mirror of https://github.com/fafhrd91/actix-web
Merge branch 'master' into master
This commit is contained in:
commit
868b5d308a
|
|
@ -26,6 +26,21 @@ jobs:
|
|||
steps:
|
||||
- uses: actions/checkout@v2
|
||||
|
||||
# install OpenSSL on Windows
|
||||
- name: Set vcpkg root
|
||||
if: matrix.target.triple == 'x86_64-pc-windows-msvc'
|
||||
run: echo "VCPKG_ROOT=$env:VCPKG_INSTALLATION_ROOT" | Out-File -FilePath $env:GITHUB_ENV -Append
|
||||
- name: Install OpenSSL
|
||||
if: matrix.target.triple == 'x86_64-pc-windows-msvc'
|
||||
run: vcpkg install openssl:x64-windows
|
||||
|
||||
- name: Install ${{ matrix.version }}
|
||||
uses: actions-rs/toolchain@v1
|
||||
with:
|
||||
toolchain: ${{ matrix.version }}-${{ matrix.target.triple }}
|
||||
profile: minimal
|
||||
override: true
|
||||
|
||||
- name: Install ${{ matrix.version }}
|
||||
uses: actions-rs/toolchain@v1
|
||||
with:
|
||||
|
|
|
|||
20
CHANGES.md
20
CHANGES.md
|
|
@ -1,10 +1,26 @@
|
|||
# Changes
|
||||
|
||||
## Unreleased - 2021-xx-xx
|
||||
### Fixed
|
||||
* Double ampersand in Logger format is escaped correctly. [#2067]
|
||||
|
||||
### Changed
|
||||
* `CustomResponder` would return error as `HttpResponse` when `CustomResponder::with_header` failed instead of skipping.
|
||||
(Only the first error is kept when multiple error occur) [#2093]
|
||||
|
||||
### Removed
|
||||
* The `client` mod was removed. Clients should now use `awc` directly.
|
||||
[871ca5e4](https://github.com/actix/actix-web/commit/871ca5e4ae2bdc22d1ea02701c2992fa8d04aed7)
|
||||
|
||||
[#2067]: https://github.com/actix/actix-web/pull/2067
|
||||
[#2093]: https://github.com/actix/actix-web/pull/2093
|
||||
|
||||
|
||||
## 4.0.0-beta.4 - 2021-03-09
|
||||
### Changed
|
||||
* Feature `cookies` is now optional and enabled by default. [#1981]
|
||||
* `JsonBody::new` returns a default limit of 32kB to be consistent with `JsonConfig` and the
|
||||
default behaviour of the `web::Json<T>` extractor. [#2010]
|
||||
* `JsonBody::new` returns a default limit of 32kB to be consistent with `JsonConfig` and the default
|
||||
behaviour of the `web::Json<T>` extractor. [#2010]
|
||||
|
||||
[#1981]: https://github.com/actix/actix-web/pull/1981
|
||||
[#2010]: https://github.com/actix/actix-web/pull/2010
|
||||
|
|
|
|||
16
Cargo.toml
16
Cargo.toml
|
|
@ -1,6 +1,6 @@
|
|||
[package]
|
||||
name = "actix-web"
|
||||
version = "4.0.0-beta.3"
|
||||
version = "4.0.0-beta.4"
|
||||
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
|
||||
description = "Actix Web is a powerful, pragmatic, and extremely fast web framework for Rust"
|
||||
readme = "README.md"
|
||||
|
|
@ -86,9 +86,9 @@ actix-service = "2.0.0-beta.4"
|
|||
actix-utils = "3.0.0-beta.2"
|
||||
actix-tls = { version = "3.0.0-beta.4", default-features = false, optional = true }
|
||||
|
||||
actix-web-codegen = "0.5.0-beta.1"
|
||||
actix-http = "3.0.0-beta.3"
|
||||
awc = { version = "3.0.0-beta.2", default-features = false }
|
||||
actix-web-codegen = "0.5.0-beta.2"
|
||||
actix-http = "3.0.0-beta.4"
|
||||
awc = { version = "3.0.0-beta.3", default-features = false }
|
||||
|
||||
ahash = "0.7"
|
||||
bytes = "1"
|
||||
|
|
@ -105,18 +105,12 @@ serde = { version = "1.0", features = ["derive"] }
|
|||
serde_json = "1.0"
|
||||
serde_urlencoded = "0.7"
|
||||
smallvec = "1.6"
|
||||
socket2 = "0.3.16"
|
||||
socket2 = "0.4.0"
|
||||
time = { version = "0.2.23", default-features = false, features = ["std"] }
|
||||
tls-openssl = { package = "openssl", version = "0.10.9", optional = true }
|
||||
tls-rustls = { package = "rustls", version = "0.19.0", optional = true }
|
||||
url = "2.1"
|
||||
|
||||
[target.'cfg(windows)'.dependencies.tls-openssl]
|
||||
version = "0.10.9"
|
||||
package = "openssl"
|
||||
features = ["vendored"]
|
||||
optional = true
|
||||
|
||||
[dev-dependencies]
|
||||
brotli2 = "0.3.2"
|
||||
criterion = "0.3"
|
||||
|
|
|
|||
|
|
@ -6,10 +6,10 @@
|
|||
<p>
|
||||
|
||||
[](https://crates.io/crates/actix-web)
|
||||
[](https://docs.rs/actix-web/4.0.0-beta.2)
|
||||
[](https://docs.rs/actix-web/4.0.0-beta.4)
|
||||
[](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
|
||||

|
||||
[](https://deps.rs/crate/actix-web/4.0.0-beta.2)
|
||||
[](https://deps.rs/crate/actix-web/4.0.0-beta.4)
|
||||
<br />
|
||||
[](https://github.com/actix/actix-web/actions)
|
||||
[](https://codecov.io/gh/actix/actix-web)
|
||||
|
|
|
|||
|
|
@ -3,6 +3,10 @@
|
|||
## Unreleased - 2021-xx-xx
|
||||
|
||||
|
||||
## 0.6.0-beta.3 - 2021-03-09
|
||||
* No notable changes.
|
||||
|
||||
|
||||
## 0.6.0-beta.2 - 2021-02-10
|
||||
* Fix If-Modified-Since and If-Unmodified-Since to not compare using sub-second timestamps. [#1887]
|
||||
* Replace `v_htmlescape` with `askama_escape`. [#1953]
|
||||
|
|
|
|||
|
|
@ -1,6 +1,6 @@
|
|||
[package]
|
||||
name = "actix-files"
|
||||
version = "0.6.0-beta.2"
|
||||
version = "0.6.0-beta.3"
|
||||
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
|
||||
description = "Static file serving for Actix Web"
|
||||
readme = "README.md"
|
||||
|
|
@ -17,7 +17,7 @@ name = "actix_files"
|
|||
path = "src/lib.rs"
|
||||
|
||||
[dependencies]
|
||||
actix-web = { version = "4.0.0-beta.3", default-features = false }
|
||||
actix-web = { version = "4.0.0-beta.4", default-features = false }
|
||||
actix-service = "2.0.0-beta.4"
|
||||
|
||||
askama_escape = "0.10"
|
||||
|
|
@ -34,4 +34,4 @@ percent-encoding = "2.1"
|
|||
|
||||
[dev-dependencies]
|
||||
actix-rt = "2.1"
|
||||
actix-web = "4.0.0-beta.3"
|
||||
actix-web = "4.0.0-beta.4"
|
||||
|
|
|
|||
|
|
@ -3,11 +3,11 @@
|
|||
> Static file serving for Actix Web
|
||||
|
||||
[](https://crates.io/crates/actix-files)
|
||||
[](https://docs.rs/actix-files/0.5.0)
|
||||
[](https://docs.rs/actix-files/0.6.0-beta.3)
|
||||
[](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
|
||||

|
||||
<br />
|
||||
[](https://deps.rs/crate/actix-files/0.5.0)
|
||||
[](https://deps.rs/crate/actix-files/0.6.0-beta.3)
|
||||
[](https://crates.io/crates/actix-files)
|
||||
[](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
||||
|
||||
|
|
|
|||
|
|
@ -19,7 +19,7 @@ use crate::{
|
|||
///
|
||||
/// `Files` service must be registered with `App::service()` method.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::App;
|
||||
/// use actix_files::Files;
|
||||
///
|
||||
|
|
|
|||
|
|
@ -3,7 +3,7 @@
|
|||
//! Provides a non-blocking service for serving static files from disk.
|
||||
//!
|
||||
//! # Example
|
||||
//! ```rust
|
||||
//! ```
|
||||
//! use actix_web::App;
|
||||
//! use actix_files::Files;
|
||||
//!
|
||||
|
|
|
|||
|
|
@ -60,7 +60,7 @@ impl NamedFile {
|
|||
///
|
||||
/// # Examples
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_files::NamedFile;
|
||||
/// use std::io::{self, Write};
|
||||
/// use std::env;
|
||||
|
|
@ -137,7 +137,7 @@ impl NamedFile {
|
|||
///
|
||||
/// # Examples
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_files::NamedFile;
|
||||
///
|
||||
/// let file = NamedFile::open("foo.txt");
|
||||
|
|
@ -156,7 +156,7 @@ impl NamedFile {
|
|||
///
|
||||
/// # Examples
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// # use std::io;
|
||||
/// use actix_files::NamedFile;
|
||||
///
|
||||
|
|
|
|||
|
|
@ -1,4 +1,4 @@
|
|||
use std::{fmt, io, path::PathBuf, rc::Rc, task::Poll};
|
||||
use std::{fmt, io, path::PathBuf, rc::Rc};
|
||||
|
||||
use actix_service::Service;
|
||||
use actix_web::{
|
||||
|
|
|
|||
|
|
@ -3,6 +3,10 @@
|
|||
## Unreleased - 2021-xx-xx
|
||||
|
||||
|
||||
## 3.0.0-beta.3 - 2021-03-09
|
||||
* No notable changes.
|
||||
|
||||
|
||||
## 3.0.0-beta.2 - 2021-02-10
|
||||
* No notable changes.
|
||||
|
||||
|
|
|
|||
|
|
@ -1,6 +1,6 @@
|
|||
[package]
|
||||
name = "actix-http-test"
|
||||
version = "3.0.0-beta.2"
|
||||
version = "3.0.0-beta.3"
|
||||
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
|
||||
description = "Various helpers for Actix applications to use during testing"
|
||||
readme = "README.md"
|
||||
|
|
@ -35,14 +35,14 @@ actix-tls = "3.0.0-beta.4"
|
|||
actix-utils = "3.0.0-beta.2"
|
||||
actix-rt = "2.1"
|
||||
actix-server = "2.0.0-beta.3"
|
||||
awc = { version = "3.0.0-beta.2", default-features = false }
|
||||
awc = { version = "3.0.0-beta.3", default-features = false }
|
||||
|
||||
base64 = "0.13"
|
||||
bytes = "1"
|
||||
futures-core = { version = "0.3.7", default-features = false }
|
||||
http = "0.2.2"
|
||||
log = "0.4"
|
||||
socket2 = "0.3"
|
||||
socket2 = "0.4"
|
||||
serde = "1.0"
|
||||
serde_json = "1.0"
|
||||
slab = "0.4"
|
||||
|
|
@ -50,12 +50,6 @@ serde_urlencoded = "0.7"
|
|||
time = { version = "0.2.23", default-features = false, features = ["std"] }
|
||||
tls-openssl = { version = "0.10.9", package = "openssl", optional = true }
|
||||
|
||||
[target.'cfg(windows)'.dependencies.tls-openssl]
|
||||
version = "0.10.9"
|
||||
package = "openssl"
|
||||
features = ["vendored"]
|
||||
optional = true
|
||||
|
||||
[dev-dependencies]
|
||||
actix-web = { version = "4.0.0-beta.3", default-features = false, features = ["cookies"] }
|
||||
actix-http = "3.0.0-beta.3"
|
||||
actix-web = { version = "4.0.0-beta.4", default-features = false, features = ["cookies"] }
|
||||
actix-http = "3.0.0-beta.4"
|
||||
|
|
|
|||
|
|
@ -3,9 +3,9 @@
|
|||
> Various helpers for Actix applications to use during testing.
|
||||
|
||||
[](https://crates.io/crates/actix-http-test)
|
||||
[](https://docs.rs/actix-http-test/2.1.0)
|
||||
[](https://docs.rs/actix-http-test/3.0.0-beta.3)
|
||||

|
||||
[](https://deps.rs/crate/actix-http-test/2.1.0)
|
||||
[](https://deps.rs/crate/actix-http-test/3.0.0-beta.3)
|
||||
[](https://gitter.im/actix/actix-web?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
||||
|
||||
## Documentation & Resources
|
||||
|
|
|
|||
|
|
@ -26,7 +26,7 @@ use socket2::{Domain, Protocol, Socket, Type};
|
|||
///
|
||||
/// # Examples
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_http::HttpService;
|
||||
/// use actix_http_test::TestServer;
|
||||
/// use actix_web::{web, App, HttpResponse, Error};
|
||||
|
|
@ -118,10 +118,10 @@ pub async fn test_server_with_addr<F: ServiceFactory<TcpStream>>(
|
|||
/// Get first available unused address
|
||||
pub fn unused_addr() -> net::SocketAddr {
|
||||
let addr: net::SocketAddr = "127.0.0.1:0".parse().unwrap();
|
||||
let socket = Socket::new(Domain::ipv4(), Type::stream(), Some(Protocol::tcp())).unwrap();
|
||||
let socket = Socket::new(Domain::IPV4, Type::STREAM, Some(Protocol::TCP)).unwrap();
|
||||
socket.bind(&addr.into()).unwrap();
|
||||
socket.set_reuse_address(true).unwrap();
|
||||
let tcp = socket.into_tcp_listener();
|
||||
let tcp = net::TcpListener::from(socket);
|
||||
tcp.local_addr().unwrap()
|
||||
}
|
||||
|
||||
|
|
|
|||
|
|
@ -1,13 +1,26 @@
|
|||
# Changes
|
||||
|
||||
## Unreleased - 2021-xx-xx
|
||||
### Added
|
||||
* `client::Connector::handshake_timeout` method for customize tls connection handshake timeout. [#2081]
|
||||
* `client::ConnectorService` as `client::Connector::finish` method's return type [#2081]
|
||||
* `client::ConnectionIo` trait alias [#2081]
|
||||
|
||||
### Chaged
|
||||
* `client::Connector` type now only have one generic type for `actix_service::Service`. [#2063]
|
||||
|
||||
[#2063]: https://github.com/actix/actix-web/pull/2063
|
||||
[#2081]: https://github.com/actix/actix-web/pull/2081
|
||||
|
||||
|
||||
## 3.0.0-beta.4 - 2021-03-08
|
||||
### Changed
|
||||
* Feature `cookies` is now optional and disabled by default. [#1981]
|
||||
* `ws::hash_key` now returns array. [#2035]
|
||||
* `ResponseBuilder::json` now takes `impl Serialize`. [#2052]
|
||||
|
||||
### Removed
|
||||
* re-export of `futures_channel::oneshot::Canceled` is removed from `error` mod. [#1994]
|
||||
* Re-export of `futures_channel::oneshot::Canceled` is removed from `error` mod. [#1994]
|
||||
* `ResponseError` impl for `futures_channel::oneshot::Canceled` is removed. [#1994]
|
||||
|
||||
[#1981]: https://github.com/actix/actix-web/pull/1981
|
||||
|
|
|
|||
|
|
@ -1,6 +1,6 @@
|
|||
[package]
|
||||
name = "actix-http"
|
||||
version = "3.0.0-beta.3"
|
||||
version = "3.0.0-beta.4"
|
||||
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
|
||||
description = "HTTP primitives for the Actix ecosystem"
|
||||
readme = "README.md"
|
||||
|
|
@ -55,7 +55,6 @@ base64 = "0.13"
|
|||
bitflags = "1.2"
|
||||
bytes = "1"
|
||||
bytestring = "1"
|
||||
cfg-if = "1"
|
||||
cookie = { version = "0.14.1", features = ["percent-encode"], optional = true }
|
||||
derive_more = "0.99.5"
|
||||
encoding_rs = "0.8"
|
||||
|
|
@ -89,7 +88,7 @@ trust-dns-resolver = { version = "0.20.0", optional = true }
|
|||
|
||||
[dev-dependencies]
|
||||
actix-server = "2.0.0-beta.3"
|
||||
actix-http-test = { version = "3.0.0-beta.2", features = ["openssl"] }
|
||||
actix-http-test = { version = "3.0.0-beta.3", features = ["openssl"] }
|
||||
actix-tls = { version = "3.0.0-beta.4", features = ["openssl"] }
|
||||
criterion = "0.3"
|
||||
env_logger = "0.8"
|
||||
|
|
@ -98,11 +97,6 @@ serde_derive = "1.0"
|
|||
tls-openssl = { version = "0.10", package = "openssl" }
|
||||
tls-rustls = { version = "0.19", package = "rustls" }
|
||||
|
||||
[target.'cfg(windows)'.dev-dependencies.tls-openssl]
|
||||
version = "0.10.9"
|
||||
package = "openssl"
|
||||
features = ["vendored"]
|
||||
|
||||
[[example]]
|
||||
name = "ws"
|
||||
required-features = ["rustls"]
|
||||
|
|
|
|||
|
|
@ -3,11 +3,11 @@
|
|||
> HTTP primitives for the Actix ecosystem.
|
||||
|
||||
[](https://crates.io/crates/actix-http)
|
||||
[](https://docs.rs/actix-http/3.0.0-beta.3)
|
||||
[](https://docs.rs/actix-http/3.0.0-beta.4)
|
||||
[](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
|
||||

|
||||
<br />
|
||||
[](https://deps.rs/crate/actix-http/3.0.0-beta.3)
|
||||
[](https://deps.rs/crate/actix-http/3.0.0-beta.4)
|
||||
[](https://crates.io/crates/actix-http)
|
||||
[](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
||||
|
||||
|
|
|
|||
|
|
@ -3,7 +3,7 @@ use std::{env, io};
|
|||
use actix_http::{Error, HttpService, Request, Response};
|
||||
use actix_server::Server;
|
||||
use bytes::BytesMut;
|
||||
use futures_util::StreamExt;
|
||||
use futures_util::StreamExt as _;
|
||||
use http::header::HeaderValue;
|
||||
use log::info;
|
||||
|
||||
|
|
|
|||
|
|
@ -4,7 +4,7 @@ use actix_http::http::HeaderValue;
|
|||
use actix_http::{Error, HttpService, Request, Response};
|
||||
use actix_server::Server;
|
||||
use bytes::BytesMut;
|
||||
use futures_util::StreamExt;
|
||||
use futures_util::StreamExt as _;
|
||||
use log::info;
|
||||
|
||||
async fn handle_request(mut req: Request) -> Result<Response, Error> {
|
||||
|
|
|
|||
|
|
@ -8,6 +8,7 @@ const DEFAULT_H2_STREAM_WINDOW: u32 = 1024 * 1024; // 1MB
|
|||
#[derive(Clone)]
|
||||
pub(crate) struct ConnectorConfig {
|
||||
pub(crate) timeout: Duration,
|
||||
pub(crate) handshake_timeout: Duration,
|
||||
pub(crate) conn_lifetime: Duration,
|
||||
pub(crate) conn_keep_alive: Duration,
|
||||
pub(crate) disconnect_timeout: Option<Duration>,
|
||||
|
|
@ -21,6 +22,7 @@ impl Default for ConnectorConfig {
|
|||
fn default() -> Self {
|
||||
Self {
|
||||
timeout: Duration::from_secs(5),
|
||||
handshake_timeout: Duration::from_secs(5),
|
||||
conn_lifetime: Duration::from_secs(75),
|
||||
conn_keep_alive: Duration::from_secs(15),
|
||||
disconnect_timeout: Some(Duration::from_millis(3000)),
|
||||
|
|
|
|||
|
|
@ -1,14 +1,16 @@
|
|||
use std::ops::{Deref, DerefMut};
|
||||
use std::pin::Pin;
|
||||
use std::task::{Context, Poll};
|
||||
use std::{fmt, io, time};
|
||||
use std::{
|
||||
io,
|
||||
ops::{Deref, DerefMut},
|
||||
pin::Pin,
|
||||
task::{Context, Poll},
|
||||
time,
|
||||
};
|
||||
|
||||
use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
|
||||
use actix_rt::task::JoinHandle;
|
||||
use bytes::Bytes;
|
||||
use futures_core::future::LocalBoxFuture;
|
||||
use h2::client::SendRequest;
|
||||
use pin_project::pin_project;
|
||||
|
||||
use crate::body::MessageBody;
|
||||
use crate::h1::ClientCodec;
|
||||
|
|
@ -19,28 +21,148 @@ use super::error::SendRequestError;
|
|||
use super::pool::Acquired;
|
||||
use super::{h1proto, h2proto};
|
||||
|
||||
pub(crate) enum ConnectionType<Io> {
|
||||
H1(Io),
|
||||
H2(H2Connection),
|
||||
/// Trait alias for types impl [tokio::io::AsyncRead] and [tokio::io::AsyncWrite].
|
||||
pub trait ConnectionIo: AsyncRead + AsyncWrite + Unpin + 'static {}
|
||||
|
||||
impl<T: AsyncRead + AsyncWrite + Unpin + 'static> ConnectionIo for T {}
|
||||
|
||||
/// HTTP client connection
|
||||
pub struct H1Connection<Io: ConnectionIo> {
|
||||
io: Option<Io>,
|
||||
created: time::Instant,
|
||||
acquired: Acquired<Io>,
|
||||
}
|
||||
|
||||
/// `H2Connection` has two parts: `SendRequest` and `Connection`.
|
||||
impl<Io: ConnectionIo> H1Connection<Io> {
|
||||
/// close or release the connection to pool based on flag input
|
||||
pub(super) fn on_release(&mut self, keep_alive: bool) {
|
||||
if keep_alive {
|
||||
self.release();
|
||||
} else {
|
||||
self.close();
|
||||
}
|
||||
}
|
||||
|
||||
/// Close connection
|
||||
fn close(&mut self) {
|
||||
let io = self.io.take().unwrap();
|
||||
self.acquired.close(ConnectionInnerType::H1(io));
|
||||
}
|
||||
|
||||
/// Release this connection to the connection pool
|
||||
fn release(&mut self) {
|
||||
let io = self.io.take().unwrap();
|
||||
self.acquired
|
||||
.release(ConnectionInnerType::H1(io), self.created);
|
||||
}
|
||||
|
||||
fn io_pin_mut(self: Pin<&mut Self>) -> Pin<&mut Io> {
|
||||
Pin::new(self.get_mut().io.as_mut().unwrap())
|
||||
}
|
||||
}
|
||||
|
||||
impl<Io: ConnectionIo> AsyncRead for H1Connection<Io> {
|
||||
fn poll_read(
|
||||
self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
buf: &mut ReadBuf<'_>,
|
||||
) -> Poll<io::Result<()>> {
|
||||
self.io_pin_mut().poll_read(cx, buf)
|
||||
}
|
||||
}
|
||||
|
||||
impl<Io: ConnectionIo> AsyncWrite for H1Connection<Io> {
|
||||
fn poll_write(
|
||||
self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
buf: &[u8],
|
||||
) -> Poll<io::Result<usize>> {
|
||||
self.io_pin_mut().poll_write(cx, buf)
|
||||
}
|
||||
|
||||
fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
|
||||
self.io_pin_mut().poll_flush(cx)
|
||||
}
|
||||
|
||||
fn poll_shutdown(
|
||||
self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
) -> Poll<Result<(), io::Error>> {
|
||||
self.io_pin_mut().poll_shutdown(cx)
|
||||
}
|
||||
|
||||
fn poll_write_vectored(
|
||||
self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
bufs: &[io::IoSlice<'_>],
|
||||
) -> Poll<io::Result<usize>> {
|
||||
self.io_pin_mut().poll_write_vectored(cx, bufs)
|
||||
}
|
||||
|
||||
fn is_write_vectored(&self) -> bool {
|
||||
self.io.as_ref().unwrap().is_write_vectored()
|
||||
}
|
||||
}
|
||||
|
||||
/// HTTP2 client connection
|
||||
pub struct H2Connection<Io: ConnectionIo> {
|
||||
io: Option<H2ConnectionInner>,
|
||||
created: time::Instant,
|
||||
acquired: Acquired<Io>,
|
||||
}
|
||||
|
||||
impl<Io: ConnectionIo> Deref for H2Connection<Io> {
|
||||
type Target = SendRequest<Bytes>;
|
||||
|
||||
fn deref(&self) -> &Self::Target {
|
||||
&self.io.as_ref().unwrap().sender
|
||||
}
|
||||
}
|
||||
|
||||
impl<Io: ConnectionIo> DerefMut for H2Connection<Io> {
|
||||
fn deref_mut(&mut self) -> &mut Self::Target {
|
||||
&mut self.io.as_mut().unwrap().sender
|
||||
}
|
||||
}
|
||||
|
||||
impl<Io: ConnectionIo> H2Connection<Io> {
|
||||
/// close or release the connection to pool based on flag input
|
||||
pub(super) fn on_release(&mut self, close: bool) {
|
||||
if close {
|
||||
self.close();
|
||||
} else {
|
||||
self.release();
|
||||
}
|
||||
}
|
||||
|
||||
/// Close connection
|
||||
fn close(&mut self) {
|
||||
let io = self.io.take().unwrap();
|
||||
self.acquired.close(ConnectionInnerType::H2(io));
|
||||
}
|
||||
|
||||
/// Release this connection to the connection pool
|
||||
fn release(&mut self) {
|
||||
let io = self.io.take().unwrap();
|
||||
self.acquired
|
||||
.release(ConnectionInnerType::H2(io), self.created);
|
||||
}
|
||||
}
|
||||
|
||||
/// `H2ConnectionInner` has two parts: `SendRequest` and `Connection`.
|
||||
///
|
||||
/// `Connection` is spawned as an async task on runtime and `H2Connection` holds a handle for
|
||||
/// this task. Therefore, it can wake up and quit the task when SendRequest is dropped.
|
||||
pub(crate) struct H2Connection {
|
||||
/// `Connection` is spawned as an async task on runtime and `H2ConnectionInner` holds a handle
|
||||
/// for this task. Therefore, it can wake up and quit the task when SendRequest is dropped.
|
||||
pub(super) struct H2ConnectionInner {
|
||||
handle: JoinHandle<()>,
|
||||
sender: SendRequest<Bytes>,
|
||||
}
|
||||
|
||||
impl H2Connection {
|
||||
pub(crate) fn new<Io>(
|
||||
impl H2ConnectionInner {
|
||||
pub(super) fn new<Io: ConnectionIo>(
|
||||
sender: SendRequest<Bytes>,
|
||||
connection: h2::client::Connection<Io>,
|
||||
) -> Self
|
||||
where
|
||||
Io: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
{
|
||||
) -> Self {
|
||||
let handle = actix_rt::spawn(async move {
|
||||
let _ = connection.await;
|
||||
});
|
||||
|
|
@ -49,161 +171,86 @@ impl H2Connection {
|
|||
}
|
||||
}
|
||||
|
||||
// cancel spawned connection task on drop.
|
||||
impl Drop for H2Connection {
|
||||
/// Cancel spawned connection task on drop.
|
||||
impl Drop for H2ConnectionInner {
|
||||
fn drop(&mut self) {
|
||||
if self
|
||||
.sender
|
||||
.send_request(http::Request::new(()), true)
|
||||
.is_err()
|
||||
{
|
||||
self.handle.abort();
|
||||
}
|
||||
}
|
||||
|
||||
// only expose sender type to public.
|
||||
impl Deref for H2Connection {
|
||||
type Target = SendRequest<Bytes>;
|
||||
|
||||
fn deref(&self) -> &Self::Target {
|
||||
&self.sender
|
||||
}
|
||||
}
|
||||
|
||||
impl DerefMut for H2Connection {
|
||||
fn deref_mut(&mut self) -> &mut Self::Target {
|
||||
&mut self.sender
|
||||
}
|
||||
}
|
||||
|
||||
pub trait Connection {
|
||||
type Io: AsyncRead + AsyncWrite + Unpin;
|
||||
|
||||
/// Send request and body
|
||||
fn send_request<B, H>(
|
||||
self,
|
||||
head: H,
|
||||
body: B,
|
||||
) -> LocalBoxFuture<'static, Result<(ResponseHead, Payload), SendRequestError>>
|
||||
where
|
||||
B: MessageBody + 'static,
|
||||
H: Into<RequestHeadType> + 'static;
|
||||
|
||||
/// Send request, returns Response and Framed
|
||||
fn open_tunnel<H: Into<RequestHeadType> + 'static>(
|
||||
self,
|
||||
head: H,
|
||||
) -> LocalBoxFuture<
|
||||
'static,
|
||||
Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
|
||||
>;
|
||||
}
|
||||
|
||||
pub(crate) trait ConnectionLifetime: AsyncRead + AsyncWrite + 'static {
|
||||
/// Close connection
|
||||
fn close(self: Pin<&mut Self>);
|
||||
|
||||
/// Release connection to the connection pool
|
||||
fn release(self: Pin<&mut Self>);
|
||||
}
|
||||
|
||||
#[doc(hidden)]
|
||||
/// HTTP client connection
|
||||
pub struct IoConnection<T>
|
||||
where
|
||||
T: AsyncWrite + Unpin + 'static,
|
||||
{
|
||||
io: Option<ConnectionType<T>>,
|
||||
created: time::Instant,
|
||||
pool: Option<Acquired<T>>,
|
||||
}
|
||||
|
||||
impl<T> fmt::Debug for IoConnection<T>
|
||||
where
|
||||
T: AsyncWrite + Unpin + fmt::Debug + 'static,
|
||||
{
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
match self.io {
|
||||
Some(ConnectionType::H1(ref io)) => write!(f, "H1Connection({:?})", io),
|
||||
Some(ConnectionType::H2(_)) => write!(f, "H2Connection"),
|
||||
None => write!(f, "Connection(Empty)"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<T: AsyncRead + AsyncWrite + Unpin> IoConnection<T> {
|
||||
pub(crate) fn new(
|
||||
io: ConnectionType<T>,
|
||||
created: time::Instant,
|
||||
pool: Option<Acquired<T>>,
|
||||
) -> Self {
|
||||
IoConnection {
|
||||
pool,
|
||||
created,
|
||||
io: Some(io),
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn into_inner(self) -> (ConnectionType<T>, time::Instant) {
|
||||
(self.io.unwrap(), self.created)
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
pub(crate) fn into_parts(self) -> (ConnectionType<T>, time::Instant, Acquired<T>) {
|
||||
(self.io.unwrap(), self.created, self.pool.unwrap())
|
||||
}
|
||||
|
||||
async fn send_request<B: MessageBody + 'static, H: Into<RequestHeadType>>(
|
||||
mut self,
|
||||
head: H,
|
||||
body: B,
|
||||
) -> Result<(ResponseHead, Payload), SendRequestError> {
|
||||
match self.io.take().unwrap() {
|
||||
ConnectionType::H1(io) => {
|
||||
h1proto::send_request(io, head.into(), body, self.created, self.pool)
|
||||
.await
|
||||
}
|
||||
ConnectionType::H2(io) => {
|
||||
h2proto::send_request(io, head.into(), body, self.created, self.pool)
|
||||
.await
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Send request, returns Response and Framed
|
||||
async fn open_tunnel<H: Into<RequestHeadType>>(
|
||||
mut self,
|
||||
head: H,
|
||||
) -> Result<(ResponseHead, Framed<T, ClientCodec>), SendRequestError> {
|
||||
match self.io.take().unwrap() {
|
||||
ConnectionType::H1(io) => h1proto::open_tunnel(io, head.into()).await,
|
||||
ConnectionType::H2(io) => {
|
||||
if let Some(mut pool) = self.pool.take() {
|
||||
pool.release(IoConnection::new(
|
||||
ConnectionType::H2(io),
|
||||
self.created,
|
||||
None,
|
||||
));
|
||||
}
|
||||
Err(SendRequestError::TunnelNotSupported)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[allow(dead_code)]
|
||||
pub(crate) enum EitherIoConnection<A, B>
|
||||
/// Unified connection type cover Http1 Plain/Tls and Http2 protocols
|
||||
pub enum Connection<A, B = Box<dyn ConnectionIo>>
|
||||
where
|
||||
A: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
B: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
A: ConnectionIo,
|
||||
B: ConnectionIo,
|
||||
{
|
||||
A(IoConnection<A>),
|
||||
B(IoConnection<B>),
|
||||
Tcp(ConnectionType<A>),
|
||||
Tls(ConnectionType<B>),
|
||||
}
|
||||
|
||||
impl<A, B> Connection for EitherIoConnection<A, B>
|
||||
where
|
||||
A: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
B: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
{
|
||||
type Io = EitherIo<A, B>;
|
||||
/// Unified connection type cover Http1/2 protocols
|
||||
pub enum ConnectionType<Io: ConnectionIo> {
|
||||
H1(H1Connection<Io>),
|
||||
H2(H2Connection<Io>),
|
||||
}
|
||||
|
||||
fn send_request<RB, H>(
|
||||
/// Helper type for storing connection types in pool.
|
||||
pub(super) enum ConnectionInnerType<Io> {
|
||||
H1(Io),
|
||||
H2(H2ConnectionInner),
|
||||
}
|
||||
|
||||
impl<Io: ConnectionIo> ConnectionType<Io> {
|
||||
pub(super) fn from_pool(
|
||||
inner: ConnectionInnerType<Io>,
|
||||
created: time::Instant,
|
||||
acquired: Acquired<Io>,
|
||||
) -> Self {
|
||||
match inner {
|
||||
ConnectionInnerType::H1(io) => Self::from_h1(io, created, acquired),
|
||||
ConnectionInnerType::H2(io) => Self::from_h2(io, created, acquired),
|
||||
}
|
||||
}
|
||||
|
||||
pub(super) fn from_h1(
|
||||
io: Io,
|
||||
created: time::Instant,
|
||||
acquired: Acquired<Io>,
|
||||
) -> Self {
|
||||
Self::H1(H1Connection {
|
||||
io: Some(io),
|
||||
created,
|
||||
acquired,
|
||||
})
|
||||
}
|
||||
|
||||
pub(super) fn from_h2(
|
||||
io: H2ConnectionInner,
|
||||
created: time::Instant,
|
||||
acquired: Acquired<Io>,
|
||||
) -> Self {
|
||||
Self::H2(H2Connection {
|
||||
io: Some(io),
|
||||
created,
|
||||
acquired,
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
impl<A, B> Connection<A, B>
|
||||
where
|
||||
A: ConnectionIo,
|
||||
B: ConnectionIo,
|
||||
{
|
||||
/// Send a request through connection.
|
||||
pub fn send_request<RB, H>(
|
||||
self,
|
||||
head: H,
|
||||
body: RB,
|
||||
|
|
@ -212,76 +259,106 @@ where
|
|||
RB: MessageBody + 'static,
|
||||
H: Into<RequestHeadType> + 'static,
|
||||
{
|
||||
Box::pin(async move {
|
||||
match self {
|
||||
EitherIoConnection::A(con) => Box::pin(con.send_request(head, body)),
|
||||
EitherIoConnection::B(con) => Box::pin(con.send_request(head, body)),
|
||||
Connection::Tcp(ConnectionType::H1(conn)) => {
|
||||
h1proto::send_request(conn, head.into(), body).await
|
||||
}
|
||||
Connection::Tls(ConnectionType::H1(conn)) => {
|
||||
h1proto::send_request(conn, head.into(), body).await
|
||||
}
|
||||
Connection::Tls(ConnectionType::H2(conn)) => {
|
||||
h2proto::send_request(conn, head.into(), body).await
|
||||
}
|
||||
_ => unreachable!(
|
||||
"Plain Tcp connection can be used only in Http1 protocol"
|
||||
),
|
||||
}
|
||||
})
|
||||
}
|
||||
|
||||
/// Send request, returns Response and Framed
|
||||
fn open_tunnel<H: Into<RequestHeadType> + 'static>(
|
||||
/// Send request, returns Response and Framed tunnel.
|
||||
pub fn open_tunnel<H: Into<RequestHeadType> + 'static>(
|
||||
self,
|
||||
head: H,
|
||||
) -> LocalBoxFuture<
|
||||
'static,
|
||||
Result<(ResponseHead, Framed<Self::Io, ClientCodec>), SendRequestError>,
|
||||
Result<(ResponseHead, Framed<Connection<A, B>, ClientCodec>), SendRequestError>,
|
||||
> {
|
||||
Box::pin(async move {
|
||||
match self {
|
||||
EitherIoConnection::A(con) => Box::pin(async {
|
||||
let (head, framed) = con.open_tunnel(head).await?;
|
||||
Ok((head, framed.into_map_io(EitherIo::A)))
|
||||
}),
|
||||
EitherIoConnection::B(con) => Box::pin(async {
|
||||
let (head, framed) = con.open_tunnel(head).await?;
|
||||
Ok((head, framed.into_map_io(EitherIo::B)))
|
||||
}),
|
||||
Connection::Tcp(ConnectionType::H1(ref _conn)) => {
|
||||
let (head, framed) = h1proto::open_tunnel(self, head.into()).await?;
|
||||
Ok((head, framed))
|
||||
}
|
||||
Connection::Tls(ConnectionType::H1(ref _conn)) => {
|
||||
let (head, framed) = h1proto::open_tunnel(self, head.into()).await?;
|
||||
Ok((head, framed))
|
||||
}
|
||||
Connection::Tls(ConnectionType::H2(mut conn)) => {
|
||||
conn.release();
|
||||
Err(SendRequestError::TunnelNotSupported)
|
||||
}
|
||||
Connection::Tcp(ConnectionType::H2(_)) => {
|
||||
unreachable!(
|
||||
"Plain Tcp connection can be used only in Http1 protocol"
|
||||
)
|
||||
}
|
||||
}
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
#[pin_project(project = EitherIoProj)]
|
||||
pub enum EitherIo<A, B> {
|
||||
A(#[pin] A),
|
||||
B(#[pin] B),
|
||||
}
|
||||
|
||||
impl<A, B> AsyncRead for EitherIo<A, B>
|
||||
impl<A, B> AsyncRead for Connection<A, B>
|
||||
where
|
||||
A: AsyncRead,
|
||||
B: AsyncRead,
|
||||
A: ConnectionIo,
|
||||
B: ConnectionIo,
|
||||
{
|
||||
fn poll_read(
|
||||
self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
buf: &mut ReadBuf<'_>,
|
||||
) -> Poll<io::Result<()>> {
|
||||
match self.project() {
|
||||
EitherIoProj::A(val) => val.poll_read(cx, buf),
|
||||
EitherIoProj::B(val) => val.poll_read(cx, buf),
|
||||
match self.get_mut() {
|
||||
Connection::Tcp(ConnectionType::H1(conn)) => {
|
||||
Pin::new(conn).poll_read(cx, buf)
|
||||
}
|
||||
Connection::Tls(ConnectionType::H1(conn)) => {
|
||||
Pin::new(conn).poll_read(cx, buf)
|
||||
}
|
||||
_ => unreachable!("H2Connection can not impl AsyncRead trait"),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<A, B> AsyncWrite for EitherIo<A, B>
|
||||
const H2_UNREACHABLE_WRITE: &str = "H2Connection can not impl AsyncWrite trait";
|
||||
|
||||
impl<A, B> AsyncWrite for Connection<A, B>
|
||||
where
|
||||
A: AsyncWrite,
|
||||
B: AsyncWrite,
|
||||
A: ConnectionIo,
|
||||
B: ConnectionIo,
|
||||
{
|
||||
fn poll_write(
|
||||
self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
buf: &[u8],
|
||||
) -> Poll<io::Result<usize>> {
|
||||
match self.project() {
|
||||
EitherIoProj::A(val) => val.poll_write(cx, buf),
|
||||
EitherIoProj::B(val) => val.poll_write(cx, buf),
|
||||
match self.get_mut() {
|
||||
Connection::Tcp(ConnectionType::H1(conn)) => {
|
||||
Pin::new(conn).poll_write(cx, buf)
|
||||
}
|
||||
Connection::Tls(ConnectionType::H1(conn)) => {
|
||||
Pin::new(conn).poll_write(cx, buf)
|
||||
}
|
||||
_ => unreachable!(H2_UNREACHABLE_WRITE),
|
||||
}
|
||||
}
|
||||
|
||||
fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
|
||||
match self.project() {
|
||||
EitherIoProj::A(val) => val.poll_flush(cx),
|
||||
EitherIoProj::B(val) => val.poll_flush(cx),
|
||||
match self.get_mut() {
|
||||
Connection::Tcp(ConnectionType::H1(conn)) => Pin::new(conn).poll_flush(cx),
|
||||
Connection::Tls(ConnectionType::H1(conn)) => Pin::new(conn).poll_flush(cx),
|
||||
_ => unreachable!(H2_UNREACHABLE_WRITE),
|
||||
}
|
||||
}
|
||||
|
||||
|
|
@ -289,18 +366,56 @@ where
|
|||
self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
) -> Poll<io::Result<()>> {
|
||||
match self.project() {
|
||||
EitherIoProj::A(val) => val.poll_shutdown(cx),
|
||||
EitherIoProj::B(val) => val.poll_shutdown(cx),
|
||||
match self.get_mut() {
|
||||
Connection::Tcp(ConnectionType::H1(conn)) => {
|
||||
Pin::new(conn).poll_shutdown(cx)
|
||||
}
|
||||
Connection::Tls(ConnectionType::H1(conn)) => {
|
||||
Pin::new(conn).poll_shutdown(cx)
|
||||
}
|
||||
_ => unreachable!(H2_UNREACHABLE_WRITE),
|
||||
}
|
||||
}
|
||||
|
||||
fn poll_write_vectored(
|
||||
self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
bufs: &[io::IoSlice<'_>],
|
||||
) -> Poll<io::Result<usize>> {
|
||||
match self.get_mut() {
|
||||
Connection::Tcp(ConnectionType::H1(conn)) => {
|
||||
Pin::new(conn).poll_write_vectored(cx, bufs)
|
||||
}
|
||||
Connection::Tls(ConnectionType::H1(conn)) => {
|
||||
Pin::new(conn).poll_write_vectored(cx, bufs)
|
||||
}
|
||||
_ => unreachable!(H2_UNREACHABLE_WRITE),
|
||||
}
|
||||
}
|
||||
|
||||
fn is_write_vectored(&self) -> bool {
|
||||
match *self {
|
||||
Connection::Tcp(ConnectionType::H1(ref conn)) => conn.is_write_vectored(),
|
||||
Connection::Tls(ConnectionType::H1(ref conn)) => conn.is_write_vectored(),
|
||||
_ => unreachable!(H2_UNREACHABLE_WRITE),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(test)]
|
||||
mod test {
|
||||
use std::net;
|
||||
use std::{
|
||||
future::Future,
|
||||
net,
|
||||
pin::Pin,
|
||||
task::{Context, Poll},
|
||||
time::{Duration, Instant},
|
||||
};
|
||||
|
||||
use actix_rt::net::TcpStream;
|
||||
use actix_rt::{
|
||||
net::TcpStream,
|
||||
time::{interval, Interval},
|
||||
};
|
||||
|
||||
use super::*;
|
||||
|
||||
|
|
@ -314,16 +429,46 @@ mod test {
|
|||
|
||||
let tcp = TcpStream::connect(local).await.unwrap();
|
||||
let (sender, connection) = h2::client::handshake(tcp).await.unwrap();
|
||||
let conn = H2Connection::new(sender.clone(), connection);
|
||||
let conn = H2ConnectionInner::new(sender.clone(), connection);
|
||||
|
||||
assert!(sender.clone().ready().await.is_ok());
|
||||
assert!(h2::client::SendRequest::clone(&*conn).ready().await.is_ok());
|
||||
assert!(h2::client::SendRequest::clone(&conn.sender)
|
||||
.ready()
|
||||
.await
|
||||
.is_ok());
|
||||
|
||||
drop(conn);
|
||||
|
||||
match sender.ready().await {
|
||||
Ok(_) => panic!("connection should be gone and can not be ready"),
|
||||
Err(e) => assert!(e.is_io()),
|
||||
};
|
||||
struct DropCheck {
|
||||
sender: h2::client::SendRequest<Bytes>,
|
||||
interval: Interval,
|
||||
start_from: Instant,
|
||||
}
|
||||
|
||||
impl Future for DropCheck {
|
||||
type Output = ();
|
||||
|
||||
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
|
||||
let this = self.get_mut();
|
||||
match futures_core::ready!(this.sender.poll_ready(cx)) {
|
||||
Ok(()) => {
|
||||
if this.start_from.elapsed() > Duration::from_secs(10) {
|
||||
panic!("connection should be gone and can not be ready");
|
||||
} else {
|
||||
let _ = this.interval.poll_tick(cx);
|
||||
Poll::Pending
|
||||
}
|
||||
}
|
||||
Err(_) => Poll::Ready(()),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
DropCheck {
|
||||
sender,
|
||||
interval: interval(Duration::from_millis(100)),
|
||||
start_from: Instant::now(),
|
||||
}
|
||||
.await;
|
||||
}
|
||||
}
|
||||
|
|
|
|||
|
|
@ -1,51 +1,53 @@
|
|||
use std::{
|
||||
fmt,
|
||||
future::Future,
|
||||
marker::PhantomData,
|
||||
net::IpAddr,
|
||||
pin::Pin,
|
||||
rc::Rc,
|
||||
task::{Context, Poll},
|
||||
time::Duration,
|
||||
};
|
||||
|
||||
use actix_codec::{AsyncRead, AsyncWrite};
|
||||
use actix_rt::net::TcpStream;
|
||||
use actix_service::{apply_fn, Service, ServiceExt};
|
||||
use actix_tls::connect::{
|
||||
new_connector, Connect as TcpConnect, Connection as TcpConnection, Resolver,
|
||||
use actix_rt::{
|
||||
net::TcpStream,
|
||||
time::{sleep, Sleep},
|
||||
};
|
||||
use actix_utils::timeout::{TimeoutError, TimeoutService};
|
||||
use actix_service::Service;
|
||||
use actix_tls::connect::{
|
||||
new_connector, Connect as TcpConnect, ConnectError as TcpConnectError,
|
||||
Connection as TcpConnection, Resolver,
|
||||
};
|
||||
use futures_core::{future::LocalBoxFuture, ready};
|
||||
use http::Uri;
|
||||
use pin_project::pin_project;
|
||||
|
||||
use super::config::ConnectorConfig;
|
||||
use super::connection::{Connection, EitherIoConnection};
|
||||
use super::connection::{Connection, ConnectionIo};
|
||||
use super::error::ConnectError;
|
||||
use super::pool::{ConnectionPool, Protocol};
|
||||
use super::pool::ConnectionPool;
|
||||
use super::Connect;
|
||||
use super::Protocol;
|
||||
|
||||
#[cfg(feature = "openssl")]
|
||||
use actix_tls::connect::ssl::openssl::SslConnector as OpensslConnector;
|
||||
#[cfg(feature = "rustls")]
|
||||
use actix_tls::connect::ssl::rustls::ClientConfig;
|
||||
#[cfg(feature = "rustls")]
|
||||
use std::sync::Arc;
|
||||
|
||||
#[cfg(any(feature = "openssl", feature = "rustls"))]
|
||||
enum SslConnector {
|
||||
#[allow(dead_code)]
|
||||
None,
|
||||
#[cfg(feature = "openssl")]
|
||||
Openssl(OpensslConnector),
|
||||
#[cfg(feature = "rustls")]
|
||||
Rustls(Arc<ClientConfig>),
|
||||
Rustls(std::sync::Arc<ClientConfig>),
|
||||
}
|
||||
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
|
||||
type SslConnector = ();
|
||||
|
||||
/// Manages HTTP client network connectivity.
|
||||
///
|
||||
/// The `Connector` type uses a builder-like combinator pattern for service
|
||||
/// construction that finishes by calling the `.finish()` method.
|
||||
///
|
||||
/// ```rust,ignore
|
||||
/// ```ignore
|
||||
/// use std::time::Duration;
|
||||
/// use actix_http::client::Connector;
|
||||
///
|
||||
|
|
@ -53,18 +55,14 @@ type SslConnector = ();
|
|||
/// .timeout(Duration::from_secs(5))
|
||||
/// .finish();
|
||||
/// ```
|
||||
pub struct Connector<T, U> {
|
||||
pub struct Connector<T> {
|
||||
connector: T,
|
||||
config: ConnectorConfig,
|
||||
#[allow(dead_code)]
|
||||
ssl: SslConnector,
|
||||
_phantom: PhantomData<U>,
|
||||
}
|
||||
|
||||
pub trait Io: AsyncRead + AsyncWrite + Unpin {}
|
||||
impl<T: AsyncRead + AsyncWrite + Unpin> Io for T {}
|
||||
|
||||
impl Connector<(), ()> {
|
||||
impl Connector<()> {
|
||||
#[allow(clippy::new_ret_no_self, clippy::let_unit_value)]
|
||||
pub fn new() -> Connector<
|
||||
impl Service<
|
||||
|
|
@ -72,13 +70,11 @@ impl Connector<(), ()> {
|
|||
Response = TcpConnection<Uri, TcpStream>,
|
||||
Error = actix_tls::connect::ConnectError,
|
||||
> + Clone,
|
||||
TcpStream,
|
||||
> {
|
||||
Connector {
|
||||
ssl: Self::build_ssl(vec![b"h2".to_vec(), b"http/1.1".to_vec()]),
|
||||
connector: new_connector(resolver::resolver()),
|
||||
config: ConnectorConfig::default(),
|
||||
_phantom: PhantomData,
|
||||
}
|
||||
}
|
||||
|
||||
|
|
@ -109,51 +105,59 @@ impl Connector<(), ()> {
|
|||
config.root_store.add_server_trust_anchors(
|
||||
&actix_tls::connect::ssl::rustls::TLS_SERVER_ROOTS,
|
||||
);
|
||||
SslConnector::Rustls(Arc::new(config))
|
||||
SslConnector::Rustls(std::sync::Arc::new(config))
|
||||
}
|
||||
|
||||
// ssl turned off, provides empty ssl connector
|
||||
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
|
||||
fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {}
|
||||
fn build_ssl(_: Vec<Vec<u8>>) -> SslConnector {
|
||||
SslConnector::None
|
||||
}
|
||||
}
|
||||
|
||||
impl<T, U> Connector<T, U> {
|
||||
impl<S> Connector<S> {
|
||||
/// Use custom connector.
|
||||
pub fn connector<T1, U1>(self, connector: T1) -> Connector<T1, U1>
|
||||
pub fn connector<S1, Io1>(self, connector: S1) -> Connector<S1>
|
||||
where
|
||||
U1: AsyncRead + AsyncWrite + Unpin + fmt::Debug,
|
||||
T1: Service<
|
||||
Io1: ConnectionIo + fmt::Debug,
|
||||
S1: Service<
|
||||
TcpConnect<Uri>,
|
||||
Response = TcpConnection<Uri, U1>,
|
||||
Error = actix_tls::connect::ConnectError,
|
||||
Response = TcpConnection<Uri, Io1>,
|
||||
Error = TcpConnectError,
|
||||
> + Clone,
|
||||
{
|
||||
Connector {
|
||||
connector,
|
||||
config: self.config,
|
||||
ssl: self.ssl,
|
||||
_phantom: PhantomData,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<T, U> Connector<T, U>
|
||||
impl<S, Io> Connector<S>
|
||||
where
|
||||
U: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
|
||||
T: Service<
|
||||
Io: ConnectionIo + fmt::Debug,
|
||||
S: Service<
|
||||
TcpConnect<Uri>,
|
||||
Response = TcpConnection<Uri, U>,
|
||||
Error = actix_tls::connect::ConnectError,
|
||||
Response = TcpConnection<Uri, Io>,
|
||||
Error = TcpConnectError,
|
||||
> + Clone
|
||||
+ 'static,
|
||||
{
|
||||
/// Connection timeout, i.e. max time to connect to remote host including dns name resolution.
|
||||
/// Set to 1 second by default.
|
||||
/// Tcp connection timeout, i.e. max time to connect to remote host including dns name
|
||||
/// resolution. Set to 5 second by default.
|
||||
pub fn timeout(mut self, timeout: Duration) -> Self {
|
||||
self.config.timeout = timeout;
|
||||
self
|
||||
}
|
||||
|
||||
/// Tls handshake timeout, i.e. max time to do tls handshake with remote host after tcp
|
||||
/// connection established. Set to 5 second by default.
|
||||
pub fn handshake_timeout(mut self, timeout: Duration) -> Self {
|
||||
self.config.handshake_timeout = timeout;
|
||||
self
|
||||
}
|
||||
|
||||
#[cfg(feature = "openssl")]
|
||||
/// Use custom `SslConnector` instance.
|
||||
pub fn ssl(mut self, connector: OpensslConnector) -> Self {
|
||||
|
|
@ -162,7 +166,8 @@ where
|
|||
}
|
||||
|
||||
#[cfg(feature = "rustls")]
|
||||
pub fn rustls(mut self, connector: Arc<ClientConfig>) -> Self {
|
||||
/// Use custom `SslConnector` instance.
|
||||
pub fn rustls(mut self, connector: std::sync::Arc<ClientConfig>) -> Self {
|
||||
self.ssl = SslConnector::Rustls(connector);
|
||||
self
|
||||
}
|
||||
|
|
@ -252,104 +257,63 @@ where
|
|||
/// Finish configuration process and create connector service.
|
||||
/// The Connector builder always concludes by calling `finish()` last in
|
||||
/// its combinator chain.
|
||||
pub fn finish(
|
||||
self,
|
||||
) -> impl Service<Connect, Response = impl Connection, Error = ConnectError> + Clone
|
||||
{
|
||||
pub fn finish(self) -> ConnectorService<S, Io> {
|
||||
let local_address = self.config.local_address;
|
||||
let timeout = self.config.timeout;
|
||||
|
||||
let tcp_service = TimeoutService::new(
|
||||
timeout,
|
||||
apply_fn(self.connector.clone(), move |msg: Connect, srv| {
|
||||
let mut req = TcpConnect::new(msg.uri).set_addr(msg.addr);
|
||||
let tcp_service_inner =
|
||||
TcpConnectorInnerService::new(self.connector, timeout, local_address);
|
||||
|
||||
if let Some(local_addr) = local_address {
|
||||
req = req.set_local_addr(local_addr);
|
||||
}
|
||||
#[allow(clippy::redundant_clone)]
|
||||
let tcp_service = TcpConnectorService {
|
||||
service: tcp_service_inner.clone(),
|
||||
};
|
||||
|
||||
srv.call(req)
|
||||
})
|
||||
.map_err(ConnectError::from)
|
||||
.map(|stream| (stream.into_parts().0, Protocol::Http1)),
|
||||
)
|
||||
.map_err(|e| match e {
|
||||
TimeoutError::Service(e) => e,
|
||||
TimeoutError::Timeout => ConnectError::Timeout,
|
||||
});
|
||||
|
||||
#[cfg(not(any(feature = "openssl", feature = "rustls")))]
|
||||
{
|
||||
// A dummy service for annotate tls pool's type signature.
|
||||
pub type DummyService = Box<
|
||||
dyn Service<
|
||||
Connect,
|
||||
Response = (Box<dyn Io>, Protocol),
|
||||
Error = ConnectError,
|
||||
Future = futures_core::future::LocalBoxFuture<
|
||||
'static,
|
||||
Result<(Box<dyn Io>, Protocol), ConnectError>,
|
||||
>,
|
||||
>,
|
||||
>;
|
||||
|
||||
InnerConnector::<_, DummyService, _, Box<dyn Io>> {
|
||||
tcp_pool: ConnectionPool::new(
|
||||
tcp_service,
|
||||
self.config.no_disconnect_timeout(),
|
||||
),
|
||||
tls_pool: None,
|
||||
}
|
||||
}
|
||||
|
||||
#[cfg(any(feature = "openssl", feature = "rustls"))]
|
||||
{
|
||||
let tls_service = match self.ssl {
|
||||
SslConnector::None => None,
|
||||
#[cfg(feature = "openssl")]
|
||||
SslConnector::Openssl(tls) => {
|
||||
const H2: &[u8] = b"h2";
|
||||
use actix_service::{boxed::service, pipeline};
|
||||
#[cfg(feature = "openssl")]
|
||||
use actix_tls::connect::ssl::openssl::OpensslConnector;
|
||||
#[cfg(feature = "rustls")]
|
||||
use actix_tls::connect::ssl::rustls::{RustlsConnector, Session};
|
||||
|
||||
let ssl_service = TimeoutService::new(
|
||||
timeout,
|
||||
pipeline(
|
||||
apply_fn(self.connector.clone(), move |msg: Connect, srv| {
|
||||
let mut req = TcpConnect::new(msg.uri).set_addr(msg.addr);
|
||||
use actix_tls::connect::ssl::openssl::{OpensslConnector, SslStream};
|
||||
|
||||
if let Some(local_addr) = local_address {
|
||||
req = req.set_local_addr(local_addr);
|
||||
}
|
||||
|
||||
srv.call(req)
|
||||
})
|
||||
.map_err(ConnectError::from),
|
||||
)
|
||||
.and_then(match self.ssl {
|
||||
#[cfg(feature = "openssl")]
|
||||
SslConnector::Openssl(ssl) => service(
|
||||
OpensslConnector::service(ssl)
|
||||
.map(|stream| {
|
||||
let sock = stream.into_parts().0;
|
||||
impl<Io: ConnectionIo> IntoConnectionIo for TcpConnection<Uri, SslStream<Io>> {
|
||||
fn into_connection_io(self) -> (Box<dyn ConnectionIo>, Protocol) {
|
||||
let sock = self.into_parts().0;
|
||||
let h2 = sock
|
||||
.ssl()
|
||||
.selected_alpn_protocol()
|
||||
.map(|protos| protos.windows(2).any(|w| w == H2))
|
||||
.unwrap_or(false);
|
||||
if h2 {
|
||||
(Box::new(sock) as Box<dyn Io>, Protocol::Http2)
|
||||
(Box::new(sock), Protocol::Http2)
|
||||
} else {
|
||||
(Box::new(sock) as Box<dyn Io>, Protocol::Http1)
|
||||
(Box::new(sock), Protocol::Http1)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
let handshake_timeout = self.config.handshake_timeout;
|
||||
|
||||
let tls_service = TlsConnectorService {
|
||||
tcp_service: tcp_service_inner,
|
||||
tls_service: OpensslConnector::service(tls),
|
||||
timeout: handshake_timeout,
|
||||
};
|
||||
|
||||
Some(actix_service::boxed::rc_service(tls_service))
|
||||
}
|
||||
})
|
||||
.map_err(ConnectError::from),
|
||||
),
|
||||
#[cfg(feature = "rustls")]
|
||||
SslConnector::Rustls(ssl) => service(
|
||||
RustlsConnector::service(ssl)
|
||||
.map_err(ConnectError::from)
|
||||
.map(|stream| {
|
||||
let sock = stream.into_parts().0;
|
||||
SslConnector::Rustls(tls) => {
|
||||
const H2: &[u8] = b"h2";
|
||||
|
||||
use actix_tls::connect::ssl::rustls::{
|
||||
RustlsConnector, Session, TlsStream,
|
||||
};
|
||||
|
||||
impl<Io: ConnectionIo> IntoConnectionIo for TcpConnection<Uri, TlsStream<Io>> {
|
||||
fn into_connection_io(self) -> (Box<dyn ConnectionIo>, Protocol) {
|
||||
let sock = self.into_parts().0;
|
||||
let h2 = sock
|
||||
.get_ref()
|
||||
.1
|
||||
|
|
@ -357,109 +321,360 @@ where
|
|||
.map(|protos| protos.windows(2).any(|w| w == H2))
|
||||
.unwrap_or(false);
|
||||
if h2 {
|
||||
(Box::new(sock) as Box<dyn Io>, Protocol::Http2)
|
||||
(Box::new(sock), Protocol::Http2)
|
||||
} else {
|
||||
(Box::new(sock) as Box<dyn Io>, Protocol::Http1)
|
||||
}
|
||||
}),
|
||||
),
|
||||
}),
|
||||
)
|
||||
.map_err(|e| match e {
|
||||
TimeoutError::Service(e) => e,
|
||||
TimeoutError::Timeout => ConnectError::Timeout,
|
||||
});
|
||||
|
||||
InnerConnector {
|
||||
tcp_pool: ConnectionPool::new(
|
||||
tcp_service,
|
||||
self.config.no_disconnect_timeout(),
|
||||
),
|
||||
tls_pool: Some(ConnectionPool::new(ssl_service, self.config)),
|
||||
}
|
||||
(Box::new(sock), Protocol::Http1)
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
struct InnerConnector<S1, S2, Io1, Io2>
|
||||
let handshake_timeout = self.config.handshake_timeout;
|
||||
|
||||
let tls_service = TlsConnectorService {
|
||||
tcp_service: tcp_service_inner,
|
||||
tls_service: RustlsConnector::service(tls),
|
||||
timeout: handshake_timeout,
|
||||
};
|
||||
|
||||
Some(actix_service::boxed::rc_service(tls_service))
|
||||
}
|
||||
};
|
||||
|
||||
let tcp_config = self.config.no_disconnect_timeout();
|
||||
|
||||
let tcp_pool = ConnectionPool::new(tcp_service, tcp_config);
|
||||
|
||||
let tls_config = self.config;
|
||||
let tls_pool = tls_service
|
||||
.map(move |tls_service| ConnectionPool::new(tls_service, tls_config));
|
||||
|
||||
ConnectorServicePriv { tcp_pool, tls_pool }
|
||||
}
|
||||
}
|
||||
|
||||
/// tcp service for map `TcpConnection<Uri, Io>` type to `(Io, Protocol)`
|
||||
#[derive(Clone)]
|
||||
pub struct TcpConnectorService<S: Clone> {
|
||||
service: S,
|
||||
}
|
||||
|
||||
impl<S, Io> Service<Connect> for TcpConnectorService<S>
|
||||
where
|
||||
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
|
||||
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
|
||||
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
S: Service<Connect, Response = TcpConnection<Uri, Io>, Error = ConnectError>
|
||||
+ Clone
|
||||
+ 'static,
|
||||
{
|
||||
type Response = (Io, Protocol);
|
||||
type Error = ConnectError;
|
||||
type Future = TcpConnectorFuture<S::Future>;
|
||||
|
||||
actix_service::forward_ready!(service);
|
||||
|
||||
fn call(&self, req: Connect) -> Self::Future {
|
||||
TcpConnectorFuture {
|
||||
fut: self.service.call(req),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[pin_project]
|
||||
pub struct TcpConnectorFuture<Fut> {
|
||||
#[pin]
|
||||
fut: Fut,
|
||||
}
|
||||
|
||||
impl<Fut, Io> Future for TcpConnectorFuture<Fut>
|
||||
where
|
||||
Fut: Future<Output = Result<TcpConnection<Uri, Io>, ConnectError>>,
|
||||
{
|
||||
type Output = Result<(Io, Protocol), ConnectError>;
|
||||
|
||||
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
|
||||
self.project()
|
||||
.fut
|
||||
.poll(cx)
|
||||
.map_ok(|res| (res.into_parts().0, Protocol::Http1))
|
||||
}
|
||||
}
|
||||
|
||||
/// service for establish tcp connection and do client tls handshake.
|
||||
/// operation is canceled when timeout limit reached.
|
||||
struct TlsConnectorService<S, St> {
|
||||
/// tcp connection is canceled on `TcpConnectorInnerService`'s timeout setting.
|
||||
tcp_service: S,
|
||||
/// tls connection is canceled on `TlsConnectorService`'s timeout setting.
|
||||
tls_service: St,
|
||||
timeout: Duration,
|
||||
}
|
||||
|
||||
impl<S, St, Io, Res> Service<Connect> for TlsConnectorService<S, St>
|
||||
where
|
||||
S: Service<Connect, Response = TcpConnection<Uri, Io>, Error = ConnectError>
|
||||
+ Clone
|
||||
+ 'static,
|
||||
St: Service<TcpConnection<Uri, Io>, Response = Res, Error = std::io::Error>
|
||||
+ Clone
|
||||
+ 'static,
|
||||
Io: ConnectionIo,
|
||||
Res: IntoConnectionIo,
|
||||
{
|
||||
type Response = (Box<dyn ConnectionIo>, Protocol);
|
||||
type Error = ConnectError;
|
||||
type Future = TlsConnectorFuture<St, S::Future, St::Future>;
|
||||
|
||||
fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
|
||||
ready!(self.tcp_service.poll_ready(cx))?;
|
||||
ready!(self.tls_service.poll_ready(cx))?;
|
||||
Poll::Ready(Ok(()))
|
||||
}
|
||||
|
||||
fn call(&self, req: Connect) -> Self::Future {
|
||||
let fut = self.tcp_service.call(req);
|
||||
let tls_service = self.tls_service.clone();
|
||||
let timeout = self.timeout;
|
||||
|
||||
TlsConnectorFuture::TcpConnect {
|
||||
fut,
|
||||
tls_service: Some(tls_service),
|
||||
timeout,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[pin_project(project = TlsConnectorProj)]
|
||||
#[allow(clippy::large_enum_variant)]
|
||||
enum TlsConnectorFuture<S, Fut1, Fut2> {
|
||||
TcpConnect {
|
||||
#[pin]
|
||||
fut: Fut1,
|
||||
tls_service: Option<S>,
|
||||
timeout: Duration,
|
||||
},
|
||||
TlsConnect {
|
||||
#[pin]
|
||||
fut: Fut2,
|
||||
#[pin]
|
||||
timeout: Sleep,
|
||||
},
|
||||
}
|
||||
|
||||
/// helper trait for generic over different TlsStream types between tls crates.
|
||||
trait IntoConnectionIo {
|
||||
fn into_connection_io(self) -> (Box<dyn ConnectionIo>, Protocol);
|
||||
}
|
||||
|
||||
impl<S, Io, Fut1, Fut2, Res> Future for TlsConnectorFuture<S, Fut1, Fut2>
|
||||
where
|
||||
S: Service<
|
||||
TcpConnection<Uri, Io>,
|
||||
Response = Res,
|
||||
Error = std::io::Error,
|
||||
Future = Fut2,
|
||||
>,
|
||||
Fut1: Future<Output = Result<TcpConnection<Uri, Io>, ConnectError>>,
|
||||
Fut2: Future<Output = Result<S::Response, S::Error>>,
|
||||
Io: ConnectionIo,
|
||||
Res: IntoConnectionIo,
|
||||
{
|
||||
type Output = Result<(Box<dyn ConnectionIo>, Protocol), ConnectError>;
|
||||
|
||||
fn poll(mut self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
|
||||
match self.as_mut().project() {
|
||||
TlsConnectorProj::TcpConnect {
|
||||
fut,
|
||||
tls_service,
|
||||
timeout,
|
||||
} => {
|
||||
let res = ready!(fut.poll(cx))?;
|
||||
let fut = tls_service
|
||||
.take()
|
||||
.expect("TlsConnectorFuture polled after complete")
|
||||
.call(res);
|
||||
let timeout = sleep(*timeout);
|
||||
self.set(TlsConnectorFuture::TlsConnect { fut, timeout });
|
||||
self.poll(cx)
|
||||
}
|
||||
TlsConnectorProj::TlsConnect { fut, timeout } => match fut.poll(cx)? {
|
||||
Poll::Ready(res) => Poll::Ready(Ok(res.into_connection_io())),
|
||||
Poll::Pending => timeout.poll(cx).map(|_| Err(ConnectError::Timeout)),
|
||||
},
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// service for establish tcp connection.
|
||||
/// operation is canceled when timeout limit reached.
|
||||
#[derive(Clone)]
|
||||
pub struct TcpConnectorInnerService<S: Clone> {
|
||||
service: S,
|
||||
timeout: Duration,
|
||||
local_address: Option<std::net::IpAddr>,
|
||||
}
|
||||
|
||||
impl<S: Clone> TcpConnectorInnerService<S> {
|
||||
fn new(
|
||||
service: S,
|
||||
timeout: Duration,
|
||||
local_address: Option<std::net::IpAddr>,
|
||||
) -> Self {
|
||||
Self {
|
||||
service,
|
||||
timeout,
|
||||
local_address,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<S, Io> Service<Connect> for TcpConnectorInnerService<S>
|
||||
where
|
||||
S: Service<
|
||||
TcpConnect<Uri>,
|
||||
Response = TcpConnection<Uri, Io>,
|
||||
Error = TcpConnectError,
|
||||
> + Clone
|
||||
+ 'static,
|
||||
{
|
||||
type Response = S::Response;
|
||||
type Error = ConnectError;
|
||||
type Future = TcpConnectorInnerFuture<S::Future>;
|
||||
|
||||
actix_service::forward_ready!(service);
|
||||
|
||||
fn call(&self, req: Connect) -> Self::Future {
|
||||
let mut req = TcpConnect::new(req.uri).set_addr(req.addr);
|
||||
|
||||
if let Some(local_addr) = self.local_address {
|
||||
req = req.set_local_addr(local_addr);
|
||||
}
|
||||
|
||||
TcpConnectorInnerFuture {
|
||||
fut: self.service.call(req),
|
||||
timeout: sleep(self.timeout),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[pin_project]
|
||||
pub struct TcpConnectorInnerFuture<Fut> {
|
||||
#[pin]
|
||||
fut: Fut,
|
||||
#[pin]
|
||||
timeout: Sleep,
|
||||
}
|
||||
|
||||
impl<Fut, Io> Future for TcpConnectorInnerFuture<Fut>
|
||||
where
|
||||
Fut: Future<Output = Result<TcpConnection<Uri, Io>, TcpConnectError>>,
|
||||
{
|
||||
type Output = Result<TcpConnection<Uri, Io>, ConnectError>;
|
||||
|
||||
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
|
||||
let this = self.project();
|
||||
match this.fut.poll(cx) {
|
||||
Poll::Ready(res) => Poll::Ready(res.map_err(ConnectError::from)),
|
||||
Poll::Pending => this.timeout.poll(cx).map(|_| Err(ConnectError::Timeout)),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Connector service for pooled Plain/Tls Tcp connections.
|
||||
pub type ConnectorService<S, Io> = ConnectorServicePriv<
|
||||
TcpConnectorService<TcpConnectorInnerService<S>>,
|
||||
Rc<
|
||||
dyn Service<
|
||||
Connect,
|
||||
Response = (Box<dyn ConnectionIo>, Protocol),
|
||||
Error = ConnectError,
|
||||
Future = LocalBoxFuture<
|
||||
'static,
|
||||
Result<(Box<dyn ConnectionIo>, Protocol), ConnectError>,
|
||||
>,
|
||||
>,
|
||||
>,
|
||||
Io,
|
||||
Box<dyn ConnectionIo>,
|
||||
>;
|
||||
|
||||
pub struct ConnectorServicePriv<S1, S2, Io1, Io2>
|
||||
where
|
||||
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>,
|
||||
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>,
|
||||
Io1: ConnectionIo,
|
||||
Io2: ConnectionIo,
|
||||
{
|
||||
tcp_pool: ConnectionPool<S1, Io1>,
|
||||
tls_pool: Option<ConnectionPool<S2, Io2>>,
|
||||
}
|
||||
|
||||
impl<S1, S2, Io1, Io2> Clone for InnerConnector<S1, S2, Io1, Io2>
|
||||
impl<S1, S2, Io1, Io2> Service<Connect> for ConnectorServicePriv<S1, S2, Io1, Io2>
|
||||
where
|
||||
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
|
||||
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
|
||||
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>
|
||||
+ Clone
|
||||
+ 'static,
|
||||
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>
|
||||
+ Clone
|
||||
+ 'static,
|
||||
Io1: ConnectionIo,
|
||||
Io2: ConnectionIo,
|
||||
{
|
||||
fn clone(&self) -> Self {
|
||||
InnerConnector {
|
||||
tcp_pool: self.tcp_pool.clone(),
|
||||
tls_pool: self.tls_pool.as_ref().cloned(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<S1, S2, Io1, Io2> Service<Connect> for InnerConnector<S1, S2, Io1, Io2>
|
||||
where
|
||||
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
|
||||
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
|
||||
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
{
|
||||
type Response = EitherIoConnection<Io1, Io2>;
|
||||
type Response = Connection<Io1, Io2>;
|
||||
type Error = ConnectError;
|
||||
type Future = InnerConnectorResponse<S1, S2, Io1, Io2>;
|
||||
type Future = ConnectorServiceFuture<S1, S2, Io1, Io2>;
|
||||
|
||||
fn poll_ready(&self, cx: &mut Context<'_>) -> Poll<Result<(), Self::Error>> {
|
||||
self.tcp_pool.poll_ready(cx)
|
||||
ready!(self.tcp_pool.poll_ready(cx))?;
|
||||
if let Some(ref tls_pool) = self.tls_pool {
|
||||
ready!(tls_pool.poll_ready(cx))?;
|
||||
}
|
||||
Poll::Ready(Ok(()))
|
||||
}
|
||||
|
||||
fn call(&self, req: Connect) -> Self::Future {
|
||||
match req.uri.scheme_str() {
|
||||
Some("https") | Some("wss") => match self.tls_pool {
|
||||
None => InnerConnectorResponse::SslIsNotSupported,
|
||||
Some(ref pool) => InnerConnectorResponse::Io2(pool.call(req)),
|
||||
None => ConnectorServiceFuture::SslIsNotSupported,
|
||||
Some(ref pool) => ConnectorServiceFuture::Tls(pool.call(req)),
|
||||
},
|
||||
_ => InnerConnectorResponse::Io1(self.tcp_pool.call(req)),
|
||||
_ => ConnectorServiceFuture::Tcp(self.tcp_pool.call(req)),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
#[pin_project::pin_project(project = InnerConnectorProj)]
|
||||
enum InnerConnectorResponse<S1, S2, Io1, Io2>
|
||||
#[pin_project(project = ConnectorServiceProj)]
|
||||
pub enum ConnectorServiceFuture<S1, S2, Io1, Io2>
|
||||
where
|
||||
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
|
||||
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
|
||||
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>
|
||||
+ Clone
|
||||
+ 'static,
|
||||
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>
|
||||
+ Clone
|
||||
+ 'static,
|
||||
Io1: ConnectionIo,
|
||||
Io2: ConnectionIo,
|
||||
{
|
||||
Io1(#[pin] <ConnectionPool<S1, Io1> as Service<Connect>>::Future),
|
||||
Io2(#[pin] <ConnectionPool<S2, Io2> as Service<Connect>>::Future),
|
||||
Tcp(#[pin] <ConnectionPool<S1, Io1> as Service<Connect>>::Future),
|
||||
Tls(#[pin] <ConnectionPool<S2, Io2> as Service<Connect>>::Future),
|
||||
SslIsNotSupported,
|
||||
}
|
||||
|
||||
impl<S1, S2, Io1, Io2> Future for InnerConnectorResponse<S1, S2, Io1, Io2>
|
||||
impl<S1, S2, Io1, Io2> Future for ConnectorServiceFuture<S1, S2, Io1, Io2>
|
||||
where
|
||||
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError> + 'static,
|
||||
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError> + 'static,
|
||||
Io1: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
Io2: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
S1: Service<Connect, Response = (Io1, Protocol), Error = ConnectError>
|
||||
+ Clone
|
||||
+ 'static,
|
||||
S2: Service<Connect, Response = (Io2, Protocol), Error = ConnectError>
|
||||
+ Clone
|
||||
+ 'static,
|
||||
Io1: ConnectionIo,
|
||||
Io2: ConnectionIo,
|
||||
{
|
||||
type Output = Result<EitherIoConnection<Io1, Io2>, ConnectError>;
|
||||
type Output = Result<Connection<Io1, Io2>, ConnectError>;
|
||||
|
||||
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
|
||||
match self.project() {
|
||||
InnerConnectorProj::Io1(fut) => fut.poll(cx).map_ok(EitherIoConnection::A),
|
||||
InnerConnectorProj::Io2(fut) => fut.poll(cx).map_ok(EitherIoConnection::B),
|
||||
InnerConnectorProj::SslIsNotSupported => {
|
||||
ConnectorServiceProj::Tcp(fut) => fut.poll(cx).map_ok(Connection::Tcp),
|
||||
ConnectorServiceProj::Tls(fut) => fut.poll(cx).map_ok(Connection::Tls),
|
||||
ConnectorServiceProj::SslIsNotSupported => {
|
||||
Poll::Ready(Err(ConnectError::SslIsNotSupported))
|
||||
}
|
||||
}
|
||||
|
|
|
|||
|
|
@ -1,38 +1,35 @@
|
|||
use std::io::Write;
|
||||
use std::pin::Pin;
|
||||
use std::task::{Context, Poll};
|
||||
use std::{io, time};
|
||||
use std::{
|
||||
io::Write,
|
||||
pin::Pin,
|
||||
task::{Context, Poll},
|
||||
};
|
||||
|
||||
use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
|
||||
use actix_codec::Framed;
|
||||
use bytes::buf::BufMut;
|
||||
use bytes::{Bytes, BytesMut};
|
||||
use futures_core::Stream;
|
||||
use futures_util::{future::poll_fn, SinkExt, StreamExt};
|
||||
use futures_util::{future::poll_fn, SinkExt as _};
|
||||
|
||||
use crate::error::PayloadError;
|
||||
use crate::h1;
|
||||
use crate::header::HeaderMap;
|
||||
use crate::http::{
|
||||
header::{IntoHeaderValue, EXPECT, HOST},
|
||||
header::{HeaderMap, IntoHeaderValue, EXPECT, HOST},
|
||||
StatusCode,
|
||||
};
|
||||
use crate::message::{RequestHeadType, ResponseHead};
|
||||
use crate::payload::{Payload, PayloadStream};
|
||||
|
||||
use super::connection::{ConnectionLifetime, ConnectionType, IoConnection};
|
||||
use super::connection::{ConnectionIo, H1Connection};
|
||||
use super::error::{ConnectError, SendRequestError};
|
||||
use super::pool::Acquired;
|
||||
use crate::body::{BodySize, MessageBody};
|
||||
|
||||
pub(crate) async fn send_request<T, B>(
|
||||
io: T,
|
||||
pub(crate) async fn send_request<Io, B>(
|
||||
io: H1Connection<Io>,
|
||||
mut head: RequestHeadType,
|
||||
body: B,
|
||||
created: time::Instant,
|
||||
pool: Option<Acquired<T>>,
|
||||
) -> Result<(ResponseHead, Payload), SendRequestError>
|
||||
where
|
||||
T: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
Io: ConnectionIo,
|
||||
B: MessageBody,
|
||||
{
|
||||
// set request host header
|
||||
|
|
@ -42,9 +39,9 @@ where
|
|||
if let Some(host) = head.as_ref().uri.host() {
|
||||
let mut wrt = BytesMut::with_capacity(host.len() + 5).writer();
|
||||
|
||||
let _ = match head.as_ref().uri.port_u16() {
|
||||
None | Some(80) | Some(443) => write!(wrt, "{}", host),
|
||||
Some(port) => write!(wrt, "{}:{}", host, port),
|
||||
match head.as_ref().uri.port_u16() {
|
||||
None | Some(80) | Some(443) => write!(wrt, "{}", host)?,
|
||||
Some(port) => write!(wrt, "{}:{}", host, port)?,
|
||||
};
|
||||
|
||||
match wrt.get_mut().split().freeze().try_into_value() {
|
||||
|
|
@ -62,12 +59,6 @@ where
|
|||
}
|
||||
}
|
||||
|
||||
let io = H1Connection {
|
||||
created,
|
||||
pool,
|
||||
io: Some(io),
|
||||
};
|
||||
|
||||
// create Framed and prepare sending request
|
||||
let mut framed = Framed::new(io, h1::ClientCodec::default());
|
||||
|
||||
|
|
@ -77,10 +68,8 @@ where
|
|||
let is_expect = if head.as_ref().headers.contains_key(EXPECT) {
|
||||
match body.size() {
|
||||
BodySize::None | BodySize::Empty | BodySize::Sized(0) => {
|
||||
let pin_framed = Pin::new(&mut framed);
|
||||
|
||||
let force_close = !pin_framed.codec_ref().keepalive();
|
||||
release_connection(pin_framed, force_close);
|
||||
let keep_alive = framed.codec_ref().keepalive();
|
||||
framed.io_mut().on_release(keep_alive);
|
||||
|
||||
// TODO: use a new variant or a new type better describing error violate
|
||||
// `Requirements for clients` session of above RFC
|
||||
|
|
@ -128,8 +117,9 @@ where
|
|||
|
||||
match pin_framed.codec_ref().message_type() {
|
||||
h1::MessageType::None => {
|
||||
let force_close = !pin_framed.codec_ref().keepalive();
|
||||
release_connection(pin_framed, force_close);
|
||||
let keep_alive = pin_framed.codec_ref().keepalive();
|
||||
pin_framed.io_mut().on_release(keep_alive);
|
||||
|
||||
Ok((head, Payload::None))
|
||||
}
|
||||
_ => {
|
||||
|
|
@ -139,33 +129,32 @@ where
|
|||
}
|
||||
}
|
||||
|
||||
pub(crate) async fn open_tunnel<T>(
|
||||
io: T,
|
||||
pub(crate) async fn open_tunnel<Io>(
|
||||
io: Io,
|
||||
head: RequestHeadType,
|
||||
) -> Result<(ResponseHead, Framed<T, h1::ClientCodec>), SendRequestError>
|
||||
) -> Result<(ResponseHead, Framed<Io, h1::ClientCodec>), SendRequestError>
|
||||
where
|
||||
T: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
Io: ConnectionIo,
|
||||
{
|
||||
// create Framed and send request
|
||||
// create Framed and send request.
|
||||
let mut framed = Framed::new(io, h1::ClientCodec::default());
|
||||
framed.send((head, BodySize::None).into()).await?;
|
||||
|
||||
// read response
|
||||
if let (Some(result), framed) = framed.into_future().await {
|
||||
let head = result.map_err(SendRequestError::from)?;
|
||||
// read response head.
|
||||
let head = poll_fn(|cx| Pin::new(&mut framed).poll_next(cx))
|
||||
.await
|
||||
.ok_or(ConnectError::Disconnected)??;
|
||||
|
||||
Ok((head, framed))
|
||||
} else {
|
||||
Err(SendRequestError::from(ConnectError::Disconnected))
|
||||
}
|
||||
}
|
||||
|
||||
/// send request body to the peer
|
||||
pub(crate) async fn send_body<T, B>(
|
||||
pub(crate) async fn send_body<Io, B>(
|
||||
body: B,
|
||||
mut framed: Pin<&mut Framed<T, h1::ClientCodec>>,
|
||||
mut framed: Pin<&mut Framed<Io, h1::ClientCodec>>,
|
||||
) -> Result<(), SendRequestError>
|
||||
where
|
||||
T: ConnectionLifetime + Unpin,
|
||||
Io: ConnectionIo,
|
||||
B: MessageBody,
|
||||
{
|
||||
actix_rt::pin!(body);
|
||||
|
|
@ -200,95 +189,21 @@ where
|
|||
}
|
||||
}
|
||||
|
||||
SinkExt::flush(Pin::into_inner(framed)).await?;
|
||||
framed.get_mut().flush().await?;
|
||||
Ok(())
|
||||
}
|
||||
|
||||
#[doc(hidden)]
|
||||
/// HTTP client connection
|
||||
pub struct H1Connection<T>
|
||||
where
|
||||
T: AsyncWrite + Unpin + 'static,
|
||||
{
|
||||
/// T should be `Unpin`
|
||||
io: Option<T>,
|
||||
created: time::Instant,
|
||||
pool: Option<Acquired<T>>,
|
||||
}
|
||||
|
||||
impl<T> ConnectionLifetime for H1Connection<T>
|
||||
where
|
||||
T: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
{
|
||||
/// Close connection
|
||||
fn close(mut self: Pin<&mut Self>) {
|
||||
if let Some(mut pool) = self.pool.take() {
|
||||
if let Some(io) = self.io.take() {
|
||||
pool.close(IoConnection::new(
|
||||
ConnectionType::H1(io),
|
||||
self.created,
|
||||
None,
|
||||
));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/// Release this connection to the connection pool
|
||||
fn release(mut self: Pin<&mut Self>) {
|
||||
if let Some(mut pool) = self.pool.take() {
|
||||
if let Some(io) = self.io.take() {
|
||||
pool.release(IoConnection::new(
|
||||
ConnectionType::H1(io),
|
||||
self.created,
|
||||
None,
|
||||
));
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncRead for H1Connection<T> {
|
||||
fn poll_read(
|
||||
mut self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
buf: &mut ReadBuf<'_>,
|
||||
) -> Poll<io::Result<()>> {
|
||||
Pin::new(&mut self.io.as_mut().unwrap()).poll_read(cx, buf)
|
||||
}
|
||||
}
|
||||
|
||||
impl<T: AsyncRead + AsyncWrite + Unpin + 'static> AsyncWrite for H1Connection<T> {
|
||||
fn poll_write(
|
||||
mut self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
buf: &[u8],
|
||||
) -> Poll<io::Result<usize>> {
|
||||
Pin::new(&mut self.io.as_mut().unwrap()).poll_write(cx, buf)
|
||||
}
|
||||
|
||||
fn poll_flush(
|
||||
mut self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
) -> Poll<io::Result<()>> {
|
||||
Pin::new(self.io.as_mut().unwrap()).poll_flush(cx)
|
||||
}
|
||||
|
||||
fn poll_shutdown(
|
||||
mut self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
) -> Poll<Result<(), io::Error>> {
|
||||
Pin::new(self.io.as_mut().unwrap()).poll_shutdown(cx)
|
||||
}
|
||||
}
|
||||
|
||||
#[pin_project::pin_project]
|
||||
pub(crate) struct PlStream<Io> {
|
||||
pub(crate) struct PlStream<Io: ConnectionIo>
|
||||
where
|
||||
Io: ConnectionIo,
|
||||
{
|
||||
#[pin]
|
||||
framed: Option<Framed<Io, h1::ClientPayloadCodec>>,
|
||||
framed: Option<Framed<H1Connection<Io>, h1::ClientPayloadCodec>>,
|
||||
}
|
||||
|
||||
impl<Io: ConnectionLifetime> PlStream<Io> {
|
||||
fn new(framed: Framed<Io, h1::ClientCodec>) -> Self {
|
||||
impl<Io: ConnectionIo> PlStream<Io> {
|
||||
fn new(framed: Framed<H1Connection<Io>, h1::ClientCodec>) -> Self {
|
||||
let framed = framed.into_map_codec(|codec| codec.into_payload_codec());
|
||||
|
||||
PlStream {
|
||||
|
|
@ -297,24 +212,23 @@ impl<Io: ConnectionLifetime> PlStream<Io> {
|
|||
}
|
||||
}
|
||||
|
||||
impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
|
||||
impl<Io: ConnectionIo> Stream for PlStream<Io> {
|
||||
type Item = Result<Bytes, PayloadError>;
|
||||
|
||||
fn poll_next(
|
||||
self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
) -> Poll<Option<Self::Item>> {
|
||||
let mut this = self.project();
|
||||
let mut framed = self.project().framed.as_pin_mut().unwrap();
|
||||
|
||||
match this.framed.as_mut().as_pin_mut().unwrap().next_item(cx)? {
|
||||
match framed.as_mut().next_item(cx)? {
|
||||
Poll::Pending => Poll::Pending,
|
||||
Poll::Ready(Some(chunk)) => {
|
||||
if let Some(chunk) = chunk {
|
||||
Poll::Ready(Some(Ok(chunk)))
|
||||
} else {
|
||||
let framed = this.framed.as_mut().as_pin_mut().unwrap();
|
||||
let force_close = !framed.codec_ref().keepalive();
|
||||
release_connection(framed, force_close);
|
||||
let keep_alive = framed.codec_ref().keepalive();
|
||||
framed.io_mut().on_release(keep_alive);
|
||||
Poll::Ready(None)
|
||||
}
|
||||
}
|
||||
|
|
@ -322,14 +236,3 @@ impl<Io: ConnectionLifetime> Stream for PlStream<Io> {
|
|||
}
|
||||
}
|
||||
}
|
||||
|
||||
fn release_connection<T, U>(framed: Pin<&mut Framed<T, U>>, force_close: bool)
|
||||
where
|
||||
T: ConnectionLifetime,
|
||||
{
|
||||
if !force_close && framed.is_read_buf_empty() && framed.is_write_buf_empty() {
|
||||
framed.io_pin().release()
|
||||
} else {
|
||||
framed.io_pin().close()
|
||||
}
|
||||
}
|
||||
|
|
|
|||
|
|
@ -1,7 +1,5 @@
|
|||
use std::future::Future;
|
||||
use std::time;
|
||||
|
||||
use actix_codec::{AsyncRead, AsyncWrite};
|
||||
use bytes::Bytes;
|
||||
use futures_util::future::poll_fn;
|
||||
use h2::{
|
||||
|
|
@ -17,20 +15,16 @@ use crate::message::{RequestHeadType, ResponseHead};
|
|||
use crate::payload::Payload;
|
||||
|
||||
use super::config::ConnectorConfig;
|
||||
use super::connection::{ConnectionType, IoConnection};
|
||||
use super::connection::{ConnectionIo, H2Connection};
|
||||
use super::error::SendRequestError;
|
||||
use super::pool::Acquired;
|
||||
use crate::client::connection::H2Connection;
|
||||
|
||||
pub(crate) async fn send_request<T, B>(
|
||||
mut io: H2Connection,
|
||||
pub(crate) async fn send_request<Io, B>(
|
||||
mut io: H2Connection<Io>,
|
||||
head: RequestHeadType,
|
||||
body: B,
|
||||
created: time::Instant,
|
||||
pool: Option<Acquired<T>>,
|
||||
) -> Result<(ResponseHead, Payload), SendRequestError>
|
||||
where
|
||||
T: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
Io: ConnectionIo,
|
||||
B: MessageBody,
|
||||
{
|
||||
trace!("Sending client request: {:?} {:?}", head, body.size());
|
||||
|
|
@ -103,13 +97,13 @@ where
|
|||
|
||||
let res = poll_fn(|cx| io.poll_ready(cx)).await;
|
||||
if let Err(e) = res {
|
||||
release(io, pool, created, e.is_io());
|
||||
io.on_release(e.is_io());
|
||||
return Err(SendRequestError::from(e));
|
||||
}
|
||||
|
||||
let resp = match io.send_request(req, eof) {
|
||||
Ok((fut, send)) => {
|
||||
release(io, pool, created, false);
|
||||
io.on_release(false);
|
||||
|
||||
if !eof {
|
||||
send_body(body, send).await?;
|
||||
|
|
@ -117,7 +111,7 @@ where
|
|||
fut.await.map_err(SendRequestError::from)?
|
||||
}
|
||||
Err(e) => {
|
||||
release(io, pool, created, e.is_io());
|
||||
io.on_release(e.is_io());
|
||||
return Err(e.into());
|
||||
}
|
||||
};
|
||||
|
|
@ -178,28 +172,10 @@ async fn send_body<B: MessageBody>(
|
|||
}
|
||||
}
|
||||
|
||||
/// release SendRequest object
|
||||
fn release<T: AsyncRead + AsyncWrite + Unpin + 'static>(
|
||||
io: H2Connection,
|
||||
pool: Option<Acquired<T>>,
|
||||
created: time::Instant,
|
||||
close: bool,
|
||||
) {
|
||||
if let Some(mut pool) = pool {
|
||||
if close {
|
||||
pool.close(IoConnection::new(ConnectionType::H2(io), created, None));
|
||||
} else {
|
||||
pool.release(IoConnection::new(ConnectionType::H2(io), created, None));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
pub(crate) fn handshake<Io>(
|
||||
pub(crate) fn handshake<Io: ConnectionIo>(
|
||||
io: Io,
|
||||
config: &ConnectorConfig,
|
||||
) -> impl Future<Output = Result<(SendRequest<Bytes>, Connection<Io, Bytes>), h2::Error>>
|
||||
where
|
||||
Io: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
{
|
||||
let mut builder = Builder::new();
|
||||
builder
|
||||
|
|
|
|||
|
|
@ -14,10 +14,10 @@ pub use actix_tls::connect::{
|
|||
Connect as TcpConnect, ConnectError as TcpConnectError, Connection as TcpConnection,
|
||||
};
|
||||
|
||||
pub use self::connection::Connection;
|
||||
pub use self::connector::Connector;
|
||||
pub use self::connection::{Connection, ConnectionIo};
|
||||
pub use self::connector::{Connector, ConnectorService};
|
||||
pub use self::error::{ConnectError, FreezeRequestError, InvalidUrl, SendRequestError};
|
||||
pub use self::pool::Protocol;
|
||||
pub use crate::Protocol;
|
||||
|
||||
#[derive(Clone)]
|
||||
pub struct Connect {
|
||||
|
|
|
|||
|
|
@ -1,40 +1,38 @@
|
|||
//! Client connection pooling keyed on the authority part of the connection URI.
|
||||
|
||||
use std::collections::VecDeque;
|
||||
use std::future::Future;
|
||||
use std::ops::Deref;
|
||||
use std::pin::Pin;
|
||||
use std::rc::Rc;
|
||||
use std::sync::Arc;
|
||||
use std::task::{Context, Poll};
|
||||
use std::time::{Duration, Instant};
|
||||
use std::{cell::RefCell, io};
|
||||
use std::{
|
||||
cell::RefCell,
|
||||
collections::VecDeque,
|
||||
future::Future,
|
||||
io,
|
||||
ops::Deref,
|
||||
pin::Pin,
|
||||
rc::Rc,
|
||||
sync::Arc,
|
||||
task::{Context, Poll},
|
||||
time::{Duration, Instant},
|
||||
};
|
||||
|
||||
use actix_codec::{AsyncRead, AsyncWrite};
|
||||
use actix_codec::{AsyncRead, AsyncWrite, ReadBuf};
|
||||
use actix_rt::time::{sleep, Sleep};
|
||||
use actix_service::Service;
|
||||
use ahash::AHashMap;
|
||||
use futures_core::future::LocalBoxFuture;
|
||||
use http::uri::Authority;
|
||||
use pin_project::pin_project;
|
||||
use tokio::io::ReadBuf;
|
||||
use tokio::sync::{OwnedSemaphorePermit, Semaphore};
|
||||
|
||||
use super::config::ConnectorConfig;
|
||||
use super::connection::{ConnectionType, H2Connection, IoConnection};
|
||||
use super::connection::{
|
||||
ConnectionInnerType, ConnectionIo, ConnectionType, H2ConnectionInner,
|
||||
};
|
||||
use super::error::ConnectError;
|
||||
use super::h2proto::handshake;
|
||||
use super::Connect;
|
||||
|
||||
#[derive(Clone, Copy, PartialEq)]
|
||||
/// Protocol version
|
||||
pub enum Protocol {
|
||||
Http1,
|
||||
Http2,
|
||||
}
|
||||
use super::Protocol;
|
||||
|
||||
#[derive(Hash, Eq, PartialEq, Clone, Debug)]
|
||||
pub(crate) struct Key {
|
||||
pub struct Key {
|
||||
authority: Authority,
|
||||
}
|
||||
|
||||
|
|
@ -44,17 +42,18 @@ impl From<Authority> for Key {
|
|||
}
|
||||
}
|
||||
|
||||
#[doc(hidden)]
|
||||
/// Connections pool for reuse Io type for certain [`http::uri::Authority`] as key.
|
||||
pub(crate) struct ConnectionPool<S, Io>
|
||||
pub struct ConnectionPool<S, Io>
|
||||
where
|
||||
Io: AsyncWrite + Unpin + 'static,
|
||||
{
|
||||
connector: Rc<S>,
|
||||
connector: S,
|
||||
inner: ConnectionPoolInner<Io>,
|
||||
}
|
||||
|
||||
/// wrapper type for check the ref count of Rc.
|
||||
struct ConnectionPoolInner<Io>(Rc<ConnectionPoolInnerPriv<Io>>)
|
||||
pub struct ConnectionPoolInner<Io>(Rc<ConnectionPoolInnerPriv<Io>>)
|
||||
where
|
||||
Io: AsyncWrite + Unpin + 'static;
|
||||
|
||||
|
|
@ -62,10 +61,21 @@ impl<Io> ConnectionPoolInner<Io>
|
|||
where
|
||||
Io: AsyncWrite + Unpin + 'static,
|
||||
{
|
||||
fn new(config: ConnectorConfig) -> Self {
|
||||
let permits = Arc::new(Semaphore::new(config.limit));
|
||||
let available = RefCell::new(AHashMap::default());
|
||||
|
||||
Self(Rc::new(ConnectionPoolInnerPriv {
|
||||
config,
|
||||
available,
|
||||
permits,
|
||||
}))
|
||||
}
|
||||
|
||||
/// spawn a async for graceful shutdown h1 Io type with a timeout.
|
||||
fn close(&self, conn: ConnectionType<Io>) {
|
||||
fn close(&self, conn: ConnectionInnerType<Io>) {
|
||||
if let Some(timeout) = self.config.disconnect_timeout {
|
||||
if let ConnectionType::H1(io) = conn {
|
||||
if let ConnectionInnerType::H1(io) = conn {
|
||||
actix_rt::spawn(CloseConnection::new(io, timeout));
|
||||
}
|
||||
}
|
||||
|
|
@ -110,7 +120,7 @@ where
|
|||
}
|
||||
}
|
||||
|
||||
struct ConnectionPoolInnerPriv<Io>
|
||||
pub struct ConnectionPoolInnerPriv<Io>
|
||||
where
|
||||
Io: AsyncWrite + Unpin + 'static,
|
||||
{
|
||||
|
|
@ -134,40 +144,22 @@ where
|
|||
/// Any requests beyond limit would be wait in fifo order and get notified in async manner
|
||||
/// by [`tokio::sync::Semaphore`]
|
||||
pub(crate) fn new(connector: S, config: ConnectorConfig) -> Self {
|
||||
let permits = Arc::new(Semaphore::new(config.limit));
|
||||
let available = RefCell::new(AHashMap::default());
|
||||
let connector = Rc::new(connector);
|
||||
|
||||
let inner = ConnectionPoolInner(Rc::new(ConnectionPoolInnerPriv {
|
||||
config,
|
||||
available,
|
||||
permits,
|
||||
}));
|
||||
let inner = ConnectionPoolInner::new(config);
|
||||
|
||||
Self { connector, inner }
|
||||
}
|
||||
}
|
||||
|
||||
impl<S, Io> Clone for ConnectionPool<S, Io>
|
||||
where
|
||||
Io: AsyncWrite + Unpin + 'static,
|
||||
{
|
||||
fn clone(&self) -> Self {
|
||||
Self {
|
||||
connector: self.connector.clone(),
|
||||
inner: self.inner.clone(),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<S, Io> Service<Connect> for ConnectionPool<S, Io>
|
||||
where
|
||||
S: Service<Connect, Response = (Io, Protocol), Error = ConnectError> + 'static,
|
||||
Io: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
S: Service<Connect, Response = (Io, Protocol), Error = ConnectError>
|
||||
+ Clone
|
||||
+ 'static,
|
||||
Io: ConnectionIo,
|
||||
{
|
||||
type Response = IoConnection<Io>;
|
||||
type Response = ConnectionType<Io>;
|
||||
type Error = ConnectError;
|
||||
type Future = LocalBoxFuture<'static, Result<IoConnection<Io>, ConnectError>>;
|
||||
type Future = LocalBoxFuture<'static, Result<Self::Response, Self::Error>>;
|
||||
|
||||
actix_service::forward_ready!(connector);
|
||||
|
||||
|
|
@ -211,7 +203,7 @@ where
|
|||
inner.close(c.conn);
|
||||
} else {
|
||||
// check if the connection is still usable
|
||||
if let ConnectionType::H1(ref mut io) = c.conn {
|
||||
if let ConnectionInnerType::H1(ref mut io) = c.conn {
|
||||
let check = ConnectionCheckFuture { io };
|
||||
match check.await {
|
||||
ConnectionState::Tainted => {
|
||||
|
|
@ -235,28 +227,26 @@ where
|
|||
|
||||
// construct acquired. It's used to put Io type back to pool/ close the Io type.
|
||||
// permit is carried with the whole lifecycle of Acquired.
|
||||
let acquired = Some(Acquired { key, inner, permit });
|
||||
let acquired = Acquired { key, inner, permit };
|
||||
|
||||
// match the connection and spawn new one if did not get anything.
|
||||
match conn {
|
||||
Some(conn) => Ok(IoConnection::new(conn.conn, conn.created, acquired)),
|
||||
Some(conn) => {
|
||||
Ok(ConnectionType::from_pool(conn.conn, conn.created, acquired))
|
||||
}
|
||||
None => {
|
||||
let (io, proto) = connector.call(req).await?;
|
||||
|
||||
// TODO: remove when http3 is added in support.
|
||||
assert!(proto != Protocol::Http3);
|
||||
|
||||
if proto == Protocol::Http1 {
|
||||
Ok(IoConnection::new(
|
||||
ConnectionType::H1(io),
|
||||
Instant::now(),
|
||||
acquired,
|
||||
))
|
||||
Ok(ConnectionType::from_h1(io, Instant::now(), acquired))
|
||||
} else {
|
||||
let config = &acquired.as_ref().unwrap().inner.config;
|
||||
let config = &acquired.inner.config;
|
||||
let (sender, connection) = handshake(io, config).await?;
|
||||
Ok(IoConnection::new(
|
||||
ConnectionType::H2(H2Connection::new(sender, connection)),
|
||||
Instant::now(),
|
||||
acquired,
|
||||
))
|
||||
let inner = H2ConnectionInner::new(sender, connection);
|
||||
Ok(ConnectionType::from_h2(inner, Instant::now(), acquired))
|
||||
}
|
||||
}
|
||||
}
|
||||
|
|
@ -307,7 +297,7 @@ where
|
|||
}
|
||||
|
||||
struct PooledConnection<Io> {
|
||||
conn: ConnectionType<Io>,
|
||||
conn: ConnectionInnerType<Io>,
|
||||
used: Instant,
|
||||
created: Instant,
|
||||
}
|
||||
|
|
@ -347,28 +337,26 @@ where
|
|||
}
|
||||
}
|
||||
|
||||
pub(crate) struct Acquired<Io>
|
||||
pub struct Acquired<Io>
|
||||
where
|
||||
Io: AsyncWrite + Unpin + 'static,
|
||||
{
|
||||
/// authority key for identify connection.
|
||||
key: Key,
|
||||
/// handle to connection pool.
|
||||
inner: ConnectionPoolInner<Io>,
|
||||
/// permit for limit concurrent in-flight connection for a Client object.
|
||||
permit: OwnedSemaphorePermit,
|
||||
}
|
||||
|
||||
impl<Io> Acquired<Io>
|
||||
where
|
||||
Io: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
{
|
||||
impl<Io: ConnectionIo> Acquired<Io> {
|
||||
/// Close the IO.
|
||||
pub(crate) fn close(&mut self, conn: IoConnection<Io>) {
|
||||
let (conn, _) = conn.into_inner();
|
||||
pub(super) fn close(&self, conn: ConnectionInnerType<Io>) {
|
||||
self.inner.close(conn);
|
||||
}
|
||||
|
||||
/// Release IO back into pool.
|
||||
pub(crate) fn release(&mut self, conn: IoConnection<Io>) {
|
||||
let (io, created) = conn.into_inner();
|
||||
pub(super) fn release(&self, conn: ConnectionInnerType<Io>, created: Instant) {
|
||||
let Acquired { key, inner, .. } = self;
|
||||
|
||||
inner
|
||||
|
|
@ -377,12 +365,12 @@ where
|
|||
.entry(key.clone())
|
||||
.or_insert_with(VecDeque::new)
|
||||
.push_back(PooledConnection {
|
||||
conn: io,
|
||||
conn,
|
||||
created,
|
||||
used: Instant::now(),
|
||||
});
|
||||
|
||||
let _ = &mut self.permit;
|
||||
let _ = &self.permit;
|
||||
}
|
||||
}
|
||||
|
||||
|
|
@ -393,7 +381,7 @@ mod test {
|
|||
use http::Uri;
|
||||
|
||||
use super::*;
|
||||
use crate::client::connection::IoConnection;
|
||||
use crate::client::connection::ConnectionType;
|
||||
|
||||
/// A stream type that always returns pending on async read.
|
||||
///
|
||||
|
|
@ -440,6 +428,7 @@ mod test {
|
|||
}
|
||||
}
|
||||
|
||||
#[derive(Clone)]
|
||||
struct TestPoolConnector {
|
||||
generated: Rc<Cell<usize>>,
|
||||
}
|
||||
|
|
@ -458,12 +447,14 @@ mod test {
|
|||
}
|
||||
}
|
||||
|
||||
fn release<T>(conn: IoConnection<T>)
|
||||
fn release<T>(conn: ConnectionType<T>)
|
||||
where
|
||||
T: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
{
|
||||
let (conn, created, mut acquired) = conn.into_parts();
|
||||
acquired.release(IoConnection::new(conn, created, None));
|
||||
match conn {
|
||||
ConnectionType::H1(mut conn) => conn.on_release(true),
|
||||
ConnectionType::H2(mut conn) => conn.on_release(false),
|
||||
}
|
||||
}
|
||||
|
||||
#[actix_rt::test]
|
||||
|
|
|
|||
|
|
@ -126,9 +126,7 @@ impl ServiceConfig {
|
|||
pub fn client_timer(&self) -> Option<Sleep> {
|
||||
let delay_time = self.0.client_timeout;
|
||||
if delay_time != 0 {
|
||||
Some(sleep_until(
|
||||
self.0.date_service.now() + Duration::from_millis(delay_time),
|
||||
))
|
||||
Some(sleep_until(self.now() + Duration::from_millis(delay_time)))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
|
|
@ -138,7 +136,7 @@ impl ServiceConfig {
|
|||
pub fn client_timer_expire(&self) -> Option<Instant> {
|
||||
let delay = self.0.client_timeout;
|
||||
if delay != 0 {
|
||||
Some(self.0.date_service.now() + Duration::from_millis(delay))
|
||||
Some(self.now() + Duration::from_millis(delay))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
|
|
@ -148,7 +146,7 @@ impl ServiceConfig {
|
|||
pub fn client_disconnect_timer(&self) -> Option<Instant> {
|
||||
let delay = self.0.client_disconnect;
|
||||
if delay != 0 {
|
||||
Some(self.0.date_service.now() + Duration::from_millis(delay))
|
||||
Some(self.now() + Duration::from_millis(delay))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
|
|
@ -157,20 +155,12 @@ impl ServiceConfig {
|
|||
#[inline]
|
||||
/// Return keep-alive timer delay is configured.
|
||||
pub fn keep_alive_timer(&self) -> Option<Sleep> {
|
||||
if let Some(ka) = self.0.keep_alive {
|
||||
Some(sleep_until(self.0.date_service.now() + ka))
|
||||
} else {
|
||||
None
|
||||
}
|
||||
self.keep_alive().map(|ka| sleep_until(self.now() + ka))
|
||||
}
|
||||
|
||||
/// Keep-alive expire time
|
||||
pub fn keep_alive_expire(&self) -> Option<Instant> {
|
||||
if let Some(ka) = self.0.keep_alive {
|
||||
Some(self.0.date_service.now() + ka)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
self.keep_alive().map(|ka| self.now() + ka)
|
||||
}
|
||||
|
||||
#[inline]
|
||||
|
|
|
|||
|
|
@ -54,7 +54,7 @@ impl Error {
|
|||
|
||||
/// Similar to `as_response_error` but downcasts.
|
||||
pub fn as_error<T: ResponseError + 'static>(&self) -> Option<&T> {
|
||||
ResponseError::downcast_ref(self.cause.as_ref())
|
||||
<dyn ResponseError>::downcast_ref(self.cause.as_ref())
|
||||
}
|
||||
}
|
||||
|
||||
|
|
@ -483,7 +483,7 @@ where
|
|||
/// response as opposite to *INTERNAL SERVER ERROR* which is defined by
|
||||
/// default.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// # use std::io;
|
||||
/// # use actix_http::*;
|
||||
///
|
||||
|
|
|
|||
|
|
@ -951,14 +951,15 @@ mod tests {
|
|||
use std::str;
|
||||
|
||||
use actix_service::fn_service;
|
||||
use futures_util::future::{lazy, ready};
|
||||
use futures_util::future::{lazy, ready, Ready};
|
||||
|
||||
use super::*;
|
||||
use crate::test::TestBuffer;
|
||||
use crate::{error::Error, KeepAlive};
|
||||
use crate::{
|
||||
error::Error,
|
||||
h1::{ExpectHandler, UpgradeHandler},
|
||||
test::TestSeqBuffer,
|
||||
http::Method,
|
||||
test::{TestBuffer, TestSeqBuffer},
|
||||
HttpMessage, KeepAlive,
|
||||
};
|
||||
|
||||
fn find_slice(haystack: &[u8], needle: &[u8], from: usize) -> Option<usize> {
|
||||
|
|
@ -1282,14 +1283,30 @@ mod tests {
|
|||
|
||||
#[actix_rt::test]
|
||||
async fn test_upgrade() {
|
||||
struct TestUpgrade;
|
||||
|
||||
impl<T> Service<(Request, Framed<T, Codec>)> for TestUpgrade {
|
||||
type Response = ();
|
||||
type Error = Error;
|
||||
type Future = Ready<Result<Self::Response, Self::Error>>;
|
||||
|
||||
actix_service::always_ready!();
|
||||
|
||||
fn call(&self, (req, _framed): (Request, Framed<T, Codec>)) -> Self::Future {
|
||||
assert_eq!(req.method(), Method::GET);
|
||||
assert!(req.upgrade());
|
||||
assert_eq!(req.headers().get("upgrade").unwrap(), "websocket");
|
||||
ready(Ok(()))
|
||||
}
|
||||
}
|
||||
|
||||
lazy(|cx| {
|
||||
let mut buf = TestSeqBuffer::empty();
|
||||
let cfg = ServiceConfig::new(KeepAlive::Disabled, 0, 0, false, None);
|
||||
|
||||
let services =
|
||||
HttpFlow::new(ok_service(), ExpectHandler, Some(UpgradeHandler));
|
||||
let services = HttpFlow::new(ok_service(), ExpectHandler, Some(TestUpgrade));
|
||||
|
||||
let h1 = Dispatcher::<_, _, _, _, UpgradeHandler>::new(
|
||||
let h1 = Dispatcher::<_, _, _, _, TestUpgrade>::new(
|
||||
buf.clone(),
|
||||
cfg,
|
||||
services,
|
||||
|
|
|
|||
|
|
@ -1,5 +1,3 @@
|
|||
use std::task::Poll;
|
||||
|
||||
use actix_service::{Service, ServiceFactory};
|
||||
use futures_util::future::{ready, Ready};
|
||||
|
||||
|
|
|
|||
|
|
@ -1,8 +1,6 @@
|
|||
use std::task::Poll;
|
||||
|
||||
use actix_codec::Framed;
|
||||
use actix_service::{Service, ServiceFactory};
|
||||
use futures_util::future::{ready, Ready};
|
||||
use futures_core::future::LocalBoxFuture;
|
||||
|
||||
use crate::error::Error;
|
||||
use crate::h1::Codec;
|
||||
|
|
@ -16,7 +14,7 @@ impl<T> ServiceFactory<(Request, Framed<T, Codec>)> for UpgradeHandler {
|
|||
type Config = ();
|
||||
type Service = UpgradeHandler;
|
||||
type InitError = Error;
|
||||
type Future = Ready<Result<Self::Service, Self::InitError>>;
|
||||
type Future = LocalBoxFuture<'static, Result<Self::Service, Self::InitError>>;
|
||||
|
||||
fn new_service(&self, _: ()) -> Self::Future {
|
||||
unimplemented!()
|
||||
|
|
@ -26,11 +24,11 @@ impl<T> ServiceFactory<(Request, Framed<T, Codec>)> for UpgradeHandler {
|
|||
impl<T> Service<(Request, Framed<T, Codec>)> for UpgradeHandler {
|
||||
type Response = ();
|
||||
type Error = Error;
|
||||
type Future = Ready<Result<Self::Response, Self::Error>>;
|
||||
type Future = LocalBoxFuture<'static, Result<Self::Response, Self::Error>>;
|
||||
|
||||
actix_service::always_ready!();
|
||||
|
||||
fn call(&self, _: (Request, Framed<T, Codec>)) -> Self::Future {
|
||||
ready(Ok(()))
|
||||
unimplemented!()
|
||||
}
|
||||
}
|
||||
|
|
|
|||
|
|
@ -2,12 +2,13 @@ use std::task::{Context, Poll};
|
|||
use std::{cmp, future::Future, marker::PhantomData, net, pin::Pin, rc::Rc};
|
||||
|
||||
use actix_codec::{AsyncRead, AsyncWrite};
|
||||
use actix_rt::time::{Instant, Sleep};
|
||||
use actix_service::Service;
|
||||
use bytes::{Bytes, BytesMut};
|
||||
use futures_core::ready;
|
||||
use h2::server::{Connection, SendResponse};
|
||||
use h2::SendStream;
|
||||
use h2::{
|
||||
server::{Connection, SendResponse},
|
||||
SendStream,
|
||||
};
|
||||
use http::header::{HeaderValue, CONNECTION, CONTENT_LENGTH, DATE, TRANSFER_ENCODING};
|
||||
use log::{error, trace};
|
||||
|
||||
|
|
@ -36,8 +37,6 @@ where
|
|||
on_connect_data: OnConnectData,
|
||||
config: ServiceConfig,
|
||||
peer_addr: Option<net::SocketAddr>,
|
||||
ka_expire: Instant,
|
||||
ka_timer: Option<Sleep>,
|
||||
_phantom: PhantomData<B>,
|
||||
}
|
||||
|
||||
|
|
@ -54,33 +53,14 @@ where
|
|||
connection: Connection<T, Bytes>,
|
||||
on_connect_data: OnConnectData,
|
||||
config: ServiceConfig,
|
||||
timeout: Option<Sleep>,
|
||||
peer_addr: Option<net::SocketAddr>,
|
||||
) -> Self {
|
||||
// let keepalive = config.keep_alive_enabled();
|
||||
// let flags = if keepalive {
|
||||
// Flags::KEEPALIVE | Flags::KEEPALIVE_ENABLED
|
||||
// } else {
|
||||
// Flags::empty()
|
||||
// };
|
||||
|
||||
// keep-alive timer
|
||||
let (ka_expire, ka_timer) = if let Some(delay) = timeout {
|
||||
(delay.deadline(), Some(delay))
|
||||
} else if let Some(delay) = config.keep_alive_timer() {
|
||||
(delay.deadline(), Some(delay))
|
||||
} else {
|
||||
(config.now(), None)
|
||||
};
|
||||
|
||||
Dispatcher {
|
||||
flow,
|
||||
config,
|
||||
peer_addr,
|
||||
connection,
|
||||
on_connect_data,
|
||||
ka_expire,
|
||||
ka_timer,
|
||||
_phantom: PhantomData,
|
||||
}
|
||||
}
|
||||
|
|
@ -108,13 +88,6 @@ where
|
|||
Some(Err(err)) => return Poll::Ready(Err(err.into())),
|
||||
|
||||
Some(Ok((req, res))) => {
|
||||
// update keep-alive expire
|
||||
if this.ka_timer.is_some() {
|
||||
if let Some(expire) = this.config.keep_alive_expire() {
|
||||
this.ka_expire = expire;
|
||||
}
|
||||
}
|
||||
|
||||
let (parts, body) = req.into_parts();
|
||||
let pl = crate::h2::Payload::new(body);
|
||||
let pl = Payload::<crate::payload::PayloadStream>::H2(pl);
|
||||
|
|
@ -130,7 +103,7 @@ where
|
|||
// merge on_connect_ext data into request extensions
|
||||
this.on_connect_data.merge_into(&mut req);
|
||||
|
||||
let svc = ServiceResponse::<S::Future, S::Response, S::Error, B> {
|
||||
let svc = ServiceResponse {
|
||||
state: ServiceResponseState::ServiceCall(
|
||||
this.flow.service.call(req),
|
||||
Some(res),
|
||||
|
|
@ -311,11 +284,9 @@ where
|
|||
}
|
||||
|
||||
ServiceResponseStateProj::SendPayload(ref mut stream, ref mut body) => {
|
||||
loop {
|
||||
loop {
|
||||
match this.buffer {
|
||||
Some(ref mut buffer) => {
|
||||
match ready!(stream.poll_capacity(cx)) {
|
||||
Some(ref mut buffer) => match ready!(stream.poll_capacity(cx)) {
|
||||
None => return Poll::Ready(()),
|
||||
|
||||
Some(Ok(cap)) => {
|
||||
|
|
@ -337,23 +308,19 @@ where
|
|||
warn!("{:?}", e);
|
||||
return Poll::Ready(());
|
||||
}
|
||||
}
|
||||
}
|
||||
},
|
||||
|
||||
None => match ready!(body.as_mut().poll_next(cx)) {
|
||||
None => {
|
||||
if let Err(e) = stream.send_data(Bytes::new(), true)
|
||||
{
|
||||
if let Err(e) = stream.send_data(Bytes::new(), true) {
|
||||
warn!("{:?}", e);
|
||||
}
|
||||
return Poll::Ready(());
|
||||
}
|
||||
|
||||
Some(Ok(chunk)) => {
|
||||
stream.reserve_capacity(cmp::min(
|
||||
chunk.len(),
|
||||
CHUNK_SIZE,
|
||||
));
|
||||
stream
|
||||
.reserve_capacity(cmp::min(chunk.len(), CHUNK_SIZE));
|
||||
*this.buffer = Some(chunk);
|
||||
}
|
||||
|
||||
|
|
@ -368,4 +335,3 @@ where
|
|||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
|
|
|||
|
|
@ -13,7 +13,7 @@ use actix_service::{
|
|||
use bytes::Bytes;
|
||||
use futures_core::ready;
|
||||
use futures_util::future::ok;
|
||||
use h2::server::{self, Handshake};
|
||||
use h2::server::{handshake, Handshake};
|
||||
use log::error;
|
||||
|
||||
use crate::body::MessageBody;
|
||||
|
|
@ -307,7 +307,7 @@ where
|
|||
Some(self.cfg.clone()),
|
||||
addr,
|
||||
on_connect_data,
|
||||
server::handshake(io),
|
||||
handshake(io),
|
||||
),
|
||||
}
|
||||
}
|
||||
|
|
@ -368,7 +368,6 @@ where
|
|||
conn,
|
||||
on_connect_data,
|
||||
config.take().unwrap(),
|
||||
None,
|
||||
*peer_addr,
|
||||
));
|
||||
self.poll(cx)
|
||||
|
|
|
|||
|
|
@ -36,7 +36,7 @@ use crate::header::{
|
|||
/// builder.insert_header(CacheControl(vec![CacheDirective::MaxAge(86400u32)]));
|
||||
/// ```
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_http::Response;
|
||||
/// use actix_http::http::header::{CacheControl, CacheDirective};
|
||||
///
|
||||
|
|
|
|||
|
|
@ -127,9 +127,8 @@ impl Display for EntityTag {
|
|||
impl FromStr for EntityTag {
|
||||
type Err = crate::error::ParseError;
|
||||
|
||||
fn from_str(s: &str) -> Result<EntityTag, crate::error::ParseError> {
|
||||
let length: usize = s.len();
|
||||
let slice = &s[..];
|
||||
fn from_str(slice: &str) -> Result<EntityTag, crate::error::ParseError> {
|
||||
let length = slice.len();
|
||||
// Early exits if it doesn't terminate in a DQUOTE.
|
||||
if !slice.ends_with('"') || slice.len() < 2 {
|
||||
return Err(crate::error::ParseError::Header);
|
||||
|
|
|
|||
|
|
@ -88,9 +88,9 @@ pub fn parse_extended_value(
|
|||
};
|
||||
|
||||
Ok(ExtendedValue {
|
||||
value,
|
||||
charset,
|
||||
language_tag,
|
||||
value,
|
||||
})
|
||||
}
|
||||
|
||||
|
|
|
|||
|
|
@ -1,15 +1,15 @@
|
|||
use std::io;
|
||||
|
||||
use bytes::{BufMut, BytesMut};
|
||||
use bytes::BufMut;
|
||||
use http::Version;
|
||||
|
||||
const DIGITS_START: u8 = b'0';
|
||||
|
||||
pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut) {
|
||||
pub(crate) fn write_status_line<B: BufMut>(version: Version, n: u16, buf: &mut B) {
|
||||
match version {
|
||||
Version::HTTP_11 => bytes.put_slice(b"HTTP/1.1 "),
|
||||
Version::HTTP_10 => bytes.put_slice(b"HTTP/1.0 "),
|
||||
Version::HTTP_09 => bytes.put_slice(b"HTTP/0.9 "),
|
||||
Version::HTTP_11 => buf.put_slice(b"HTTP/1.1 "),
|
||||
Version::HTTP_10 => buf.put_slice(b"HTTP/1.0 "),
|
||||
Version::HTTP_09 => buf.put_slice(b"HTTP/0.9 "),
|
||||
_ => {
|
||||
// other HTTP version handlers do not use this method
|
||||
}
|
||||
|
|
@ -19,33 +19,36 @@ pub(crate) fn write_status_line(version: Version, n: u16, bytes: &mut BytesMut)
|
|||
let d10 = ((n / 10) % 10) as u8;
|
||||
let d1 = (n % 10) as u8;
|
||||
|
||||
bytes.put_u8(DIGITS_START + d100);
|
||||
bytes.put_u8(DIGITS_START + d10);
|
||||
bytes.put_u8(DIGITS_START + d1);
|
||||
buf.put_u8(DIGITS_START + d100);
|
||||
buf.put_u8(DIGITS_START + d10);
|
||||
buf.put_u8(DIGITS_START + d1);
|
||||
|
||||
// trailing space before reason
|
||||
bytes.put_u8(b' ');
|
||||
buf.put_u8(b' ');
|
||||
}
|
||||
|
||||
/// NOTE: bytes object has to contain enough space
|
||||
pub fn write_content_length(n: u64, bytes: &mut BytesMut) {
|
||||
pub fn write_content_length<B: BufMut>(n: u64, buf: &mut B) {
|
||||
if n == 0 {
|
||||
bytes.put_slice(b"\r\ncontent-length: 0\r\n");
|
||||
buf.put_slice(b"\r\ncontent-length: 0\r\n");
|
||||
return;
|
||||
}
|
||||
|
||||
let mut buf = itoa::Buffer::new();
|
||||
let mut buffer = itoa::Buffer::new();
|
||||
|
||||
bytes.put_slice(b"\r\ncontent-length: ");
|
||||
bytes.put_slice(buf.format(n).as_bytes());
|
||||
bytes.put_slice(b"\r\n");
|
||||
buf.put_slice(b"\r\ncontent-length: ");
|
||||
buf.put_slice(buffer.format(n).as_bytes());
|
||||
buf.put_slice(b"\r\n");
|
||||
}
|
||||
|
||||
pub(crate) struct Writer<'a>(pub &'a mut BytesMut);
|
||||
pub(crate) struct Writer<'a, B>(pub &'a mut B);
|
||||
|
||||
impl<'a> io::Write for Writer<'a> {
|
||||
impl<'a, B> io::Write for Writer<'a, B>
|
||||
where
|
||||
B: BufMut,
|
||||
{
|
||||
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
|
||||
self.0.extend_from_slice(buf);
|
||||
self.0.put_slice(buf);
|
||||
Ok(buf.len())
|
||||
}
|
||||
|
||||
|
|
@ -58,6 +61,8 @@ impl<'a> io::Write for Writer<'a> {
|
|||
mod tests {
|
||||
use std::str::from_utf8;
|
||||
|
||||
use bytes::BytesMut;
|
||||
|
||||
use super::*;
|
||||
|
||||
#[test]
|
||||
|
|
|
|||
|
|
@ -357,7 +357,7 @@ impl ResponseBuilder {
|
|||
|
||||
/// Insert a header, replacing any that were set with an equivalent field name.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// # use actix_http::Response;
|
||||
/// use actix_http::http::header::ContentType;
|
||||
///
|
||||
|
|
@ -384,7 +384,7 @@ impl ResponseBuilder {
|
|||
|
||||
/// Append a header, keeping any that were set with an equivalent field name.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// # use actix_http::Response;
|
||||
/// use actix_http::http::header::ContentType;
|
||||
///
|
||||
|
|
@ -525,7 +525,7 @@ impl ResponseBuilder {
|
|||
|
||||
/// Set a cookie
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_http::{http, Request, Response};
|
||||
///
|
||||
/// fn index(req: Request) -> Response {
|
||||
|
|
@ -555,7 +555,7 @@ impl ResponseBuilder {
|
|||
|
||||
/// Remove cookie
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_http::{http, Request, Response, HttpMessage};
|
||||
///
|
||||
/// fn index(req: Request) -> Response {
|
||||
|
|
|
|||
|
|
@ -1,14 +1,19 @@
|
|||
use std::marker::PhantomData;
|
||||
use std::pin::Pin;
|
||||
use std::task::{Context, Poll};
|
||||
use std::{fmt, net, rc::Rc};
|
||||
use std::{
|
||||
fmt,
|
||||
future::Future,
|
||||
marker::PhantomData,
|
||||
net,
|
||||
pin::Pin,
|
||||
rc::Rc,
|
||||
task::{Context, Poll},
|
||||
};
|
||||
|
||||
use actix_codec::{AsyncRead, AsyncWrite, Framed};
|
||||
use actix_rt::net::TcpStream;
|
||||
use actix_service::{pipeline_factory, IntoServiceFactory, Service, ServiceFactory};
|
||||
use bytes::Bytes;
|
||||
use futures_core::{ready, Future};
|
||||
use h2::server::{self, Handshake};
|
||||
use futures_core::ready;
|
||||
use h2::server::{handshake, Handshake};
|
||||
use pin_project::pin_project;
|
||||
|
||||
use crate::body::MessageBody;
|
||||
|
|
@ -562,7 +567,7 @@ where
|
|||
match proto {
|
||||
Protocol::Http2 => HttpServiceHandlerResponse {
|
||||
state: State::H2Handshake(Some((
|
||||
server::handshake(io),
|
||||
handshake(io),
|
||||
self.cfg.clone(),
|
||||
self.flow.clone(),
|
||||
on_connect_data,
|
||||
|
|
@ -658,7 +663,6 @@ where
|
|||
conn,
|
||||
on_connect_data,
|
||||
cfg,
|
||||
None,
|
||||
peer_addr,
|
||||
)));
|
||||
self.poll(cx)
|
||||
|
|
|
|||
|
|
@ -26,7 +26,7 @@ use crate::{
|
|||
|
||||
/// Test `Request` builder
|
||||
///
|
||||
/// ```rust,ignore
|
||||
/// ```ignore
|
||||
/// # use http::{header, StatusCode};
|
||||
/// # use actix_web::*;
|
||||
/// use actix_web::test::TestRequest;
|
||||
|
|
|
|||
|
|
@ -1,7 +1,7 @@
|
|||
use time::{Date, OffsetDateTime, PrimitiveDateTime};
|
||||
|
||||
/// Attempt to parse a `time` string as one of either RFC 1123, RFC 850, or asctime.
|
||||
pub fn parse_http_date(time: &str) -> Option<PrimitiveDateTime> {
|
||||
pub(crate) fn parse_http_date(time: &str) -> Option<PrimitiveDateTime> {
|
||||
try_parse_rfc_1123(time)
|
||||
.or_else(|| try_parse_rfc_850(time))
|
||||
.or_else(|| try_parse_asctime(time))
|
||||
|
|
|
|||
|
|
@ -6,7 +6,7 @@ use actix_service::ServiceFactoryExt;
|
|||
use bytes::Bytes;
|
||||
use futures_util::{
|
||||
future::{self, ok},
|
||||
StreamExt,
|
||||
StreamExt as _,
|
||||
};
|
||||
|
||||
const STR: &str = "Hello World Hello World Hello World Hello World Hello World \
|
||||
|
|
|
|||
|
|
@ -12,8 +12,11 @@ use actix_http::{body, Error, HttpService, Request, Response};
|
|||
use actix_http_test::test_server;
|
||||
use actix_service::{fn_service, ServiceFactoryExt};
|
||||
use bytes::{Bytes, BytesMut};
|
||||
use futures_util::future::{err, ok, ready};
|
||||
use futures_util::stream::{once, Stream, StreamExt};
|
||||
use futures_core::Stream;
|
||||
use futures_util::{
|
||||
future::{err, ok, ready},
|
||||
stream::{once, StreamExt as _},
|
||||
};
|
||||
use openssl::{
|
||||
pkey::PKey,
|
||||
ssl::{SslAcceptor, SslMethod},
|
||||
|
|
|
|||
|
|
@ -10,8 +10,9 @@ use actix_http_test::test_server;
|
|||
use actix_service::{fn_factory_with_config, fn_service};
|
||||
|
||||
use bytes::{Bytes, BytesMut};
|
||||
use futures_core::Stream;
|
||||
use futures_util::future::{self, err, ok};
|
||||
use futures_util::stream::{once, Stream, StreamExt};
|
||||
use futures_util::stream::{once, StreamExt as _};
|
||||
use rustls::{
|
||||
internal::pemfile::{certs, pkcs8_private_keys},
|
||||
NoClientAuth, ServerConfig as RustlsServerConfig,
|
||||
|
|
|
|||
|
|
@ -7,7 +7,7 @@ use actix_rt::time::sleep;
|
|||
use actix_service::fn_service;
|
||||
use bytes::Bytes;
|
||||
use futures_util::future::{self, err, ok, ready, FutureExt};
|
||||
use futures_util::stream::{once, StreamExt};
|
||||
use futures_util::stream::{once, StreamExt as _};
|
||||
use regex::Regex;
|
||||
|
||||
use actix_http::HttpMessage;
|
||||
|
|
@ -126,7 +126,7 @@ async fn test_chunked_payload() {
|
|||
.take_payload()
|
||||
.map(|res| match res {
|
||||
Ok(pl) => pl,
|
||||
Err(e) => panic!(format!("Error reading payload: {}", e)),
|
||||
Err(e) => panic!("Error reading payload: {}", e),
|
||||
})
|
||||
.fold(0usize, |acc, chunk| ready(acc + chunk.len()))
|
||||
.map(|req_size| {
|
||||
|
|
@ -162,7 +162,7 @@ async fn test_chunked_payload() {
|
|||
let re = Regex::new(r"size=(\d+)").unwrap();
|
||||
let size: usize = match re.captures(&data) {
|
||||
Some(caps) => caps.get(1).unwrap().as_str().parse().unwrap(),
|
||||
None => panic!(format!("Failed to find size in HTTP Response: {}", data)),
|
||||
None => panic!("Failed to find size in HTTP Response: {}", data),
|
||||
};
|
||||
size
|
||||
};
|
||||
|
|
|
|||
|
|
@ -12,7 +12,7 @@ use actix_utils::dispatcher::Dispatcher;
|
|||
use bytes::Bytes;
|
||||
use futures_util::future;
|
||||
use futures_util::task::{Context, Poll};
|
||||
use futures_util::{SinkExt, StreamExt};
|
||||
use futures_util::{SinkExt as _, StreamExt as _};
|
||||
|
||||
struct WsService<T>(Arc<Mutex<(PhantomData<T>, Cell<bool>)>>);
|
||||
|
||||
|
|
|
|||
|
|
@ -3,6 +3,10 @@
|
|||
## Unreleased - 2021-xx-xx
|
||||
|
||||
|
||||
## 0.4.0-beta.3 - 2021-03-09
|
||||
* No notable changes.
|
||||
|
||||
|
||||
## 0.4.0-beta.2 - 2021-02-10
|
||||
* No notable changes.
|
||||
|
||||
|
|
|
|||
|
|
@ -1,6 +1,6 @@
|
|||
[package]
|
||||
name = "actix-multipart"
|
||||
version = "0.4.0-beta.2"
|
||||
version = "0.4.0-beta.3"
|
||||
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
|
||||
description = "Multipart form support for Actix Web"
|
||||
readme = "README.md"
|
||||
|
|
@ -16,7 +16,7 @@ name = "actix_multipart"
|
|||
path = "src/lib.rs"
|
||||
|
||||
[dependencies]
|
||||
actix-web = { version = "4.0.0-beta.3", default-features = false }
|
||||
actix-web = { version = "4.0.0-beta.4", default-features = false }
|
||||
actix-utils = "3.0.0-beta.2"
|
||||
|
||||
bytes = "1"
|
||||
|
|
@ -29,6 +29,6 @@ twoway = "0.2"
|
|||
|
||||
[dev-dependencies]
|
||||
actix-rt = "2.1"
|
||||
actix-http = "3.0.0-beta.3"
|
||||
actix-http = "3.0.0-beta.4"
|
||||
tokio = { version = "1", features = ["sync"] }
|
||||
tokio-stream = "0.1"
|
||||
|
|
|
|||
|
|
@ -3,13 +3,12 @@
|
|||
> Multipart form support for Actix Web.
|
||||
|
||||
[](https://crates.io/crates/actix-multipart)
|
||||
[](https://docs.rs/actix-multipart/0.4.0-beta.2)
|
||||
[](https://docs.rs/actix-multipart/0.4.0-beta.3)
|
||||
[](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
|
||||

|
||||
<br />
|
||||
[](https://deps.rs/crate/actix-multipart/0.4.0-beta.2)
|
||||
[](https://deps.rs/crate/actix-multipart/0.4.0-beta.3)
|
||||
[](https://crates.io/crates/actix-multipart)
|
||||
[](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
||||
|
||||
## Documentation & Resources
|
||||
|
||||
|
|
|
|||
|
|
@ -10,7 +10,7 @@ use crate::server::Multipart;
|
|||
///
|
||||
/// ## Server example
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use futures_util::stream::{Stream, StreamExt};
|
||||
/// use actix_web::{web, HttpResponse, Error};
|
||||
/// use actix_multipart as mp;
|
||||
|
|
|
|||
|
|
@ -3,6 +3,10 @@
|
|||
## Unreleased - 2021-xx-xx
|
||||
|
||||
|
||||
## 4.0.0-beta.3 - 2021-03-09
|
||||
* No notable changes.
|
||||
|
||||
|
||||
## 4.0.0-beta.2 - 2021-02-10
|
||||
* No notable changes.
|
||||
|
||||
|
|
|
|||
|
|
@ -1,6 +1,6 @@
|
|||
[package]
|
||||
name = "actix-web-actors"
|
||||
version = "4.0.0-beta.2"
|
||||
version = "4.0.0-beta.3"
|
||||
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
|
||||
description = "Actix actors support for Actix Web"
|
||||
readme = "README.md"
|
||||
|
|
@ -18,8 +18,8 @@ path = "src/lib.rs"
|
|||
[dependencies]
|
||||
actix = { version = "0.11.0-beta.3", default-features = false }
|
||||
actix-codec = "0.4.0-beta.1"
|
||||
actix-http = "3.0.0-beta.3"
|
||||
actix-web = { version = "4.0.0-beta.3", default-features = false }
|
||||
actix-http = "3.0.0-beta.4"
|
||||
actix-web = { version = "4.0.0-beta.4", default-features = false }
|
||||
|
||||
bytes = "1"
|
||||
bytestring = "1"
|
||||
|
|
|
|||
|
|
@ -3,11 +3,11 @@
|
|||
> Actix actors support for Actix Web.
|
||||
|
||||
[](https://crates.io/crates/actix-web-actors)
|
||||
[](https://docs.rs/actix-web-actors/0.5.0)
|
||||
[](https://docs.rs/actix-web-actors/4.0.0-beta.3)
|
||||
[](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
|
||||

|
||||
<br />
|
||||
[](https://deps.rs/crate/actix-web-actors/0.5.0)
|
||||
[](https://deps.rs/crate/actix-web-actors/4.0.0-beta.3)
|
||||
[](https://crates.io/crates/actix-web-actors)
|
||||
[](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
||||
|
||||
|
|
|
|||
|
|
@ -1,6 +1,9 @@
|
|||
# Changes
|
||||
|
||||
## Unreleased - 2021-xx-xx
|
||||
|
||||
|
||||
## 0.5.0-beta.2 - 2021-03-09
|
||||
* Preserve doc comments when using route macros. [#2022]
|
||||
* Add `name` attribute to `route` macro. [#1934]
|
||||
|
||||
|
|
|
|||
|
|
@ -1,6 +1,6 @@
|
|||
[package]
|
||||
name = "actix-web-codegen"
|
||||
version = "0.5.0-beta.1"
|
||||
version = "0.5.0-beta.2"
|
||||
description = "Routing and runtime macros for Actix Web"
|
||||
readme = "README.md"
|
||||
homepage = "https://actix.rs"
|
||||
|
|
@ -20,7 +20,7 @@ proc-macro2 = "1"
|
|||
|
||||
[dev-dependencies]
|
||||
actix-rt = "2.1"
|
||||
actix-web = "4.0.0-beta.3"
|
||||
actix-web = "4.0.0-beta.4"
|
||||
futures-util = { version = "0.3.7", default-features = false }
|
||||
trybuild = "1"
|
||||
rustversion = "1"
|
||||
|
|
|
|||
|
|
@ -3,11 +3,11 @@
|
|||
> Routing and runtime macros for Actix Web.
|
||||
|
||||
[](https://crates.io/crates/actix-web-codegen)
|
||||
[](https://docs.rs/actix-web-codegen/0.5.0-beta.1)
|
||||
[](https://docs.rs/actix-web-codegen/0.5.0-beta.2)
|
||||
[](https://blog.rust-lang.org/2020/03/12/Rust-1.46.html)
|
||||

|
||||
<br />
|
||||
[](https://deps.rs/crate/actix-web-codegen/0.5.0-beta.1)
|
||||
[](https://deps.rs/crate/actix-web-codegen/0.5.0-beta.2)
|
||||
[](https://crates.io/crates/actix-web-codegen)
|
||||
[](https://gitter.im/actix/actix?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
||||
|
||||
|
|
|
|||
|
|
@ -82,7 +82,7 @@ mod route;
|
|||
///
|
||||
/// # Example
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// # use actix_web::HttpResponse;
|
||||
/// # use actix_web_codegen::route;
|
||||
/// #[route("/test", method="GET", method="HEAD")]
|
||||
|
|
@ -127,7 +127,7 @@ code, e.g `my_guard` or `my_module::my_guard`.
|
|||
|
||||
# Example
|
||||
|
||||
```rust
|
||||
```
|
||||
# use actix_web::HttpResponse;
|
||||
# use actix_web_codegen::"#, stringify!($method), ";
|
||||
#[", stringify!($method), r#"("/")]
|
||||
|
|
@ -162,7 +162,7 @@ method_macro! {
|
|||
/// This macro can be applied with `#[actix_web::main]` when used in Actix Web applications.
|
||||
///
|
||||
/// # Examples
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// #[actix_web_codegen::main]
|
||||
/// async fn main() {
|
||||
/// async { println!("Hello world"); }.await
|
||||
|
|
|
|||
|
|
@ -1,6 +1,15 @@
|
|||
# Changes
|
||||
|
||||
## Unreleased - 2021-xx-xx
|
||||
### Changed
|
||||
* `ConnectorService` type is renamed to `BoxConnectorService`. [#2081]
|
||||
* Fix http/https encoding when enabling `compress` feature. [#2116]
|
||||
|
||||
[#2081]: https://github.com/actix/actix-web/pull/2081
|
||||
[#2116]: https://github.com/actix/actix-web/pull/2116
|
||||
|
||||
|
||||
## 3.0.0-beta.3 - 2021-03-08
|
||||
### Added
|
||||
* `ClientResponse::timeout` for set the timeout of collecting response body. [#1931]
|
||||
* `ClientBuilder::local_address` for bind to a local ip address for this client. [#2024]
|
||||
|
|
|
|||
|
|
@ -1,6 +1,6 @@
|
|||
[package]
|
||||
name = "awc"
|
||||
version = "3.0.0-beta.2"
|
||||
version = "3.0.0-beta.3"
|
||||
authors = ["Nikolay Kim <fafhrd91@gmail.com>"]
|
||||
description = "Async HTTP and WebSocket client library built on the Actix ecosystem"
|
||||
readme = "README.md"
|
||||
|
|
@ -46,12 +46,11 @@ trust-dns = ["actix-http/trust-dns"]
|
|||
[dependencies]
|
||||
actix-codec = "0.4.0-beta.1"
|
||||
actix-service = "2.0.0-beta.4"
|
||||
actix-http = "3.0.0-beta.3"
|
||||
actix-http = "3.0.0-beta.4"
|
||||
actix-rt = { version = "2.1", default-features = false }
|
||||
|
||||
base64 = "0.13"
|
||||
bytes = "1"
|
||||
cfg-if = "1.0"
|
||||
derive_more = "0.99.5"
|
||||
futures-core = { version = "0.3.7", default-features = false }
|
||||
itoa = "0.4"
|
||||
|
|
@ -66,16 +65,10 @@ serde_urlencoded = "0.7"
|
|||
tls-openssl = { version = "0.10.9", package = "openssl", optional = true }
|
||||
tls-rustls = { version = "0.19.0", package = "rustls", optional = true, features = ["dangerous_configuration"] }
|
||||
|
||||
[target.'cfg(windows)'.dependencies.tls-openssl]
|
||||
version = "0.10.9"
|
||||
package = "openssl"
|
||||
features = ["vendored"]
|
||||
optional = true
|
||||
|
||||
[dev-dependencies]
|
||||
actix-web = { version = "4.0.0-beta.3", features = ["openssl"] }
|
||||
actix-http = { version = "3.0.0-beta.3", features = ["openssl"] }
|
||||
actix-http-test = { version = "3.0.0-beta.2", features = ["openssl"] }
|
||||
actix-web = { version = "4.0.0-beta.4", features = ["openssl"] }
|
||||
actix-http = { version = "3.0.0-beta.4", features = ["openssl"] }
|
||||
actix-http-test = { version = "3.0.0-beta.3", features = ["openssl"] }
|
||||
actix-utils = "3.0.0-beta.1"
|
||||
actix-server = "2.0.0-beta.3"
|
||||
actix-tls = { version = "3.0.0-beta.4", features = ["openssl", "rustls"] }
|
||||
|
|
|
|||
|
|
@ -3,9 +3,9 @@
|
|||
> Async HTTP and WebSocket client library.
|
||||
|
||||
[](https://crates.io/crates/awc)
|
||||
[](https://docs.rs/awc/3.0.0-beta.2)
|
||||
[](https://docs.rs/awc/3.0.0-beta.3)
|
||||

|
||||
[](https://deps.rs/crate/awc/3.0.0-beta.2)
|
||||
[](https://deps.rs/crate/awc/3.0.0-beta.3)
|
||||
[](https://gitter.im/actix/actix-web?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
||||
|
||||
## Documentation & Resources
|
||||
|
|
@ -27,7 +27,7 @@ fn main() {
|
|||
|
||||
let res = client
|
||||
.get("http://www.rust-lang.org") // <- Create request builder
|
||||
.header("User-Agent", "Actix-web")
|
||||
.insert_header(("User-Agent", "Actix-web"))
|
||||
.send() // <- Send http request
|
||||
.await;
|
||||
|
||||
|
|
|
|||
|
|
@ -6,7 +6,7 @@ use std::time::Duration;
|
|||
|
||||
use actix_codec::{AsyncRead, AsyncWrite};
|
||||
use actix_http::{
|
||||
client::{Connector, TcpConnect, TcpConnectError, TcpConnection},
|
||||
client::{Connector, ConnectorService, TcpConnect, TcpConnectError, TcpConnection},
|
||||
http::{self, header, Error as HttpError, HeaderMap, HeaderName, Uri},
|
||||
};
|
||||
use actix_rt::net::TcpStream;
|
||||
|
|
@ -15,20 +15,20 @@ use actix_service::{boxed, Service};
|
|||
use crate::connect::DefaultConnector;
|
||||
use crate::error::SendRequestError;
|
||||
use crate::middleware::{NestTransform, Redirect, Transform};
|
||||
use crate::{Client, ClientConfig, ConnectRequest, ConnectResponse, ConnectorService};
|
||||
use crate::{Client, ClientConfig, ConnectRequest, ConnectResponse};
|
||||
|
||||
/// An HTTP Client builder
|
||||
///
|
||||
/// This type can be used to construct an instance of `Client` through a
|
||||
/// builder-like pattern.
|
||||
pub struct ClientBuilder<S = (), Io = (), M = ()> {
|
||||
pub struct ClientBuilder<S = (), M = ()> {
|
||||
default_headers: bool,
|
||||
max_http_version: Option<http::Version>,
|
||||
stream_window_size: Option<u32>,
|
||||
conn_window_size: Option<u32>,
|
||||
headers: HeaderMap,
|
||||
timeout: Option<Duration>,
|
||||
connector: Connector<S, Io>,
|
||||
connector: Connector<S>,
|
||||
middleware: M,
|
||||
local_address: Option<IpAddr>,
|
||||
max_redirects: u8,
|
||||
|
|
@ -42,7 +42,6 @@ impl ClientBuilder {
|
|||
Response = TcpConnection<Uri, TcpStream>,
|
||||
Error = TcpConnectError,
|
||||
> + Clone,
|
||||
TcpStream,
|
||||
(),
|
||||
> {
|
||||
ClientBuilder {
|
||||
|
|
@ -60,7 +59,7 @@ impl ClientBuilder {
|
|||
}
|
||||
}
|
||||
|
||||
impl<S, Io, M> ClientBuilder<S, Io, M>
|
||||
impl<S, Io, M> ClientBuilder<S, M>
|
||||
where
|
||||
S: Service<TcpConnect<Uri>, Response = TcpConnection<Uri, Io>, Error = TcpConnectError>
|
||||
+ Clone
|
||||
|
|
@ -68,7 +67,7 @@ where
|
|||
Io: AsyncRead + AsyncWrite + Unpin + fmt::Debug + 'static,
|
||||
{
|
||||
/// Use custom connector service.
|
||||
pub fn connector<S1, Io1>(self, connector: Connector<S1, Io1>) -> ClientBuilder<S1, Io1, M>
|
||||
pub fn connector<S1, Io1>(self, connector: Connector<S1>) -> ClientBuilder<S1, M>
|
||||
where
|
||||
S1: Service<
|
||||
TcpConnect<Uri>,
|
||||
|
|
@ -213,7 +212,7 @@ where
|
|||
pub fn wrap<S1, M1>(
|
||||
self,
|
||||
mw: M1,
|
||||
) -> ClientBuilder<S, Io, NestTransform<M, M1, S1, ConnectRequest>>
|
||||
) -> ClientBuilder<S, NestTransform<M, M1, S1, ConnectRequest>>
|
||||
where
|
||||
M: Transform<S1, ConnectRequest>,
|
||||
M1: Transform<M::Transform, ConnectRequest>,
|
||||
|
|
@ -235,7 +234,7 @@ where
|
|||
/// Finish build process and create `Client` instance.
|
||||
pub fn finish(self) -> Client
|
||||
where
|
||||
M: Transform<ConnectorService, ConnectRequest> + 'static,
|
||||
M: Transform<DefaultConnector<ConnectorService<S, Io>>, ConnectRequest> + 'static,
|
||||
M::Transform:
|
||||
Service<ConnectRequest, Response = ConnectResponse, Error = SendRequestError>,
|
||||
{
|
||||
|
|
@ -251,7 +250,7 @@ where
|
|||
|
||||
fn _finish(self) -> Client
|
||||
where
|
||||
M: Transform<ConnectorService, ConnectRequest> + 'static,
|
||||
M: Transform<DefaultConnector<ConnectorService<S, Io>>, ConnectRequest> + 'static,
|
||||
M::Transform:
|
||||
Service<ConnectRequest, Response = ConnectResponse, Error = SendRequestError>,
|
||||
{
|
||||
|
|
@ -270,16 +269,14 @@ where
|
|||
connector = connector.local_address(val);
|
||||
}
|
||||
|
||||
let connector = boxed::service(DefaultConnector::new(connector.finish()));
|
||||
let connector = boxed::service(self.middleware.new_transform(connector));
|
||||
let connector = DefaultConnector::new(connector.finish());
|
||||
let connector = boxed::rc_service(self.middleware.new_transform(connector));
|
||||
|
||||
let config = ClientConfig {
|
||||
headers: self.headers,
|
||||
Client(ClientConfig {
|
||||
headers: Rc::new(self.headers),
|
||||
timeout: self.timeout,
|
||||
connector,
|
||||
};
|
||||
|
||||
Client(Rc::new(config))
|
||||
})
|
||||
}
|
||||
}
|
||||
|
||||
|
|
|
|||
|
|
@ -1,15 +1,17 @@
|
|||
use std::{
|
||||
fmt,
|
||||
future::Future,
|
||||
io, net,
|
||||
net,
|
||||
pin::Pin,
|
||||
rc::Rc,
|
||||
task::{Context, Poll},
|
||||
};
|
||||
|
||||
use actix_codec::{AsyncRead, AsyncWrite, Framed, ReadBuf};
|
||||
use actix_codec::Framed;
|
||||
use actix_http::{
|
||||
body::Body,
|
||||
client::{Connect as ClientConnect, ConnectError, Connection, SendRequestError},
|
||||
client::{
|
||||
Connect as ClientConnect, ConnectError, Connection, ConnectionIo, SendRequestError,
|
||||
},
|
||||
h1::ClientCodec,
|
||||
Payload, RequestHead, RequestHeadType, ResponseHead,
|
||||
};
|
||||
|
|
@ -18,7 +20,7 @@ use futures_core::{future::LocalBoxFuture, ready};
|
|||
|
||||
use crate::response::ClientResponse;
|
||||
|
||||
pub type ConnectorService = Box<
|
||||
pub type BoxConnectorService = Rc<
|
||||
dyn Service<
|
||||
ConnectRequest,
|
||||
Response = ConnectResponse,
|
||||
|
|
@ -27,6 +29,8 @@ pub type ConnectorService = Box<
|
|||
>,
|
||||
>;
|
||||
|
||||
pub type BoxedSocket = Box<dyn ConnectionIo>;
|
||||
|
||||
pub enum ConnectRequest {
|
||||
Client(RequestHeadType, Body, Option<net::SocketAddr>),
|
||||
Tunnel(RequestHead, Option<net::SocketAddr>),
|
||||
|
|
@ -57,7 +61,7 @@ impl ConnectResponse {
|
|||
}
|
||||
}
|
||||
|
||||
pub(crate) struct DefaultConnector<S> {
|
||||
pub struct DefaultConnector<S> {
|
||||
connector: S,
|
||||
}
|
||||
|
||||
|
|
@ -67,15 +71,14 @@ impl<S> DefaultConnector<S> {
|
|||
}
|
||||
}
|
||||
|
||||
impl<S> Service<ConnectRequest> for DefaultConnector<S>
|
||||
impl<S, Io> Service<ConnectRequest> for DefaultConnector<S>
|
||||
where
|
||||
S: Service<ClientConnect, Error = ConnectError>,
|
||||
S::Response: Connection,
|
||||
<S::Response as Connection>::Io: 'static,
|
||||
S: Service<ClientConnect, Error = ConnectError, Response = Connection<Io>>,
|
||||
Io: ConnectionIo,
|
||||
{
|
||||
type Response = ConnectResponse;
|
||||
type Error = SendRequestError;
|
||||
type Future = ConnectRequestFuture<S::Future, <S::Response as Connection>::Io>;
|
||||
type Future = ConnectRequestFuture<S::Future, Io>;
|
||||
|
||||
actix_service::forward_ready!(connector);
|
||||
|
||||
|
|
@ -101,7 +104,10 @@ where
|
|||
|
||||
pin_project_lite::pin_project! {
|
||||
#[project = ConnectRequestProj]
|
||||
pub(crate) enum ConnectRequestFuture<Fut, Io> {
|
||||
pub enum ConnectRequestFuture<Fut, Io>
|
||||
where
|
||||
Io: ConnectionIo
|
||||
{
|
||||
Connection {
|
||||
#[pin]
|
||||
fut: Fut,
|
||||
|
|
@ -113,17 +119,16 @@ pin_project_lite::pin_project! {
|
|||
Tunnel {
|
||||
fut: LocalBoxFuture<
|
||||
'static,
|
||||
Result<(ResponseHead, Framed<Io, ClientCodec>), SendRequestError>,
|
||||
Result<(ResponseHead, Framed<Connection<Io>, ClientCodec>), SendRequestError>,
|
||||
>,
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
impl<Fut, C, Io> Future for ConnectRequestFuture<Fut, Io>
|
||||
impl<Fut, Io> Future for ConnectRequestFuture<Fut, Io>
|
||||
where
|
||||
Fut: Future<Output = Result<C, ConnectError>>,
|
||||
C: Connection<Io = Io>,
|
||||
Io: AsyncRead + AsyncWrite + Unpin + 'static,
|
||||
Fut: Future<Output = Result<Connection<Io>, ConnectError>>,
|
||||
Io: ConnectionIo,
|
||||
{
|
||||
type Output = Result<ConnectResponse, SendRequestError>;
|
||||
|
||||
|
|
@ -138,14 +143,14 @@ where
|
|||
let fut = ConnectRequestFuture::Client {
|
||||
fut: connection.send_request(head, body),
|
||||
};
|
||||
self.as_mut().set(fut);
|
||||
self.set(fut);
|
||||
}
|
||||
ConnectRequest::Tunnel(head, ..) => {
|
||||
// send request
|
||||
let fut = ConnectRequestFuture::Tunnel {
|
||||
fut: connection.open_tunnel(RequestHeadType::from(head)),
|
||||
};
|
||||
self.as_mut().set(fut);
|
||||
self.set(fut);
|
||||
}
|
||||
}
|
||||
self.poll(cx)
|
||||
|
|
@ -158,65 +163,9 @@ where
|
|||
}
|
||||
ConnectRequestProj::Tunnel { fut } => {
|
||||
let (head, framed) = ready!(fut.as_mut().poll(cx))?;
|
||||
let framed = framed.into_map_io(|io| BoxedSocket(Box::new(Socket(io))));
|
||||
let framed = framed.into_map_io(|io| Box::new(io) as _);
|
||||
Poll::Ready(Ok(ConnectResponse::Tunnel(head, framed)))
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
trait AsyncSocket {
|
||||
fn as_read(&self) -> &(dyn AsyncRead + Unpin);
|
||||
fn as_read_mut(&mut self) -> &mut (dyn AsyncRead + Unpin);
|
||||
fn as_write(&mut self) -> &mut (dyn AsyncWrite + Unpin);
|
||||
}
|
||||
|
||||
struct Socket<T: AsyncRead + AsyncWrite + Unpin>(T);
|
||||
|
||||
impl<T: AsyncRead + AsyncWrite + Unpin> AsyncSocket for Socket<T> {
|
||||
fn as_read(&self) -> &(dyn AsyncRead + Unpin) {
|
||||
&self.0
|
||||
}
|
||||
fn as_read_mut(&mut self) -> &mut (dyn AsyncRead + Unpin) {
|
||||
&mut self.0
|
||||
}
|
||||
fn as_write(&mut self) -> &mut (dyn AsyncWrite + Unpin) {
|
||||
&mut self.0
|
||||
}
|
||||
}
|
||||
|
||||
pub struct BoxedSocket(Box<dyn AsyncSocket>);
|
||||
|
||||
impl fmt::Debug for BoxedSocket {
|
||||
fn fmt(&self, f: &mut fmt::Formatter<'_>) -> fmt::Result {
|
||||
write!(f, "BoxedSocket")
|
||||
}
|
||||
}
|
||||
|
||||
impl AsyncRead for BoxedSocket {
|
||||
fn poll_read(
|
||||
self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
buf: &mut ReadBuf<'_>,
|
||||
) -> Poll<io::Result<()>> {
|
||||
Pin::new(self.get_mut().0.as_read_mut()).poll_read(cx, buf)
|
||||
}
|
||||
}
|
||||
|
||||
impl AsyncWrite for BoxedSocket {
|
||||
fn poll_write(
|
||||
self: Pin<&mut Self>,
|
||||
cx: &mut Context<'_>,
|
||||
buf: &[u8],
|
||||
) -> Poll<io::Result<usize>> {
|
||||
Pin::new(self.get_mut().0.as_write()).poll_write(cx, buf)
|
||||
}
|
||||
|
||||
fn poll_flush(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
|
||||
Pin::new(self.get_mut().0.as_write()).poll_flush(cx)
|
||||
}
|
||||
|
||||
fn poll_shutdown(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<io::Result<()>> {
|
||||
Pin::new(self.get_mut().0.as_write()).poll_shutdown(cx)
|
||||
}
|
||||
}
|
||||
|
|
|
|||
|
|
@ -23,7 +23,7 @@ pub struct FrozenClientRequest {
|
|||
pub(crate) addr: Option<net::SocketAddr>,
|
||||
pub(crate) response_decompress: bool,
|
||||
pub(crate) timeout: Option<Duration>,
|
||||
pub(crate) config: Rc<ClientConfig>,
|
||||
pub(crate) config: ClientConfig,
|
||||
}
|
||||
|
||||
impl FrozenClientRequest {
|
||||
|
|
@ -51,7 +51,7 @@ impl FrozenClientRequest {
|
|||
self.addr,
|
||||
self.response_decompress,
|
||||
self.timeout,
|
||||
self.config.as_ref(),
|
||||
&self.config,
|
||||
body,
|
||||
)
|
||||
}
|
||||
|
|
@ -62,7 +62,7 @@ impl FrozenClientRequest {
|
|||
self.addr,
|
||||
self.response_decompress,
|
||||
self.timeout,
|
||||
self.config.as_ref(),
|
||||
&self.config,
|
||||
value,
|
||||
)
|
||||
}
|
||||
|
|
@ -73,7 +73,7 @@ impl FrozenClientRequest {
|
|||
self.addr,
|
||||
self.response_decompress,
|
||||
self.timeout,
|
||||
self.config.as_ref(),
|
||||
&self.config,
|
||||
value,
|
||||
)
|
||||
}
|
||||
|
|
@ -88,7 +88,7 @@ impl FrozenClientRequest {
|
|||
self.addr,
|
||||
self.response_decompress,
|
||||
self.timeout,
|
||||
self.config.as_ref(),
|
||||
&self.config,
|
||||
stream,
|
||||
)
|
||||
}
|
||||
|
|
@ -99,7 +99,7 @@ impl FrozenClientRequest {
|
|||
self.addr,
|
||||
self.response_decompress,
|
||||
self.timeout,
|
||||
self.config.as_ref(),
|
||||
&self.config,
|
||||
)
|
||||
}
|
||||
|
||||
|
|
@ -168,7 +168,7 @@ impl FrozenSendBuilder {
|
|||
self.req.addr,
|
||||
self.req.response_decompress,
|
||||
self.req.timeout,
|
||||
self.req.config.as_ref(),
|
||||
&self.req.config,
|
||||
body,
|
||||
)
|
||||
}
|
||||
|
|
@ -183,7 +183,7 @@ impl FrozenSendBuilder {
|
|||
self.req.addr,
|
||||
self.req.response_decompress,
|
||||
self.req.timeout,
|
||||
self.req.config.as_ref(),
|
||||
&self.req.config,
|
||||
value,
|
||||
)
|
||||
}
|
||||
|
|
@ -198,7 +198,7 @@ impl FrozenSendBuilder {
|
|||
self.req.addr,
|
||||
self.req.response_decompress,
|
||||
self.req.timeout,
|
||||
self.req.config.as_ref(),
|
||||
&self.req.config,
|
||||
value,
|
||||
)
|
||||
}
|
||||
|
|
@ -217,7 +217,7 @@ impl FrozenSendBuilder {
|
|||
self.req.addr,
|
||||
self.req.response_decompress,
|
||||
self.req.timeout,
|
||||
self.req.config.as_ref(),
|
||||
&self.req.config,
|
||||
stream,
|
||||
)
|
||||
}
|
||||
|
|
@ -232,7 +232,7 @@ impl FrozenSendBuilder {
|
|||
self.req.addr,
|
||||
self.req.response_decompress,
|
||||
self.req.timeout,
|
||||
self.req.config.as_ref(),
|
||||
&self.req.config,
|
||||
)
|
||||
}
|
||||
}
|
||||
|
|
|
|||
|
|
@ -121,7 +121,7 @@ pub mod test;
|
|||
pub mod ws;
|
||||
|
||||
pub use self::builder::ClientBuilder;
|
||||
pub use self::connect::{BoxedSocket, ConnectRequest, ConnectResponse, ConnectorService};
|
||||
pub use self::connect::{BoxConnectorService, BoxedSocket, ConnectRequest, ConnectResponse};
|
||||
pub use self::frozen::{FrozenClientRequest, FrozenSendBuilder};
|
||||
pub use self::request::ClientRequest;
|
||||
pub use self::response::{ClientResponse, JsonBody, MessageBody};
|
||||
|
|
@ -131,7 +131,7 @@ pub use self::sender::SendClientRequest;
|
|||
///
|
||||
/// ## Examples
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use awc::Client;
|
||||
///
|
||||
/// #[actix_rt::main]
|
||||
|
|
@ -147,11 +147,12 @@ pub use self::sender::SendClientRequest;
|
|||
/// }
|
||||
/// ```
|
||||
#[derive(Clone)]
|
||||
pub struct Client(Rc<ClientConfig>);
|
||||
pub struct Client(ClientConfig);
|
||||
|
||||
#[derive(Clone)]
|
||||
pub(crate) struct ClientConfig {
|
||||
pub(crate) connector: ConnectorService,
|
||||
pub(crate) headers: HeaderMap,
|
||||
pub(crate) connector: BoxConnectorService,
|
||||
pub(crate) headers: Rc<HeaderMap>,
|
||||
pub(crate) timeout: Option<Duration>,
|
||||
}
|
||||
|
||||
|
|
@ -175,7 +176,6 @@ impl Client {
|
|||
Response = TcpConnection<Uri, TcpStream>,
|
||||
Error = TcpConnectError,
|
||||
> + Clone,
|
||||
TcpStream,
|
||||
> {
|
||||
ClientBuilder::new()
|
||||
}
|
||||
|
|
|
|||
|
|
@ -189,7 +189,7 @@ where
|
|||
// remove body
|
||||
.call(ConnectRequest::Client(head, Body::None, addr));
|
||||
|
||||
self.as_mut().set(RedirectServiceFuture::Client {
|
||||
self.set(RedirectServiceFuture::Client {
|
||||
fut,
|
||||
max_redirect_times,
|
||||
uri: Some(uri),
|
||||
|
|
@ -236,7 +236,7 @@ where
|
|||
.unwrap()
|
||||
.call(ConnectRequest::Client(head, body_new, addr));
|
||||
|
||||
self.as_mut().set(RedirectServiceFuture::Client {
|
||||
self.set(RedirectServiceFuture::Client {
|
||||
fut,
|
||||
max_redirect_times,
|
||||
uri: Some(uri),
|
||||
|
|
|
|||
|
|
@ -21,22 +21,17 @@ use crate::frozen::FrozenClientRequest;
|
|||
use crate::sender::{PrepForSendingError, RequestSender, SendClientRequest};
|
||||
use crate::ClientConfig;
|
||||
|
||||
cfg_if::cfg_if! {
|
||||
if #[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))] {
|
||||
#[cfg(feature = "compress")]
|
||||
const HTTPS_ENCODING: &str = "br, gzip, deflate";
|
||||
} else if #[cfg(feature = "compress")] {
|
||||
#[cfg(not(feature = "compress"))]
|
||||
const HTTPS_ENCODING: &str = "br";
|
||||
} else {
|
||||
const HTTPS_ENCODING: &str = "identity";
|
||||
}
|
||||
}
|
||||
|
||||
/// An HTTP Client request builder
|
||||
///
|
||||
/// This type can be used to construct an instance of `ClientRequest` through a
|
||||
/// builder-like pattern.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// #[actix_rt::main]
|
||||
/// async fn main() {
|
||||
/// let response = awc::Client::new()
|
||||
|
|
@ -57,7 +52,7 @@ pub struct ClientRequest {
|
|||
addr: Option<net::SocketAddr>,
|
||||
response_decompress: bool,
|
||||
timeout: Option<Duration>,
|
||||
config: Rc<ClientConfig>,
|
||||
config: ClientConfig,
|
||||
|
||||
#[cfg(feature = "cookies")]
|
||||
cookies: Option<CookieJar>,
|
||||
|
|
@ -65,7 +60,7 @@ pub struct ClientRequest {
|
|||
|
||||
impl ClientRequest {
|
||||
/// Create new client request builder.
|
||||
pub(crate) fn new<U>(method: Method, uri: U, config: Rc<ClientConfig>) -> Self
|
||||
pub(crate) fn new<U>(method: Method, uri: U, config: ClientConfig) -> Self
|
||||
where
|
||||
Uri: TryFrom<U>,
|
||||
<Uri as TryFrom<U>>::Error: Into<HttpError>,
|
||||
|
|
@ -190,7 +185,7 @@ impl ClientRequest {
|
|||
|
||||
/// Append a header, keeping any that were set with an equivalent field name.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// # #[actix_rt::main]
|
||||
/// # async fn main() {
|
||||
/// # use awc::Client;
|
||||
|
|
@ -271,7 +266,7 @@ impl ClientRequest {
|
|||
|
||||
/// Set a cookie
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// #[actix_rt::main]
|
||||
/// async fn main() {
|
||||
/// let resp = awc::Client::new().get("https://www.rust-lang.org")
|
||||
|
|
@ -398,7 +393,7 @@ impl ClientRequest {
|
|||
slf.addr,
|
||||
slf.response_decompress,
|
||||
slf.timeout,
|
||||
slf.config.as_ref(),
|
||||
&slf.config,
|
||||
body,
|
||||
)
|
||||
}
|
||||
|
|
@ -414,7 +409,7 @@ impl ClientRequest {
|
|||
slf.addr,
|
||||
slf.response_decompress,
|
||||
slf.timeout,
|
||||
slf.config.as_ref(),
|
||||
&slf.config,
|
||||
value,
|
||||
)
|
||||
}
|
||||
|
|
@ -432,7 +427,7 @@ impl ClientRequest {
|
|||
slf.addr,
|
||||
slf.response_decompress,
|
||||
slf.timeout,
|
||||
slf.config.as_ref(),
|
||||
&slf.config,
|
||||
value,
|
||||
)
|
||||
}
|
||||
|
|
@ -452,7 +447,7 @@ impl ClientRequest {
|
|||
slf.addr,
|
||||
slf.response_decompress,
|
||||
slf.timeout,
|
||||
slf.config.as_ref(),
|
||||
&slf.config,
|
||||
stream,
|
||||
)
|
||||
}
|
||||
|
|
@ -468,7 +463,7 @@ impl ClientRequest {
|
|||
slf.addr,
|
||||
slf.response_decompress,
|
||||
slf.timeout,
|
||||
slf.config.as_ref(),
|
||||
&slf.config,
|
||||
)
|
||||
}
|
||||
|
||||
|
|
@ -521,11 +516,11 @@ impl ClientRequest {
|
|||
.unwrap_or(true);
|
||||
|
||||
if https {
|
||||
slf = slf.insert_header_if_none((header::ACCEPT_ENCODING, HTTPS_ENCODING))
|
||||
slf = slf.insert_header_if_none((header::ACCEPT_ENCODING, HTTPS_ENCODING));
|
||||
} else {
|
||||
#[cfg(any(feature = "flate2-zlib", feature = "flate2-rust"))]
|
||||
#[cfg(feature = "compress")]
|
||||
{
|
||||
slf = slf.insert_header_if_none((header::ACCEPT_ENCODING, "gzip, deflate"))
|
||||
slf = slf.insert_header_if_none((header::ACCEPT_ENCODING, "gzip, deflate"));
|
||||
}
|
||||
};
|
||||
}
|
||||
|
|
|
|||
|
|
@ -228,12 +228,13 @@ impl<S> fmt::Debug for ClientResponse<S> {
|
|||
}
|
||||
}
|
||||
|
||||
const DEFAULT_BODY_LIMIT: usize = 2 * 1024 * 1024;
|
||||
|
||||
/// Future that resolves to a complete HTTP message body.
|
||||
pub struct MessageBody<S> {
|
||||
length: Option<usize>,
|
||||
err: Option<PayloadError>,
|
||||
timeout: ResponseTimeout,
|
||||
fut: Option<ReadBody<S>>,
|
||||
body: Result<ReadBody<S>, Option<PayloadError>>,
|
||||
}
|
||||
|
||||
impl<S> MessageBody<S>
|
||||
|
|
@ -242,41 +243,38 @@ where
|
|||
{
|
||||
/// Create `MessageBody` for request.
|
||||
pub fn new(res: &mut ClientResponse<S>) -> MessageBody<S> {
|
||||
let mut len = None;
|
||||
if let Some(l) = res.headers().get(&header::CONTENT_LENGTH) {
|
||||
if let Ok(s) = l.to_str() {
|
||||
if let Ok(l) = s.parse::<usize>() {
|
||||
len = Some(l)
|
||||
} else {
|
||||
return Self::err(PayloadError::UnknownLength);
|
||||
}
|
||||
} else {
|
||||
return Self::err(PayloadError::UnknownLength);
|
||||
let length = match res.headers().get(&header::CONTENT_LENGTH) {
|
||||
Some(value) => {
|
||||
let len = value.to_str().ok().and_then(|s| s.parse::<usize>().ok());
|
||||
|
||||
match len {
|
||||
None => return Self::err(PayloadError::UnknownLength),
|
||||
len => len,
|
||||
}
|
||||
}
|
||||
None => None,
|
||||
};
|
||||
|
||||
MessageBody {
|
||||
length: len,
|
||||
err: None,
|
||||
length,
|
||||
timeout: std::mem::take(&mut res.timeout),
|
||||
fut: Some(ReadBody::new(res.take_payload(), 262_144)),
|
||||
body: Ok(ReadBody::new(res.take_payload(), DEFAULT_BODY_LIMIT)),
|
||||
}
|
||||
}
|
||||
|
||||
/// Change max size of payload. By default max size is 256kB
|
||||
/// Change max size of payload. By default max size is 2048kB
|
||||
pub fn limit(mut self, limit: usize) -> Self {
|
||||
if let Some(ref mut fut) = self.fut {
|
||||
fut.limit = limit;
|
||||
if let Ok(ref mut body) = self.body {
|
||||
body.limit = limit;
|
||||
}
|
||||
self
|
||||
}
|
||||
|
||||
fn err(e: PayloadError) -> Self {
|
||||
MessageBody {
|
||||
fut: None,
|
||||
err: Some(e),
|
||||
length: None,
|
||||
timeout: ResponseTimeout::default(),
|
||||
body: Err(Some(e)),
|
||||
}
|
||||
}
|
||||
}
|
||||
|
|
@ -290,19 +288,20 @@ where
|
|||
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
|
||||
let this = self.get_mut();
|
||||
|
||||
if let Some(err) = this.err.take() {
|
||||
return Poll::Ready(Err(err));
|
||||
}
|
||||
|
||||
match this.body {
|
||||
Err(ref mut err) => Poll::Ready(Err(err.take().unwrap())),
|
||||
Ok(ref mut body) => {
|
||||
if let Some(len) = this.length.take() {
|
||||
if len > this.fut.as_ref().unwrap().limit {
|
||||
if len > body.limit {
|
||||
return Poll::Ready(Err(PayloadError::Overflow));
|
||||
}
|
||||
}
|
||||
|
||||
this.timeout.poll_timeout(cx)?;
|
||||
|
||||
Pin::new(&mut this.fut.as_mut().unwrap()).poll(cx)
|
||||
Pin::new(body).poll(cx)
|
||||
}
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
|
|
@ -415,7 +414,7 @@ impl<S> ReadBody<S> {
|
|||
fn new(stream: Payload<S>, limit: usize) -> Self {
|
||||
Self {
|
||||
stream,
|
||||
buf: BytesMut::with_capacity(std::cmp::min(limit, 32768)),
|
||||
buf: BytesMut::new(),
|
||||
limit,
|
||||
}
|
||||
}
|
||||
|
|
@ -430,20 +429,14 @@ where
|
|||
fn poll(self: Pin<&mut Self>, cx: &mut Context<'_>) -> Poll<Self::Output> {
|
||||
let this = self.get_mut();
|
||||
|
||||
loop {
|
||||
return match Pin::new(&mut this.stream).poll_next(cx)? {
|
||||
Poll::Ready(Some(chunk)) => {
|
||||
while let Some(chunk) = ready!(Pin::new(&mut this.stream).poll_next(cx)?) {
|
||||
if (this.buf.len() + chunk.len()) > this.limit {
|
||||
Poll::Ready(Err(PayloadError::Overflow))
|
||||
} else {
|
||||
return Poll::Ready(Err(PayloadError::Overflow));
|
||||
}
|
||||
this.buf.extend_from_slice(&chunk);
|
||||
continue;
|
||||
}
|
||||
}
|
||||
Poll::Ready(None) => Poll::Ready(Ok(this.buf.split().freeze())),
|
||||
Poll::Pending => Poll::Pending,
|
||||
};
|
||||
}
|
||||
|
||||
Poll::Ready(Ok(this.buf.split().freeze()))
|
||||
}
|
||||
}
|
||||
|
||||
|
|
@ -462,7 +455,7 @@ mod tests {
|
|||
_ => unreachable!("error"),
|
||||
}
|
||||
|
||||
let mut req = TestResponse::with_header(header::CONTENT_LENGTH, "1000000").finish();
|
||||
let mut req = TestResponse::with_header(header::CONTENT_LENGTH, "10000000").finish();
|
||||
match req.body().await.err().unwrap() {
|
||||
PayloadError::Overflow => {}
|
||||
_ => unreachable!("error"),
|
||||
|
|
|
|||
|
|
@ -28,7 +28,6 @@
|
|||
|
||||
use std::convert::TryFrom;
|
||||
use std::net::SocketAddr;
|
||||
use std::rc::Rc;
|
||||
use std::{fmt, str};
|
||||
|
||||
use actix_codec::Framed;
|
||||
|
|
@ -56,7 +55,7 @@ pub struct WebsocketsRequest {
|
|||
addr: Option<SocketAddr>,
|
||||
max_size: usize,
|
||||
server_mode: bool,
|
||||
config: Rc<ClientConfig>,
|
||||
config: ClientConfig,
|
||||
|
||||
#[cfg(feature = "cookies")]
|
||||
cookies: Option<CookieJar>,
|
||||
|
|
@ -64,7 +63,7 @@ pub struct WebsocketsRequest {
|
|||
|
||||
impl WebsocketsRequest {
|
||||
/// Create new WebSocket connection
|
||||
pub(crate) fn new<U>(uri: U, config: Rc<ClientConfig>) -> Self
|
||||
pub(crate) fn new<U>(uri: U, config: ClientConfig) -> Self
|
||||
where
|
||||
Uri: TryFrom<U>,
|
||||
<Uri as TryFrom<U>>::Error: Into<HttpError>,
|
||||
|
|
@ -382,7 +381,7 @@ impl WebsocketsRequest {
|
|||
if let Some(hdr_key) = head.headers.get(&header::SEC_WEBSOCKET_ACCEPT) {
|
||||
let encoded = ws::hash_key(key.as_ref());
|
||||
|
||||
if hdr_key.as_bytes() != &encoded {
|
||||
if hdr_key.as_bytes() != encoded {
|
||||
log::trace!(
|
||||
"Invalid challenge response: expected: {:?} received: {:?}",
|
||||
&encoded,
|
||||
|
|
|
|||
|
|
@ -9,7 +9,7 @@ use actix_web::test::{init_service, ok_service, TestRequest};
|
|||
|
||||
/// Criterion Benchmark for async Service
|
||||
/// Should be used from within criterion group:
|
||||
/// ```rust,ignore
|
||||
/// ```ignore
|
||||
/// let mut criterion: ::criterion::Criterion<_> =
|
||||
/// ::criterion::Criterion::default().configure_from_args();
|
||||
/// bench_async_service(&mut criterion, ok_service(), "async_service_direct");
|
||||
|
|
|
|||
|
|
@ -1,35 +1,44 @@
|
|||
digraph {
|
||||
subgraph cluster_web {
|
||||
label="actix/actix-web"
|
||||
label="actix/web"
|
||||
|
||||
"awc"
|
||||
"actix-web"
|
||||
"actix-files"
|
||||
"actix-http"
|
||||
"actix-multipart"
|
||||
"actix-web-actors"
|
||||
"actix-web-codegen"
|
||||
"actix-http-test"
|
||||
"web"
|
||||
"files"
|
||||
"http"
|
||||
"multipart"
|
||||
"web-actors"
|
||||
"web-codegen"
|
||||
"http-test"
|
||||
|
||||
{ rank=same; "multipart" "web-actors" "http-test" };
|
||||
{ rank=same; "files" "awc" "web" };
|
||||
{ rank=same; "web-codegen" "http" };
|
||||
}
|
||||
|
||||
"actix-web" -> { "actix-codec" "actix-service" "actix-utils" "actix-router" "actix-rt" "actix-server" "macros" "threadpool" "actix-tls" "actix-web-codegen" "actix-http" "awc" }
|
||||
"awc" -> { "actix-codec" "actix-service" "actix-http" "actix-rt" }
|
||||
"actix-web-actors" -> { "actix" "actix-web" "actix-http" "actix-codec" }
|
||||
"actix-multipart" -> { "actix-web" "actix-service" "actix-utils" }
|
||||
"actix-http" -> { "actix-service" "actix-codec" "actix-tls" "actix-utils" "actix-rt" "threadpool" }
|
||||
"actix-http" -> { "actix-tls" }[color=blue] // optional
|
||||
"actix-files" -> { "actix-web" }
|
||||
"actix-http-test" -> { "actix-service" "actix-codec" "actix-tls" "actix-utils" "actix-rt" "actix-server" "awc" }
|
||||
"web" -> { "codec" "service" "utils" "router" "rt" "server" "macros" "web-codegen" "http" "awc" }
|
||||
"web" -> { "tls" }[color=blue] // optional
|
||||
"awc" -> { "codec" "service" "http" "rt" }
|
||||
"web-actors" -> { "actix" "web" "http" "codec" }
|
||||
"multipart" -> { "web" "service" "utils" }
|
||||
"http" -> { "service" "codec" "utils" "rt" }
|
||||
"http" -> { "tls" }[color=blue] // optional
|
||||
"files" -> { "web" }
|
||||
"http-test" -> { "service" "codec" "utils" "rt" "server" "awc" }
|
||||
"http-test" -> { "tls" }[color=blue] // optional
|
||||
|
||||
// net
|
||||
|
||||
"actix-utils" -> { "actix-service" "actix-rt" "actix-codec" }
|
||||
"actix-tracing" -> { "actix-service" }
|
||||
"actix-tls" -> { "actix-service" "actix-codec" "actix-utils" }
|
||||
"actix-server" -> { "actix-service" "actix-rt" "actix-codec" "actix-utils" }
|
||||
"actix-rt" -> { "macros" "threadpool" }
|
||||
"utils" -> { "service" "rt" "codec" }
|
||||
"tracing" -> { "service" }
|
||||
"tls" -> { "service" "codec" "utils" }
|
||||
"server" -> { "service" "rt" "codec" "utils" }
|
||||
"rt" -> { "macros" }
|
||||
|
||||
{ rank=same; "utils" "codec" };
|
||||
{ rank=same; "rt" "macros" "service" "router" };
|
||||
|
||||
// actix
|
||||
|
||||
"actix" -> { "actix-rt" }
|
||||
"actix" -> { "rt" }
|
||||
}
|
||||
|
|
|
|||
|
|
@ -30,7 +30,7 @@ async fn main() -> std::io::Result<()> {
|
|||
.service(
|
||||
web::resource("/resource2/index.html")
|
||||
.wrap(middleware::DefaultHeaders::new().header("X-Version-R2", "0.3"))
|
||||
.default_service(web::route().to(|| HttpResponse::MethodNotAllowed()))
|
||||
.default_service(web::route().to(HttpResponse::MethodNotAllowed))
|
||||
.route(web::get().to(index_async)),
|
||||
)
|
||||
.service(web::resource("/test1.html").to(|| async { "Test\r\n" }))
|
||||
|
|
|
|||
|
|
@ -34,7 +34,7 @@ async fn main() -> std::io::Result<()> {
|
|||
.service(
|
||||
web::resource("/resource2/index.html")
|
||||
.wrap(middleware::DefaultHeaders::new().header("X-Version-R2", "0.3"))
|
||||
.default_service(web::route().to(|| HttpResponse::MethodNotAllowed()))
|
||||
.default_service(web::route().to(HttpResponse::MethodNotAllowed))
|
||||
.route(web::get().to(index_async)),
|
||||
)
|
||||
.service(web::resource("/test1.html").to(|| async { "Test\r\n" }))
|
||||
|
|
|
|||
16
src/app.rs
16
src/app.rs
|
|
@ -79,7 +79,7 @@ where
|
|||
/// uses `Arc` so data could be created outside of app factory and clones could
|
||||
/// be stored via `App::app_data()` method.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use std::cell::Cell;
|
||||
/// use actix_web::{web, App, HttpResponse, Responder};
|
||||
///
|
||||
|
|
@ -152,7 +152,7 @@ where
|
|||
/// different module or even library. For example,
|
||||
/// some of the resource's configuration could be moved to different module.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// // this function could be located in different module
|
||||
|
|
@ -185,7 +185,7 @@ where
|
|||
/// This method can be used multiple times with same path, in that case
|
||||
/// multiple resources with one route would be registered for same resource path.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// async fn index(data: web::Path<(String, String)>) -> &'static str {
|
||||
|
|
@ -228,7 +228,7 @@ where
|
|||
///
|
||||
/// It is possible to use services like `Resource`, `Route`.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// async fn index() -> &'static str {
|
||||
|
|
@ -246,7 +246,7 @@ where
|
|||
///
|
||||
/// It is also possible to use static files as default service.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// fn main() {
|
||||
|
|
@ -283,7 +283,7 @@ where
|
|||
/// and are never considered for matching at request time. Calls to
|
||||
/// `HttpRequest::url_for()` will work as expected.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpRequest, HttpResponse, Result};
|
||||
///
|
||||
/// async fn index(req: HttpRequest) -> Result<HttpResponse> {
|
||||
|
|
@ -325,7 +325,7 @@ where
|
|||
/// the builder chain. Consequently, the *first* middleware registered
|
||||
/// in the builder chain is the *last* to execute during request processing.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_service::Service;
|
||||
/// use actix_web::{middleware, web, App};
|
||||
/// use actix_web::http::{header::CONTENT_TYPE, HeaderValue};
|
||||
|
|
@ -382,7 +382,7 @@ where
|
|||
///
|
||||
/// Use middleware when you need to read or modify *every* request or response in some way.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_service::Service;
|
||||
/// use actix_web::{web, App};
|
||||
/// use actix_web::http::{header::CONTENT_TYPE, HeaderValue};
|
||||
|
|
|
|||
|
|
@ -1,6 +1,5 @@
|
|||
use std::cell::RefCell;
|
||||
use std::rc::Rc;
|
||||
use std::task::Poll;
|
||||
|
||||
use actix_http::{Extensions, Request, Response};
|
||||
use actix_router::{Path, ResourceDef, Router, Url};
|
||||
|
|
|
|||
|
|
@ -113,7 +113,7 @@ pub struct AppConfig {
|
|||
|
||||
impl AppConfig {
|
||||
pub(crate) fn new(secure: bool, addr: SocketAddr, host: String) -> Self {
|
||||
AppConfig { secure, addr, host }
|
||||
AppConfig { secure, host, addr }
|
||||
}
|
||||
|
||||
/// Server host name.
|
||||
|
|
|
|||
|
|
@ -37,7 +37,7 @@ pub(crate) type FnDataFactory =
|
|||
/// If route data is not set for a handler, using `Data<T>` extractor would cause *Internal
|
||||
/// Server Error* response.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use std::sync::Mutex;
|
||||
/// use actix_web::{web, App, HttpResponse, Responder};
|
||||
///
|
||||
|
|
|
|||
|
|
@ -51,7 +51,7 @@ pub trait FromRequest: Sized {
|
|||
///
|
||||
/// ## Example
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, dev, App, Error, HttpRequest, FromRequest};
|
||||
/// use actix_web::error::ErrorBadRequest;
|
||||
/// use futures_util::future::{ok, err, Ready};
|
||||
|
|
@ -143,7 +143,7 @@ where
|
|||
///
|
||||
/// ## Example
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, dev, App, Result, Error, HttpRequest, FromRequest};
|
||||
/// use actix_web::error::ErrorBadRequest;
|
||||
/// use futures_util::future::{ok, err, Ready};
|
||||
|
|
|
|||
10
src/guard.rs
10
src/guard.rs
|
|
@ -12,7 +12,7 @@
|
|||
//! to store extra attributes on a request by using the `Extensions` container.
|
||||
//! Extensions containers are available via the `RequestHead::extensions()` method.
|
||||
//!
|
||||
//! ```rust
|
||||
//! ```
|
||||
//! use actix_web::{web, http, dev, guard, App, HttpResponse};
|
||||
//!
|
||||
//! fn main() {
|
||||
|
|
@ -42,7 +42,7 @@ pub trait Guard {
|
|||
|
||||
/// Create guard object for supplied function.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{guard, web, App, HttpResponse};
|
||||
///
|
||||
/// fn main() {
|
||||
|
|
@ -85,7 +85,7 @@ where
|
|||
|
||||
/// Return guard that matches if any of supplied guards.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, guard, App, HttpResponse};
|
||||
///
|
||||
/// fn main() {
|
||||
|
|
@ -124,7 +124,7 @@ impl Guard for AnyGuard {
|
|||
|
||||
/// Return guard that matches if all of the supplied guards.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{guard, web, App, HttpResponse};
|
||||
///
|
||||
/// fn main() {
|
||||
|
|
@ -259,7 +259,7 @@ impl Guard for HeaderGuard {
|
|||
|
||||
/// Return predicate that matches if request contains specified Host name.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, guard::Host, App, HttpResponse};
|
||||
///
|
||||
/// fn main() {
|
||||
|
|
|
|||
|
|
@ -28,17 +28,6 @@ where
|
|||
fn call(&self, param: T) -> R;
|
||||
}
|
||||
|
||||
impl<F, R> Handler<(), R> for F
|
||||
where
|
||||
F: Fn() -> R + Clone + 'static,
|
||||
R: Future,
|
||||
R::Output: Responder,
|
||||
{
|
||||
fn call(&self, _: ()) -> R {
|
||||
(self)()
|
||||
}
|
||||
}
|
||||
|
||||
#[doc(hidden)]
|
||||
/// Extract arguments from request, run factory function and make response.
|
||||
pub struct HandlerService<F, T, R>
|
||||
|
|
@ -177,30 +166,29 @@ where
|
|||
}
|
||||
|
||||
/// FromRequest trait impl for tuples
|
||||
macro_rules! factory_tuple ({ $(($n:tt, $T:ident)),+} => {
|
||||
impl<Func, $($T,)+ Res> Handler<($($T,)+), Res> for Func
|
||||
where Func: Fn($($T,)+) -> Res + Clone + 'static,
|
||||
macro_rules! factory_tuple ({ $($param:ident)* } => {
|
||||
impl<Func, $($param,)* Res> Handler<($($param,)*), Res> for Func
|
||||
where Func: Fn($($param),*) -> Res + Clone + 'static,
|
||||
Res: Future,
|
||||
Res::Output: Responder,
|
||||
{
|
||||
fn call(&self, param: ($($T,)+)) -> Res {
|
||||
(self)($(param.$n,)+)
|
||||
#[allow(non_snake_case)]
|
||||
fn call(&self, ($($param,)*): ($($param,)*)) -> Res {
|
||||
(self)($($param,)*)
|
||||
}
|
||||
}
|
||||
});
|
||||
|
||||
#[rustfmt::skip]
|
||||
mod m {
|
||||
use super::*;
|
||||
|
||||
factory_tuple!((0, A));
|
||||
factory_tuple!((0, A), (1, B));
|
||||
factory_tuple!((0, A), (1, B), (2, C));
|
||||
factory_tuple!((0, A), (1, B), (2, C), (3, D));
|
||||
factory_tuple!((0, A), (1, B), (2, C), (3, D), (4, E));
|
||||
factory_tuple!((0, A), (1, B), (2, C), (3, D), (4, E), (5, F));
|
||||
factory_tuple!((0, A), (1, B), (2, C), (3, D), (4, E), (5, F), (6, G));
|
||||
factory_tuple!((0, A), (1, B), (2, C), (3, D), (4, E), (5, F), (6, G), (7, H));
|
||||
factory_tuple!((0, A), (1, B), (2, C), (3, D), (4, E), (5, F), (6, G), (7, H), (8, I));
|
||||
factory_tuple!((0, A), (1, B), (2, C), (3, D), (4, E), (5, F), (6, G), (7, H), (8, I), (9, J));
|
||||
}
|
||||
factory_tuple! {}
|
||||
factory_tuple! { A }
|
||||
factory_tuple! { A B }
|
||||
factory_tuple! { A B C }
|
||||
factory_tuple! { A B C D }
|
||||
factory_tuple! { A B C D E }
|
||||
factory_tuple! { A B C D E F }
|
||||
factory_tuple! { A B C D E F G }
|
||||
factory_tuple! { A B C D E F G H }
|
||||
factory_tuple! { A B C D E F G H I }
|
||||
factory_tuple! { A B C D E F G H I J }
|
||||
factory_tuple! { A B C D E F G H I J K }
|
||||
factory_tuple! { A B C D E F G H I J K L }
|
||||
|
|
|
|||
14
src/lib.rs
14
src/lib.rs
|
|
@ -2,7 +2,7 @@
|
|||
//!
|
||||
//! ## Example
|
||||
//!
|
||||
//! ```rust,no_run
|
||||
//! ```no_run
|
||||
//! use actix_web::{get, web, App, HttpServer, Responder};
|
||||
//!
|
||||
//! #[get("/{id}/{name}/index.html")]
|
||||
|
|
@ -173,11 +173,7 @@ pub mod dev {
|
|||
|
||||
impl BodyEncoding for ResponseBuilder {
|
||||
fn get_encoding(&self) -> Option<ContentEncoding> {
|
||||
if let Some(ref enc) = self.extensions().get::<Enc>() {
|
||||
Some(enc.0)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
self.extensions().get::<Enc>().map(|enc| enc.0)
|
||||
}
|
||||
|
||||
fn encoding(&mut self, encoding: ContentEncoding) -> &mut Self {
|
||||
|
|
@ -188,11 +184,7 @@ pub mod dev {
|
|||
|
||||
impl<B> BodyEncoding for Response<B> {
|
||||
fn get_encoding(&self) -> Option<ContentEncoding> {
|
||||
if let Some(ref enc) = self.extensions().get::<Enc>() {
|
||||
Some(enc.0)
|
||||
} else {
|
||||
None
|
||||
}
|
||||
self.extensions().get::<Enc>().map(|enc| enc.0)
|
||||
}
|
||||
|
||||
fn encoding(&mut self, encoding: ContentEncoding) -> &mut Self {
|
||||
|
|
|
|||
|
|
@ -16,7 +16,7 @@ use crate::{error::Error, service::ServiceResponse};
|
|||
/// [`Scope::wrap`](crate::Scope::wrap) and [`Condition`](super::Condition).
|
||||
///
|
||||
/// # Examples
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::middleware::{Logger, Compat};
|
||||
/// use actix_web::{App, web};
|
||||
///
|
||||
|
|
|
|||
|
|
@ -31,7 +31,7 @@ use crate::{
|
|||
/// encoding to `ContentEncoding::Identity`.
|
||||
///
|
||||
/// # Examples
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, middleware, App, HttpResponse};
|
||||
///
|
||||
/// let app = App::new()
|
||||
|
|
@ -197,22 +197,23 @@ impl AcceptEncoding {
|
|||
|
||||
/// Parse a raw Accept-Encoding header value into an ordered list.
|
||||
pub fn parse(raw: &str, encoding: ContentEncoding) -> ContentEncoding {
|
||||
let mut encodings: Vec<_> = raw
|
||||
let mut encodings = raw
|
||||
.replace(' ', "")
|
||||
.split(',')
|
||||
.map(|l| AcceptEncoding::new(l))
|
||||
.collect();
|
||||
.flatten()
|
||||
.collect::<Vec<_>>();
|
||||
|
||||
encodings.sort();
|
||||
|
||||
for enc in encodings {
|
||||
if let Some(enc) = enc {
|
||||
if encoding == ContentEncoding::Auto {
|
||||
return enc.encoding;
|
||||
} else if encoding == enc.encoding {
|
||||
return encoding;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
ContentEncoding::Identity
|
||||
}
|
||||
}
|
||||
|
|
|
|||
|
|
@ -12,7 +12,7 @@ use futures_util::future::{Either, FutureExt, LocalBoxFuture};
|
|||
/// middleware for a workaround.
|
||||
///
|
||||
/// # Examples
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::middleware::{Condition, NormalizePath};
|
||||
/// use actix_web::App;
|
||||
///
|
||||
|
|
@ -106,6 +106,7 @@ mod tests {
|
|||
HttpResponse,
|
||||
};
|
||||
|
||||
#[allow(clippy::unnecessary_wraps)]
|
||||
fn render_500<B>(mut res: ServiceResponse<B>) -> Result<ErrorHandlerResponse<B>> {
|
||||
res.response_mut()
|
||||
.headers_mut()
|
||||
|
|
|
|||
|
|
@ -29,7 +29,7 @@ use crate::{
|
|||
/// Headers with the same key that are already set in a response will *not* be overwritten.
|
||||
///
|
||||
/// # Examples
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, http, middleware, App, HttpResponse};
|
||||
///
|
||||
/// fn main() {
|
||||
|
|
|
|||
|
|
@ -34,7 +34,7 @@ type ErrorHandler<B> = dyn Fn(ServiceResponse<B>) -> Result<ErrorHandlerResponse
|
|||
/// for a given status code. Handlers can modify existing responses or create completely new ones.
|
||||
///
|
||||
/// # Examples
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::middleware::{ErrorHandlers, ErrorHandlerResponse};
|
||||
/// use actix_web::{web, http, dev, App, HttpRequest, HttpResponse, Result};
|
||||
///
|
||||
|
|
@ -182,6 +182,7 @@ mod tests {
|
|||
use crate::test::{self, TestRequest};
|
||||
use crate::HttpResponse;
|
||||
|
||||
#[allow(clippy::unnecessary_wraps)]
|
||||
fn render_500<B>(mut res: ServiceResponse<B>) -> Result<ErrorHandlerResponse<B>> {
|
||||
res.response_mut()
|
||||
.headers_mut()
|
||||
|
|
@ -205,6 +206,7 @@ mod tests {
|
|||
assert_eq!(resp.headers().get(CONTENT_TYPE).unwrap(), "0001");
|
||||
}
|
||||
|
||||
#[allow(clippy::unnecessary_wraps)]
|
||||
fn render_500_async<B: 'static>(
|
||||
mut res: ServiceResponse<B>,
|
||||
) -> Result<ErrorHandlerResponse<B>> {
|
||||
|
|
|
|||
|
|
@ -43,7 +43,7 @@ use crate::{
|
|||
/// ```
|
||||
///
|
||||
/// # Examples
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{middleware::Logger, App};
|
||||
///
|
||||
/// // access logs are printed with the INFO level so ensure it is enabled by default
|
||||
|
|
@ -124,7 +124,7 @@ impl Logger {
|
|||
/// It is convention to print "-" to indicate no output instead of an empty string.
|
||||
///
|
||||
/// # Example
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// # use actix_web::{http::HeaderValue, middleware::Logger};
|
||||
/// # fn parse_jwt_id (_req: Option<&HeaderValue>) -> String { "jwt_uid".to_owned() }
|
||||
/// Logger::new("example %{JWT_ID}xi")
|
||||
|
|
@ -363,7 +363,7 @@ impl Format {
|
|||
/// Returns `None` if the format string syntax is incorrect.
|
||||
pub fn new(s: &str) -> Format {
|
||||
log::trace!("Access log format: {}", s);
|
||||
let fmt = Regex::new(r"%(\{([A-Za-z0-9\-_]+)\}([aioe]|xi)|[atPrUsbTD]?)").unwrap();
|
||||
let fmt = Regex::new(r"%(\{([A-Za-z0-9\-_]+)\}([aioe]|xi)|[%atPrUsbTD]?)").unwrap();
|
||||
|
||||
let mut idx = 0;
|
||||
let mut results = Vec::new();
|
||||
|
|
@ -639,6 +639,38 @@ mod tests {
|
|||
let _res = srv.call(req).await.unwrap();
|
||||
}
|
||||
|
||||
#[actix_rt::test]
|
||||
async fn test_escape_percent() {
|
||||
let mut format = Format::new("%%{r}a");
|
||||
|
||||
let req = TestRequest::default()
|
||||
.insert_header((
|
||||
header::FORWARDED,
|
||||
header::HeaderValue::from_static("for=192.0.2.60;proto=http;by=203.0.113.43"),
|
||||
))
|
||||
.to_srv_request();
|
||||
|
||||
let now = OffsetDateTime::now_utc();
|
||||
for unit in &mut format.0 {
|
||||
unit.render_request(now, &req);
|
||||
}
|
||||
|
||||
let resp = HttpResponse::build(StatusCode::OK).force_close().finish();
|
||||
for unit in &mut format.0 {
|
||||
unit.render_response(&resp);
|
||||
}
|
||||
|
||||
let entry_time = OffsetDateTime::now_utc();
|
||||
let render = |fmt: &mut fmt::Formatter<'_>| {
|
||||
for unit in &format.0 {
|
||||
unit.render(fmt, 1024, entry_time)?;
|
||||
}
|
||||
Ok(())
|
||||
};
|
||||
let s = format!("{}", FormatDisplay(&render));
|
||||
assert_eq!(s, "%{r}a");
|
||||
}
|
||||
|
||||
#[actix_rt::test]
|
||||
async fn test_url_path() {
|
||||
let mut format = Format::new("%T %U");
|
||||
|
|
|
|||
|
|
@ -54,7 +54,7 @@ impl Default for TrailingSlash {
|
|||
/// `TrailingSlash::Always` behavior), as shown in the example tests below.
|
||||
///
|
||||
/// # Examples
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, middleware, App};
|
||||
///
|
||||
/// # actix_web::rt::System::new().block_on(async {
|
||||
|
|
|
|||
|
|
@ -159,7 +159,7 @@ impl HttpRequest {
|
|||
|
||||
/// Generate url for named resource
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// # use actix_web::{web, App, HttpRequest, HttpResponse};
|
||||
/// #
|
||||
/// fn index(req: HttpRequest) -> HttpResponse {
|
||||
|
|
@ -231,7 +231,7 @@ impl HttpRequest {
|
|||
///
|
||||
/// If `App::data` was used to store object, use `Data<T>`:
|
||||
///
|
||||
/// ```rust,ignore
|
||||
/// ```ignore
|
||||
/// let opt_t = req.app_data::<Data<T>>();
|
||||
/// ```
|
||||
pub fn app_data<T: 'static>(&self) -> Option<&T> {
|
||||
|
|
@ -302,7 +302,7 @@ impl Drop for HttpRequest {
|
|||
///
|
||||
/// ## Example
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpRequest};
|
||||
/// use serde_derive::Deserialize;
|
||||
///
|
||||
|
|
|
|||
|
|
@ -23,7 +23,7 @@ use crate::{dev::Payload, FromRequest, HttpRequest};
|
|||
/// provided to make this potential foot-gun more obvious.
|
||||
///
|
||||
/// # Example
|
||||
/// ```rust,no_run
|
||||
/// ```no_run
|
||||
/// # use actix_web::{web, HttpResponse, HttpRequest, Responder};
|
||||
///
|
||||
/// #[derive(Debug, Clone, PartialEq)]
|
||||
|
|
|
|||
|
|
@ -2,7 +2,6 @@ use std::cell::RefCell;
|
|||
use std::fmt;
|
||||
use std::future::Future;
|
||||
use std::rc::Rc;
|
||||
use std::task::Poll;
|
||||
|
||||
use actix_http::{Error, Extensions, Response};
|
||||
use actix_router::IntoPattern;
|
||||
|
|
@ -36,7 +35,7 @@ type HttpNewService = BoxServiceFactory<(), ServiceRequest, ServiceResponse, Err
|
|||
/// and check guards for specific route, if request matches all
|
||||
/// guards, route considered matched and route handler get called.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// fn main() {
|
||||
|
|
@ -98,7 +97,7 @@ where
|
|||
|
||||
/// Add match guard to a resource.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, guard, App, HttpResponse};
|
||||
///
|
||||
/// async fn index(data: web::Path<(String, String)>) -> &'static str {
|
||||
|
|
@ -131,7 +130,7 @@ where
|
|||
|
||||
/// Register a new route.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, guard, App, HttpResponse};
|
||||
///
|
||||
/// fn main() {
|
||||
|
|
@ -148,7 +147,7 @@ where
|
|||
/// Multiple routes could be added to a resource. Resource object uses
|
||||
/// match guards for route selection.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, guard, App};
|
||||
///
|
||||
/// fn main() {
|
||||
|
|
@ -173,7 +172,7 @@ where
|
|||
/// Provided data is available for all routes registered for the current resource.
|
||||
/// Resource data overrides data registered by `App::data()` method.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, FromRequest};
|
||||
///
|
||||
/// /// extract text data from request
|
||||
|
|
@ -212,7 +211,7 @@ where
|
|||
|
||||
/// Register a new route and add handler. This route matches all requests.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::*;
|
||||
///
|
||||
/// fn index(req: HttpRequest) -> HttpResponse {
|
||||
|
|
@ -224,7 +223,7 @@ where
|
|||
///
|
||||
/// This is shortcut for:
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// # extern crate actix_web;
|
||||
/// # use actix_web::*;
|
||||
/// # fn index(req: HttpRequest) -> HttpResponse { unimplemented!() }
|
||||
|
|
@ -290,7 +289,7 @@ where
|
|||
/// Resource level middlewares are not allowed to change response
|
||||
/// type (i.e modify response's body).
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_service::Service;
|
||||
/// use actix_web::{web, App};
|
||||
/// use actix_web::http::{header::CONTENT_TYPE, HeaderValue};
|
||||
|
|
@ -450,9 +449,9 @@ impl ServiceFactory<ServiceRequest> for ResourceFactory {
|
|||
.collect::<Result<Vec<_>, _>>()?;
|
||||
|
||||
Ok(ResourceService {
|
||||
routes,
|
||||
app_data,
|
||||
default,
|
||||
routes,
|
||||
})
|
||||
})
|
||||
}
|
||||
|
|
|
|||
|
|
@ -18,7 +18,7 @@ pub trait Responder {
|
|||
|
||||
/// Override a status code for a Responder.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{http::StatusCode, HttpRequest, Responder};
|
||||
///
|
||||
/// fn index(req: HttpRequest) -> impl Responder {
|
||||
|
|
@ -36,7 +36,7 @@ pub trait Responder {
|
|||
///
|
||||
/// Overrides other headers with the same name.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, HttpRequest, Responder};
|
||||
/// use serde::Serialize;
|
||||
///
|
||||
|
|
@ -155,8 +155,7 @@ impl Responder for BytesMut {
|
|||
pub struct CustomResponder<T> {
|
||||
responder: T,
|
||||
status: Option<StatusCode>,
|
||||
headers: Option<HeaderMap>,
|
||||
error: Option<HttpError>,
|
||||
headers: Result<HeaderMap, HttpError>,
|
||||
}
|
||||
|
||||
impl<T: Responder> CustomResponder<T> {
|
||||
|
|
@ -164,14 +163,13 @@ impl<T: Responder> CustomResponder<T> {
|
|||
CustomResponder {
|
||||
responder,
|
||||
status: None,
|
||||
headers: None,
|
||||
error: None,
|
||||
headers: Ok(HeaderMap::new()),
|
||||
}
|
||||
}
|
||||
|
||||
/// Override a status code for the Responder's response.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{HttpRequest, Responder, http::StatusCode};
|
||||
///
|
||||
/// fn index(req: HttpRequest) -> impl Responder {
|
||||
|
|
@ -187,7 +185,7 @@ impl<T: Responder> CustomResponder<T> {
|
|||
///
|
||||
/// Overrides other headers with the same name.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, HttpRequest, Responder};
|
||||
/// use serde::Serialize;
|
||||
///
|
||||
|
|
@ -206,14 +204,12 @@ impl<T: Responder> CustomResponder<T> {
|
|||
where
|
||||
H: IntoHeaderPair,
|
||||
{
|
||||
if self.headers.is_none() {
|
||||
self.headers = Some(HeaderMap::new());
|
||||
}
|
||||
|
||||
if let Ok(ref mut headers) = self.headers {
|
||||
match header.try_into_header_pair() {
|
||||
Ok((key, value)) => self.headers.as_mut().unwrap().append(key, value),
|
||||
Err(e) => self.error = Some(e.into()),
|
||||
Ok((key, value)) => headers.append(key, value),
|
||||
Err(e) => self.headers = Err(e.into()),
|
||||
};
|
||||
}
|
||||
|
||||
self
|
||||
}
|
||||
|
|
@ -221,17 +217,20 @@ impl<T: Responder> CustomResponder<T> {
|
|||
|
||||
impl<T: Responder> Responder for CustomResponder<T> {
|
||||
fn respond_to(self, req: &HttpRequest) -> HttpResponse {
|
||||
let headers = match self.headers {
|
||||
Ok(headers) => headers,
|
||||
Err(err) => return HttpResponse::from_error(Error::from(err)),
|
||||
};
|
||||
|
||||
let mut res = self.responder.respond_to(req);
|
||||
|
||||
if let Some(status) = self.status {
|
||||
*res.status_mut() = status;
|
||||
}
|
||||
|
||||
if let Some(ref headers) = self.headers {
|
||||
for (k, v) in headers {
|
||||
// TODO: before v4, decide if this should be append instead
|
||||
res.headers_mut().insert(k.clone(), v.clone());
|
||||
}
|
||||
res.headers_mut().insert(k, v);
|
||||
}
|
||||
|
||||
res
|
||||
|
|
|
|||
|
|
@ -90,7 +90,7 @@ impl Service<ServiceRequest> for RouteService {
|
|||
impl Route {
|
||||
/// Add method guard to the route.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// # use actix_web::*;
|
||||
/// # fn main() {
|
||||
/// App::new().service(web::resource("/path").route(
|
||||
|
|
@ -110,7 +110,7 @@ impl Route {
|
|||
|
||||
/// Add guard to the route.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// # use actix_web::*;
|
||||
/// # fn main() {
|
||||
/// App::new().service(web::resource("/path").route(
|
||||
|
|
@ -128,7 +128,7 @@ impl Route {
|
|||
|
||||
/// Set handler function, use request extractors for parameters.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, http, App};
|
||||
/// use serde_derive::Deserialize;
|
||||
///
|
||||
|
|
@ -152,7 +152,7 @@ impl Route {
|
|||
///
|
||||
/// It is possible to use multiple extractors for one handler function.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// # use std::collections::HashMap;
|
||||
/// # use serde_derive::Deserialize;
|
||||
/// use actix_web::{web, App};
|
||||
|
|
|
|||
15
src/scope.rs
15
src/scope.rs
|
|
@ -2,7 +2,6 @@ use std::cell::RefCell;
|
|||
use std::fmt;
|
||||
use std::future::Future;
|
||||
use std::rc::Rc;
|
||||
use std::task::Poll;
|
||||
|
||||
use actix_http::Extensions;
|
||||
use actix_router::{ResourceDef, Router};
|
||||
|
|
@ -41,7 +40,7 @@ type HttpNewService = BoxServiceFactory<(), ServiceRequest, ServiceResponse, Err
|
|||
/// You can get variable path segments from `HttpRequest::match_info()`.
|
||||
/// `Path` extractor also is able to extract scope level variable segments.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// fn main() {
|
||||
|
|
@ -98,7 +97,7 @@ where
|
|||
{
|
||||
/// Add match guard to a scope.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, guard, App, HttpRequest, HttpResponse};
|
||||
///
|
||||
/// async fn index(data: web::Path<(String, String)>) -> &'static str {
|
||||
|
|
@ -124,7 +123,7 @@ where
|
|||
/// Set or override application data. Application data could be accessed
|
||||
/// by using `Data<T>` extractor where `T` is data type.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use std::cell::Cell;
|
||||
/// use actix_web::{web, App, HttpResponse, Responder};
|
||||
///
|
||||
|
|
@ -169,7 +168,7 @@ where
|
|||
/// different module or even library. For example,
|
||||
/// some of the resource's configuration could be moved to different module.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// # extern crate actix_web;
|
||||
/// use actix_web::{web, middleware, App, HttpResponse};
|
||||
///
|
||||
|
|
@ -216,7 +215,7 @@ where
|
|||
/// * *Scope* is a set of resources with common root path.
|
||||
/// * "StaticFiles" is a service for static files support
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpRequest};
|
||||
///
|
||||
/// struct AppState;
|
||||
|
|
@ -248,7 +247,7 @@ where
|
|||
/// This method can be called multiple times, in that case
|
||||
/// multiple resources with one route would be registered for same resource path.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// async fn index(data: web::Path<(String, String)>) -> &'static str {
|
||||
|
|
@ -342,7 +341,7 @@ where
|
|||
/// to Route or Application level middleware, in that Scope-level middleware
|
||||
/// can not modify ServiceResponse.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_service::Service;
|
||||
/// use actix_web::{web, App};
|
||||
/// use actix_web::http::{header::CONTENT_TYPE, HeaderValue};
|
||||
|
|
|
|||
|
|
@ -12,13 +12,6 @@ use actix_http::{
|
|||
use actix_server::{Server, ServerBuilder};
|
||||
use actix_service::{map_config, IntoServiceFactory, Service, ServiceFactory};
|
||||
|
||||
#[cfg(unix)]
|
||||
use actix_http::Protocol;
|
||||
#[cfg(unix)]
|
||||
use actix_service::pipeline_factory;
|
||||
#[cfg(unix)]
|
||||
use futures_util::future::ok;
|
||||
|
||||
#[cfg(feature = "openssl")]
|
||||
use actix_tls::accept::openssl::{AlpnError, SslAcceptor, SslAcceptorBuilder};
|
||||
#[cfg(feature = "rustls")]
|
||||
|
|
@ -42,7 +35,7 @@ struct Config {
|
|||
///
|
||||
/// Create new HTTP server with application factory.
|
||||
///
|
||||
/// ```rust,no_run
|
||||
/// ```no_run
|
||||
/// use actix_web::{web, App, HttpResponse, HttpServer};
|
||||
///
|
||||
/// #[actix_rt::main]
|
||||
|
|
@ -489,7 +482,9 @@ where
|
|||
#[cfg(unix)]
|
||||
/// Start listening for unix domain (UDS) connections on existing listener.
|
||||
pub fn listen_uds(mut self, lst: std::os::unix::net::UnixListener) -> io::Result<Self> {
|
||||
use actix_http::Protocol;
|
||||
use actix_rt::net::UnixStream;
|
||||
use actix_service::pipeline_factory;
|
||||
|
||||
let cfg = self.config.clone();
|
||||
let factory = self.factory.clone();
|
||||
|
|
@ -511,13 +506,16 @@ where
|
|||
c.host.clone().unwrap_or_else(|| format!("{}", socket_addr)),
|
||||
);
|
||||
|
||||
pipeline_factory(|io: UnixStream| ok((io, Protocol::Http1, None))).and_then({
|
||||
pipeline_factory(|io: UnixStream| async { Ok((io, Protocol::Http1, None)) })
|
||||
.and_then({
|
||||
let svc = HttpService::build()
|
||||
.keep_alive(c.keep_alive)
|
||||
.client_timeout(c.client_timeout);
|
||||
|
||||
let svc = if let Some(handler) = on_connect_fn.clone() {
|
||||
svc.on_connect_ext(move |io: &_, ext: _| (&*handler)(io as &dyn Any, ext))
|
||||
svc.on_connect_ext(move |io: &_, ext: _| {
|
||||
(&*handler)(io as &dyn Any, ext)
|
||||
})
|
||||
} else {
|
||||
svc
|
||||
};
|
||||
|
|
@ -534,7 +532,9 @@ where
|
|||
where
|
||||
A: AsRef<std::path::Path>,
|
||||
{
|
||||
use actix_http::Protocol;
|
||||
use actix_rt::net::UnixStream;
|
||||
use actix_service::pipeline_factory;
|
||||
|
||||
let cfg = self.config.clone();
|
||||
let factory = self.factory.clone();
|
||||
|
|
@ -555,7 +555,8 @@ where
|
|||
socket_addr,
|
||||
c.host.clone().unwrap_or_else(|| format!("{}", socket_addr)),
|
||||
);
|
||||
pipeline_factory(|io: UnixStream| ok((io, Protocol::Http1, None))).and_then(
|
||||
pipeline_factory(|io: UnixStream| async { Ok((io, Protocol::Http1, None)) })
|
||||
.and_then(
|
||||
HttpService::build()
|
||||
.keep_alive(c.keep_alive)
|
||||
.client_timeout(c.client_timeout)
|
||||
|
|
@ -587,7 +588,7 @@ where
|
|||
/// This methods panics if no socket address can be bound or an `Actix` system is not yet
|
||||
/// configured.
|
||||
///
|
||||
/// ```rust,no_run
|
||||
/// ```no_run
|
||||
/// use std::io;
|
||||
/// use actix_web::{web, App, HttpResponse, HttpServer};
|
||||
///
|
||||
|
|
@ -606,17 +607,14 @@ where
|
|||
|
||||
fn create_tcp_listener(addr: net::SocketAddr, backlog: u32) -> io::Result<net::TcpListener> {
|
||||
use socket2::{Domain, Protocol, Socket, Type};
|
||||
let domain = match addr {
|
||||
net::SocketAddr::V4(_) => Domain::ipv4(),
|
||||
net::SocketAddr::V6(_) => Domain::ipv6(),
|
||||
};
|
||||
let socket = Socket::new(domain, Type::stream(), Some(Protocol::tcp()))?;
|
||||
let domain = Domain::for_address(addr);
|
||||
let socket = Socket::new(domain, Type::STREAM, Some(Protocol::TCP))?;
|
||||
socket.set_reuse_address(true)?;
|
||||
socket.bind(&addr.into())?;
|
||||
// clamp backlog to max u32 that fits in i32 range
|
||||
let backlog = cmp::min(backlog, i32::MAX as u32) as i32;
|
||||
socket.listen(backlog)?;
|
||||
Ok(socket.into_tcp_listener())
|
||||
Ok(net::TcpListener::from(socket))
|
||||
}
|
||||
|
||||
#[cfg(feature = "openssl")]
|
||||
|
|
|
|||
|
|
@ -462,7 +462,7 @@ impl WebService {
|
|||
|
||||
/// Add match guard to a web service.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, guard, dev, App, Error, HttpResponse};
|
||||
///
|
||||
/// async fn index(req: dev::ServiceRequest) -> Result<dev::ServiceResponse, Error> {
|
||||
|
|
@ -573,31 +573,28 @@ macro_rules! services {
|
|||
}
|
||||
|
||||
/// HttpServiceFactory trait impl for tuples
|
||||
macro_rules! service_tuple ({ $(($n:tt, $T:ident)),+} => {
|
||||
macro_rules! service_tuple ({ $($T:ident)+ } => {
|
||||
impl<$($T: HttpServiceFactory),+> HttpServiceFactory for ($($T,)+) {
|
||||
#[allow(non_snake_case)]
|
||||
fn register(self, config: &mut AppService) {
|
||||
$(self.$n.register(config);)+
|
||||
let ($($T,)*) = self;
|
||||
$($T.register(config);)+
|
||||
}
|
||||
}
|
||||
});
|
||||
|
||||
#[rustfmt::skip]
|
||||
mod m {
|
||||
use super::*;
|
||||
|
||||
service_tuple!((0, A));
|
||||
service_tuple!((0, A), (1, B));
|
||||
service_tuple!((0, A), (1, B), (2, C));
|
||||
service_tuple!((0, A), (1, B), (2, C), (3, D));
|
||||
service_tuple!((0, A), (1, B), (2, C), (3, D), (4, E));
|
||||
service_tuple!((0, A), (1, B), (2, C), (3, D), (4, E), (5, F));
|
||||
service_tuple!((0, A), (1, B), (2, C), (3, D), (4, E), (5, F), (6, G));
|
||||
service_tuple!((0, A), (1, B), (2, C), (3, D), (4, E), (5, F), (6, G), (7, H));
|
||||
service_tuple!((0, A), (1, B), (2, C), (3, D), (4, E), (5, F), (6, G), (7, H), (8, I));
|
||||
service_tuple!((0, A), (1, B), (2, C), (3, D), (4, E), (5, F), (6, G), (7, H), (8, I), (9, J));
|
||||
service_tuple!((0, A), (1, B), (2, C), (3, D), (4, E), (5, F), (6, G), (7, H), (8, I), (9, J), (10, K));
|
||||
service_tuple!((0, A), (1, B), (2, C), (3, D), (4, E), (5, F), (6, G), (7, H), (8, I), (9, J), (10, K), (11, L));
|
||||
}
|
||||
service_tuple! { A }
|
||||
service_tuple! { A B }
|
||||
service_tuple! { A B C }
|
||||
service_tuple! { A B C D }
|
||||
service_tuple! { A B C D E }
|
||||
service_tuple! { A B C D E F }
|
||||
service_tuple! { A B C D E F G }
|
||||
service_tuple! { A B C D E F G H }
|
||||
service_tuple! { A B C D E F G H I }
|
||||
service_tuple! { A B C D E F G H I J }
|
||||
service_tuple! { A B C D E F G H I J K }
|
||||
service_tuple! { A B C D E F G H I J K L }
|
||||
|
||||
#[cfg(test)]
|
||||
mod tests {
|
||||
|
|
|
|||
24
src/test.rs
24
src/test.rs
|
|
@ -54,7 +54,7 @@ pub fn default_service(
|
|||
/// This method accepts application builder instance, and constructs
|
||||
/// service.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_service::Service;
|
||||
/// use actix_web::{test, web, App, HttpResponse, http::StatusCode};
|
||||
///
|
||||
|
|
@ -101,7 +101,7 @@ where
|
|||
|
||||
/// Calls service and waits for response future completion.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{test, web, App, HttpResponse, http::StatusCode};
|
||||
///
|
||||
/// #[actix_rt::test]
|
||||
|
|
@ -131,7 +131,7 @@ where
|
|||
|
||||
/// Helper function that returns a response body of a TestRequest
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{test, web, App, HttpResponse, http::header};
|
||||
/// use bytes::Bytes;
|
||||
///
|
||||
|
|
@ -174,7 +174,7 @@ where
|
|||
|
||||
/// Helper function that returns a response body of a ServiceResponse.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{test, web, App, HttpResponse, http::header};
|
||||
/// use bytes::Bytes;
|
||||
///
|
||||
|
|
@ -212,7 +212,7 @@ where
|
|||
|
||||
/// Helper function that returns a deserialized response body of a ServiceResponse.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{App, test, web, HttpResponse, http::header};
|
||||
/// use serde::{Serialize, Deserialize};
|
||||
///
|
||||
|
|
@ -275,7 +275,7 @@ where
|
|||
|
||||
/// Helper function that returns a deserialized response body of a TestRequest
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{App, test, web, HttpResponse, http::header};
|
||||
/// use serde::{Serialize, Deserialize};
|
||||
///
|
||||
|
|
@ -332,7 +332,7 @@ where
|
|||
/// * `TestRequest::to_srv_response` creates `ServiceResponse` instance.
|
||||
/// * `TestRequest::to_http_request` creates `HttpRequest` instance, which is used for testing handlers.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{test, HttpRequest, HttpResponse, HttpMessage};
|
||||
/// use actix_web::http::{header, StatusCode};
|
||||
///
|
||||
|
|
@ -580,7 +580,7 @@ impl TestRequest {
|
|||
///
|
||||
/// # Examples
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, test, App, HttpResponse, Error};
|
||||
///
|
||||
/// async fn my_handler() -> Result<HttpResponse, Error> {
|
||||
|
|
@ -620,7 +620,7 @@ where
|
|||
///
|
||||
/// # Examples
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, test, App, HttpResponse, Error};
|
||||
///
|
||||
/// async fn my_handler() -> Result<HttpResponse, Error> {
|
||||
|
|
@ -782,10 +782,10 @@ where
|
|||
};
|
||||
|
||||
TestServer {
|
||||
ssl,
|
||||
addr,
|
||||
client,
|
||||
system,
|
||||
ssl,
|
||||
server,
|
||||
}
|
||||
}
|
||||
|
|
@ -870,10 +870,10 @@ impl TestServerConfig {
|
|||
/// Get first available unused address
|
||||
pub fn unused_addr() -> net::SocketAddr {
|
||||
let addr: net::SocketAddr = "127.0.0.1:0".parse().unwrap();
|
||||
let socket = Socket::new(Domain::ipv4(), Type::stream(), Some(Protocol::tcp())).unwrap();
|
||||
let socket = Socket::new(Domain::IPV4, Type::STREAM, Some(Protocol::TCP)).unwrap();
|
||||
socket.bind(&addr.into()).unwrap();
|
||||
socket.set_reuse_address(true).unwrap();
|
||||
let tcp = socket.into_tcp_listener();
|
||||
let tcp = net::TcpListener::from(socket);
|
||||
tcp.local_addr().unwrap()
|
||||
}
|
||||
|
||||
|
|
|
|||
|
|
@ -20,7 +20,7 @@ use crate::{dev::Payload, error::PathError, FromRequest, HttpRequest};
|
|||
/// // extract path info from "/{name}/{count}/index.html" into tuple
|
||||
/// // {name} - deserialize a String
|
||||
/// // {count} - deserialize a u32
|
||||
/// #[get("/")]
|
||||
/// #[get("/{name}/{count}/index.html")]
|
||||
/// async fn index(path: web::Path<(String, u32)>) -> String {
|
||||
/// let (name, count) = path.into_inner();
|
||||
/// format!("Welcome {}! {}", name, count)
|
||||
|
|
@ -40,7 +40,7 @@ use crate::{dev::Payload, error::PathError, FromRequest, HttpRequest};
|
|||
/// }
|
||||
///
|
||||
/// // extract `Info` from a path using serde
|
||||
/// #[get("/")]
|
||||
/// #[get("/{name}")]
|
||||
/// async fn index(info: web::Path<Info>) -> String {
|
||||
/// format!("Welcome {}!", info.name)
|
||||
/// }
|
||||
|
|
|
|||
24
src/web.rs
24
src/web.rs
|
|
@ -42,7 +42,7 @@ pub use crate::types::*;
|
|||
/// `/users/{userid}/{friend}` and store `userid` and `friend` in
|
||||
/// the exposed `Params` object:
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// # extern crate actix_web;
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
|
|
@ -61,7 +61,7 @@ pub fn resource<T: IntoPattern>(path: T) -> Resource {
|
|||
/// Scopes collect multiple paths under a common path prefix.
|
||||
/// Scope path can contain variable path segments as resources.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// let app = App::new().service(
|
||||
|
|
@ -88,7 +88,7 @@ pub fn route() -> Route {
|
|||
|
||||
/// Create *route* with `GET` method guard.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// let app = App::new().service(
|
||||
|
|
@ -106,7 +106,7 @@ pub fn get() -> Route {
|
|||
|
||||
/// Create *route* with `POST` method guard.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// let app = App::new().service(
|
||||
|
|
@ -124,7 +124,7 @@ pub fn post() -> Route {
|
|||
|
||||
/// Create *route* with `PUT` method guard.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// let app = App::new().service(
|
||||
|
|
@ -142,7 +142,7 @@ pub fn put() -> Route {
|
|||
|
||||
/// Create *route* with `PATCH` method guard.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// let app = App::new().service(
|
||||
|
|
@ -160,7 +160,7 @@ pub fn patch() -> Route {
|
|||
|
||||
/// Create *route* with `DELETE` method guard.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// let app = App::new().service(
|
||||
|
|
@ -178,7 +178,7 @@ pub fn delete() -> Route {
|
|||
|
||||
/// Create *route* with `HEAD` method guard.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// let app = App::new().service(
|
||||
|
|
@ -196,7 +196,7 @@ pub fn head() -> Route {
|
|||
|
||||
/// Create *route* with `TRACE` method guard.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse};
|
||||
///
|
||||
/// let app = App::new().service(
|
||||
|
|
@ -214,7 +214,7 @@ pub fn trace() -> Route {
|
|||
|
||||
/// Create *route* and add method guard.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, http, App, HttpResponse};
|
||||
///
|
||||
/// let app = App::new().service(
|
||||
|
|
@ -232,7 +232,7 @@ pub fn method(method: Method) -> Route {
|
|||
|
||||
/// Create a new route and add handler.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{web, App, HttpResponse, Responder};
|
||||
///
|
||||
/// async fn index() -> impl Responder {
|
||||
|
|
@ -256,7 +256,7 @@ where
|
|||
|
||||
/// Create raw service for a specific path.
|
||||
///
|
||||
/// ```rust
|
||||
/// ```
|
||||
/// use actix_web::{dev, web, guard, App, Error, HttpResponse};
|
||||
///
|
||||
/// async fn my_service(req: dev::ServiceRequest) -> Result<dev::ServiceResponse, Error> {
|
||||
|
|
|
|||
|
|
@ -1,15 +1,11 @@
|
|||
use std::sync::mpsc;
|
||||
use std::{thread, time::Duration};
|
||||
|
||||
#[cfg(feature = "openssl")]
|
||||
extern crate tls_openssl as openssl;
|
||||
#[cfg(feature = "rustls")]
|
||||
extern crate tls_rustls as rustls;
|
||||
|
||||
#[cfg(feature = "openssl")]
|
||||
use openssl::ssl::SslAcceptorBuilder;
|
||||
|
||||
use actix_web::{test, web, App, HttpResponse, HttpServer};
|
||||
#[cfg(any(unix, feature = "openssl"))]
|
||||
use {
|
||||
actix_web::{test, web, App, HttpResponse, HttpServer},
|
||||
std::{sync::mpsc, thread, time::Duration},
|
||||
};
|
||||
|
||||
#[cfg(unix)]
|
||||
#[actix_rt::test]
|
||||
|
|
@ -72,7 +68,7 @@ async fn test_start() {
|
|||
}
|
||||
|
||||
#[cfg(feature = "openssl")]
|
||||
fn ssl_acceptor() -> std::io::Result<SslAcceptorBuilder> {
|
||||
fn ssl_acceptor() -> openssl::ssl::SslAcceptorBuilder {
|
||||
use openssl::{
|
||||
pkey::PKey,
|
||||
ssl::{SslAcceptor, SslMethod},
|
||||
|
|
@ -89,7 +85,7 @@ fn ssl_acceptor() -> std::io::Result<SslAcceptorBuilder> {
|
|||
builder.set_certificate(&cert).unwrap();
|
||||
builder.set_private_key(&key).unwrap();
|
||||
|
||||
Ok(builder)
|
||||
builder
|
||||
}
|
||||
|
||||
#[actix_rt::test]
|
||||
|
|
@ -102,7 +98,7 @@ async fn test_start_ssl() {
|
|||
|
||||
thread::spawn(move || {
|
||||
let sys = actix_rt::System::new();
|
||||
let builder = ssl_acceptor().unwrap();
|
||||
let builder = ssl_acceptor();
|
||||
|
||||
let srv = HttpServer::new(|| {
|
||||
App::new().service(web::resource("/").route(web::to(|req: HttpRequest| {
|
||||
|
|
|
|||
Loading…
Reference in New Issue